Revision as of 18:24, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 426422969 of page 5,10-Methenyltetrahydrofolate for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 18:25, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 464482216 of page 5,10-Methylenetetrahydrofolate for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
⚫ |
| verifiedrevid = 443353978 |
|
| Watchedfields = changed |
|
|
⚫ |
|ImageFile=5,10-methylenetetrahydrofolic acid.svg |
⚫ |
| verifiedrevid = 408391878 |
|
⚫ |
|ImageFile=5,10-Methenyltetrahydrofolate.svg |
|
|
|ImageSize= |
|
|ImageSize= |
|
|IUPACName= ''N''-pteridin-10-ium-8-yl)benzoyl]-<small>L</small>-glutamic acid |
|
|IUPACName= ''N''-pteridin-8(9''H'')-yl)benzoyl]-<small>L</small>-glutamic acid |
|
|OtherNames= 5,10-CH=THF |
|
|OtherNames=5,10-CH<sub>2</sub>-THF,<br>MTHF |
|
|Section1= {{Chembox Identifiers |
|
|Section1= {{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 133 |
|
| ChemSpiderID = 97272 |
|
| InChI = 1/C20H21N7O6/c21-20-24-16-15(18(31)25-20)27-9-26(8-12(27)7-22-16)11-3-1-10(2-4-11)17(30)23-13(19(32)33)5-6-14(28)29/h1-4,9,12-13H,5-8H2,(H6-,21,22,23,24,25,28,29,30,31,32,33)/p+1 |
|
| InChI = 1/C20H23N7O6/c21-20-24-16-15(18(31)25-20)27-9-26(8-12(27)7-22-16)11-3-1-10(2-4-11)17(30)23-13(19(32)33)5-6-14(28)29/h1-4,12-13H,5-9H2,(H,23,30)(H,28,29)(H,32,33)(H4,21,22,24,25,31)/t12?,13-/m0/s1 |
|
| InChIKey = MEANFMOQMXYMCT-IKLDFBCSAN |
|
| InChIKey = QYNUQALWYRSVHF-ABLWVSNPBB |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 46521 |
|
| ChEMBL = 117348 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C20H21N7O6/c21-20-24-16-15(18(31)25-20)27-9-26(8-12(27)7-22-16)11-3-1-10(2-4-11)17(30)23-13(19(32)33)5-6-14(28)29/h1-4,9,12-13H,5-8H2,(H6-,21,22,23,24,25,28,29,30,31,32,33)/p+1 |
|
| StdInChI = 1S/C20H23N7O6/c21-20-24-16-15(18(31)25-20)27-9-26(8-12(27)7-22-16)11-3-1-10(2-4-11)17(30)23-13(19(32)33)5-6-14(28)29/h1-4,12-13H,5-9H2,(H,23,30)(H,28,29)(H,32,33)(H4,21,22,24,25,31)/t12?,13-/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = MEANFMOQMXYMCT-UHFFFAOYSA-O |
|
| StdInChIKey = QYNUQALWYRSVHF-ABLWVSNPSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = <!-- blanked - oldvalue: 7444-29-3 --> |
|
| CASNo = <!-- blanked - oldvalue: 3432-99-3 --> |
|
| PubChem=644350 |
|
| PubChem=108194 |
⚫ |
| SMILES = O=C(O)C(NC(=O)c1ccc(cc1)N4/C=3/C2=C(/N\C(=N/C2=O)N)NCC3C4)CCC(=O)O |
|
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
⚫ |
| MeSHName=5,10-methenyltetrahydrofolate |
|
|
|
| ChEBI = 20502 |
|
⚫ |
| SMILES = O=C(O)(NC(=O)c1ccc(cc1)N4CC3N(C=2C(=O)/N=C(/N)NC=2NC3)C4)CCC(=O)O |
|
⚫ |
| MeSHName=5,10-methylenetetrahydrofolate |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2= {{Chembox Properties |
|
| Formula=C<sub>20</sub>H<sub>213</sub>N<sub>7</sub>O<sub>6</sub> |
|
| Formula=C<sub>20</sub>H<sub>23</sub>N<sub>7</sub>O<sub>6</sub> |
|
| MolarMass=455.42 g/mol |
|
| MolarMass=457.44 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |