Revision as of 18:27, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456620789 of page 5-Bromo-DMT for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 18:27, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 443355526 of page 5-Bromouracil for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 413275757 |
|
| verifiedrevid = 443354280 |
|
|
| ImageFile = 5-Bromouracil structure.png |
|
| Name = 5-Bromo-DMT |
|
|
⚫ |
| ImageSize = 150px |
|
| ImageFile = 5-Bromo-DMT.svg |
|
|
|
| IUPACName = 5-Bromo-1H-pyrimidine-2,4-dione |
⚫ |
| ImageSize = 200px |
|
|
|
| OtherNames = 5-Bromo-2,4-dihydroxypyrimidine |
|
| ImageName = |
|
|
| IUPACName = dimethylamine |
|
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
|
| Abbreviations = 5-BrU<br>5-BU |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 319812 |
|
| ChemSpiderID = 5597 |
|
| InChI = 1/C12H15BrN2/c1-15(2)6-5-9-8-14-12-4-3-10(13)7-11(9)12/h3-4,7-8,14H,5-6H2,1-2H3 |
|
|
| InChIKey = ATEYZYQLBQUZJE-UHFFFAOYAL |
|
| InChIKey = LQLQRFGHAALLLE-UHFFFAOYAN |
|
| SMILES1 = CN(C)CCc2cnc1ccc(Br)cc12 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 403031 |
|
| ChEMBL = 144730 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C12H15BrN2/c1-15(2)6-5-9-8-14-12-4-3-10(13)7-11(9)12/h3-4,7-8,14H,5-6H2,1-2H3 |
|
| StdInChI = 1S/C4H3BrN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ATEYZYQLBQUZJE-UHFFFAOYSA-N |
|
| StdInChIKey = LQLQRFGHAALLLE-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 17274-65-6 --> |
|
| CASNo = 51-20-7 |
|
| PubChem = 360252 |
|
| EINECS = |
|
|
| PubChem = 5802 |
|
| SMILES = CN(C)CCC1=CNC2=C1C=C(Br)C=C2 |
|
|
|
| SMILES = Br/C1=C/NC(=O)NC1=O |
|
}} |
|
|
|
| InChI = 1/C4H3BrN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9) |
|
|
| RTECS = |
|
|
| MeSHName = |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 20552 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = |
|
|
| ATCCode_prefix = |
|
|
| ATCCode_suffix = |
|
|
| ATC_Supplemental =}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula = C<sub>12</sub>H<sub>15</sub>N<sub>2</sub>Br |
|
| Formula = C<sub>4</sub>H<sub>3</sub>BrN<sub>2</sub>O<sub>2</sub> |
|
| MolarMass = |
|
| MolarMass = 190.983 g/mol |
|
| Density = |
|
| Appearance = |
|
|
| Density = |
|
| MeltingPt = 98-99 °C |
|
| MeltingPt = |
⚫ |
| BoilingPt = |
|
|
|
| Melting_notes = |
|
}} |
|
|
⚫ |
| BoilingPt = |
|
|
| Boiling_notes = |
|
|
| Solubility = |
|
|
| SolubleOther = |
|
|
| Solvent = |
|
|
| pKa = |
|
|
| pKb = }} |
|
|
| Section7 = {{Chembox Hazards |
|
|
| EUClass = |
|
|
| EUIndex = |
|
|
| MainHazards = |
|
|
| NFPA-H = |
|
|
| NFPA-F = |
|
|
| NFPA-R = |
|
|
| NFPA-O = |
|
|
| RPhrases = |
|
|
| SPhrases = |
|
|
| RSPhrases = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
| ExploLimits = |
|
|
| PEL = }} |
|
}} |
|
}} |