| Revision as of 18:35, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Saving copy of the {{chembox}} taken from revid 443357128 of page 6-APA for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 18:35, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Saving copy of the {{drugbox}} taken from revid 472062495 of page 6-APB for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
| verifiedrevid = 443355903 |
|
| verifiedrevid = 455351623 |
|
|
| IUPAC_name = 6-(2-aminopropyl)benzofuran |
|
| Name = 6-Aminopenicillanic acid |
|
|
|
| image = 6-APB_structure.png |
|
| ImageFile = 6-Aminopenicillanic acid.svg |
|
|
|
| image2 = 6-APB Animation2.gif |
|
| ImageSize = 250px |
|
|
|
|
|
| ImageName = 6-Aminopenicillanic acid |
|
|
|
<!--Clinical data--> |
|
| |
|
|
|
| tradename = |
|
| IUPACName = (2S,5R,6R)-6-Amino-3,3-dimethyl-7-oxo-4- thia-1-azabicycloheptane-2- carboxylic acid |
|
|
|
| pregnancy_category = ? |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| legal_status = Uncontrolled |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
|
| ⚫ |
| ChemSpiderID = 10611 |
|
|
|
<!--Pharmacokinetic data--> |
|
| InChI = 1/C8H12N2O3S/c1-8(2)4(7(12)13)10-5(11)3(9)6(10)14-8/h3-4,6H,9H2,1-2H3,(H,12,13)/t3-,4+,6-/m1/s1 |
|
|
|
| bioavailability = |
|
| InChIKey = NGHVIOIJCVXTGV-ALEPSDHEBW |
|
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = <!-- blanked - oldvalue: 286834-85-3 --> |
|
|
| CAS_supplemental = <br /> 286834-84-2 (hydrochloride) |
|
|
| ATC_prefix = none |
|
|
| ATC_suffix = |
|
⚫ |
| PubChem = 9794343 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 7970110 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=11 | H=13 | N=1 | O=1 |
|
|
| molecular_weight = 175.23 g/mol |
|
|
| smiles = o2c1cc(ccc1cc2)CC(N)C |
|
|
| InChI = 1/C11H13NO/c1-8(12)6-9-2-3-10-4-5-13-11(10)7-9/h2-5,7-8H,6,12H2,1H3 |
|
|
| InChIKey = FQDAMYLMQQKPRX-UHFFFAOYAX |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C8H12N2O3S/c1-8(2)4(7(12)13)10-5(11)3(9)6(10)14-8/h3-4,6H,9H2,1-2H3,(H,12,13)/t3-,4+,6-/m1/s1 |
|
| StdInChI = 1S/C11H13NO/c1-8(12)6-9-2-3-10-4-5-13-11(10)7-9/h2-5,7-8H,6,12H2,1H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = NGHVIOIJCVXTGV-ALEPSDHESA-N |
|
| StdInChIKey = FQDAMYLMQQKPRX-UHFFFAOYSA-N |
| ⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo = 551-16-6 |
|
| ⚫ |
| PubChem = 11082 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 57869 |
|
|
| SMILES = O=C(O)1N2C(=O)(N)2SC1(C)C |
|
|
| RTECS = |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>8</sub>H<sub>12</sub>N<sub>2</sub>O<sub>3</sub>S<sub></sub> |
|
|
| MolarMass = 216.25 g/mol |
|
|
| MeltingPt = 198 - 200 °C |
|
|
| BoilingPt = > 200 °C (decomposes) |
|
|
| |
|
|
}} |
|
|
| Section3 = {{Chembox Structure |
|
|
| |
|
|
}} |
|
|
| |
|
|
}} |
|
}} |
