| Revision as of 05:21, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 449577696 of page Allylglycine for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 05:22, 17 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 448081843 of page Allylnorpethidine for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
| verifiedrevid = 402708622 |
|
| verifiedrevid = 421226707 |
|
|
| IUPAC_name = ethyl 4-phenyl-1-prop-2-enylpiperidine-4-carboxylate |
|
|ImageFile=Allylglycine.png |
|
|
|
| image = WIN-7681.svg |
|
|ImageSize=180px |
|
|
|
| width = 160 |
|
|IUPACName=2-Aminopent-4-enoic acid |
|
|
|
|
|
|OtherNames= |
|
|
|
<!--Clinical data--> |
|
|Section1={{Chembox Identifiers |
|
|
|
| tradename = |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| ⚫ |
| ChemSpiderID = 13425 |
|
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| InChI = 1/C5H9NO2/c1-2-3-4(6)5(7)8/h2,4H,1,3,6H2,(H,7,8) |
|
|
|
| pregnancy_category = |
|
| InChIKey = WNNNWFKQCKFSDK-UHFFFAOYAL |
|
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| SMILES1 = O=C(O)C(N)CC=C |
|
|
|
| legal_CA = <!-- Schedule I --> |
|
|
| legal_UK = |
|
|
| legal_US = |
|
|
| legal_status = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| protein_bound = |
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 2372-70-5 --> |
|
|
| ATC_prefix = none |
|
|
| ATC_suffix = |
|
⚫ |
| PubChem = 16915 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 16026 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=17 | H=23 | N=1 | O=2 |
|
|
| molecular_weight = 273.37 g/mol |
|
|
| smiles = O=C(OCC)C2(c1ccccc1)CCN(C\C=C)CC2 |
|
|
| InChI = 1/C17H23NO2/c1-3-12-18-13-10-17(11-14-18,16(19)20-4-2)15-8-6-5-7-9-15/h3,5-9H,1,4,10-14H2,2H3 |
|
|
| InChIKey = YUNKDDDGCRLMAF-UHFFFAOYAA |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C5H9NO2/c1-2-3-4(6)5(7)8/h2,4H,1,3,6H2,(H,7,8) |
|
| StdInChI = 1S/C17H23NO2/c1-3-12-18-13-10-17(11-14-18,16(19)20-4-2)15-8-6-5-7-9-15/h3,5-9H,1,4,10-14H2,2H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = WNNNWFKQCKFSDK-UHFFFAOYSA-N |
|
| StdInChIKey = YUNKDDDGCRLMAF-UHFFFAOYSA-N |
|
|
| synonyms = Allylnorpethidine, WIN-7681 |
| ⚫ |
| CASNo = <!-- blanked - oldvalue: 7685-44-1 --> |
|
| ⚫ |
| PubChem=14044 |
|
|
| SMILES=C=CCC(C(=O)O)N |
|
|
}} |
|
|
|Section2={{Chembox Properties |
|
|
| Formula=C<sub>5</sub>H<sub>9</sub>NO<sub>2</sub> |
|
|
| MolarMass=115.13 g/mol |
|
|
| Appearance= |
|
|
| Density= |
|
|
| MeltingPtC=265 |
|
|
| BoilingPt= |
|
|
| Solubility= |
|
|
}} |
|
|
|Section3={{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
|
}} |
|
}} |
