Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 09:23, 10 April 2012 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{chembox}} taken from revid 483835854 of page Mercury(II)_oxide for the Chem/Drugbox validation project (updated: 'StdInChI').← Previous edit		Revision as of 09:58, 10 April 2012 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{chembox}} taken from revid 477363580 of page Octyl_cyanoacrylate for the Chem/Drugbox validation project (updated: 'CASNo').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{chembox		{{chembox
	\| Verifiedfields = changed		\| Verifiedfields = changed
			\| Watchedfields = changed
	\| verifiedrevid = ~~470455221~~		\| verifiedrevid = 426563450
	\| ImageFile = HgOpowder.jpg
			\| ImageFile = Octyl-cyanoacrylate-2D-skeletal.svg
	\| ImageName = Mercury(II) oxide
			\| ImageSize = 200px
⚫	\| ImageFile1 = ~~Montroydite~~-3D-~~ionic~~.png
	\| ~~ImageName1~~ = ~~Mercury(II)~~ ~~oxide~~		\| ImageName = Skeletal formula
		⚫	\| ImageFile1 = Octyl-cyanoacrylate-3D-balls.png
	\| IUPACName = Mercury(II) oxide
			\| ImageSize1 = 220px
	\| OtherNames = Mercuric oxide<br />]
			\| ImageName1 = Ball-and-stick model
			\| IUPACName = Octyl 2-cyanopropenoate
			\| OtherNames = Ocrylate; Octyl 2-cyanoacrylate
	\| Section1 = {{Chembox Identifiers		\| Section1 = {{Chembox Identifiers
		⚫	\| CASNo_Ref = {{cascite\|correct\|??}}
	\| CASNo = 21908-53-2
			\| CASNo = <!-- blanked - oldvalue: 6701-17-3 -->
⚫	\| CASNo_Ref = {{cascite\|correct\|~~CAS~~}}
	\| ~~UNNumber~~ = ~~1641~~		\| EINECS =
	\| ~~RTECS~~ = ~~OW8750000~~		\| PubChem = 23167
			\| SMILES = N#CC(C(OCCCCCCCC)=O)=C
	\| PubChen = 30856
		⚫	\| ChemSpiderID_Ref = {{chemspidercite\|changed\|chemspider}}
	\| KEGG_Ref = {{keggcite\|correct\|kegg}}
		⚫	\| ChemSpiderID = 21678
⚫	\| StdInChI_Ref = {{stdinchicite\|changed\|chemspider}}
			\| InChI = 1/C12H19NO2/c1-3-4-5-6-7-8-9-15-12(14)11(2)10-13/h2-9H2,1H3
	\| StdInChI = 1S/Hg.O
			\| InChIKey = RPQUGMLCZLGZTG-UHFFFAOYAE
⚫	\| StdInChIKey_Ref = {{stdinchicite\|~~correct~~\|chemspider}}
		⚫	\| StdInChI_Ref = {{stdinchicite\|changed\|chemspider}}
⚫	\| StdInChIKey = ~~UKWHYYKOEPRTIC~~-UHFFFAOYSA-N
			\| StdInChI = 1S/C12H19NO2/c1-3-4-5-6-7-8-9-15-12(14)11(2)10-13/h2-9H2,1H3
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
		⚫	\| StdInChIKey_Ref = {{stdinchicite\|changed\|chemspider}}
	\| StdInChIKey = UKWHYYKOEPRTIC-UHFFFAOYSA-N
		⚫	\| StdInChIKey = RPQUGMLCZLGZTG-UHFFFAOYSA-N
⚫	\| ChemSpiderID_Ref = {{chemspidercite\|~~correct~~\|chemspider}}
⚫	\| ChemSpiderID = ~~28626~~
	\| KEGG = C18670
	}}		}}
	\| Section2 = {{Chembox Properties		\| Section2 = {{Chembox Properties
		⚫	\| Appearance = Colorless liquid
	\| Hg = 1 \| O = 1
			\| C=12\|H=19\|N=1\|O=2
⚫	\| Appearance = ~~Yellow~~ ~~or red solid~~
	\| ~~Odor~~ = ~~odorless~~		\| MeltingPt =
		⚫	\| BoilingPt =
	\| Density = 11.14 g/cm<sup>3</sup>
		⚫	\| Density =
	\| Solubility = 0.0053 g/100 mL (25 °C) <br> 0.0395 g/100 mL (100 °C)
			\| Flash point =
	\| SolubleOther = insoluble in ], ], ], ]
			\| Solubility = Reacts
	\| MeltingPt = 500 °C (decomposes)
	\| BandGap = 2.2 eV<ref name=landolt>{{cite book\| chapter = Mercury oxide (HgO) crystal structure, physical properties\| volume = 41B\| doi = 10.1007/b71137\| publisher = Springer-Verlag\| year = 1999\| pages = 1–7\| isbn = 978-3-540-64964-9 \| work = Landolt-Börnstein – Group III Condensed Matter}}</ref>
	\| RefractIndex = 2.5 (550 nm)<ref name=landolt/>
	}}
	\| Section3 = {{Chembox Structure
	\| Coordination = orthorhombic
	\| CrystalStruct =
	\| Dipole =
	}}
	\| Section4 = {{Chembox Thermochemistry
	\| DeltaHf = −90 kJ·mol<sup>−1</sup><ref name=b1>{{cite book\| author = Zumdahl, Steven S.\|title =Chemical Principles 6th Ed.\| publisher = Houghton Mifflin Company\| year = 2009\| isbn = 061894690X\|page=A22}}</ref>
	\| Entropy = 70 J·mol<sup>−1</sup>·K<sup>−1</sup><ref name=b1/>
	}}
	\| Section7 = {{Chembox Hazards
	\| ExternalMSDS =
	\| EUIndex = 080-002-00-6
	\| EUClass = Very toxic ('''T+''')<br/>Dangerous for the environment ('''N''')
	\| RPhrases = {{R26/27/28}}, {{R33}}, {{R50/53}}
	\| SPhrases = {{S1/2}}, {{S13}}, {{S28}}, {{S45}}, {{S60}}, {{S61}}
⚫	\| ~~NFPA-H~~ = 3
	\| NFPA-F = 1
	\| NFPA-R = 0
	\| FlashPt = Non-flammable
⚫	\| ~~PEL~~ =
	}}
	\| Section8 = {{Chembox Related
	\| OtherAnions = ]<br/>]<br/>]
	\| OtherCations = ]<br/>]
	\| OtherCpds = ]
	}}		}}
	}}		}}

Revision as of 09:58, 10 April 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 477363580 of page Octyl_cyanoacrylate with values updated to verified values.

WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names
Skeletal formula
Ball-and-stick model
IUPAC name Octyl 2-cyanopropenoate
Other names Ocrylate; Octyl 2-cyanoacrylate
Identifiers
3D model (JSmol)	Interactive image
ChemSpider	21678
PubChem CID	23167
InChI InChI=1S/C12H19NO2/c1-3-4-5-6-7-8-9-15-12(14)11(2)10-13/h2-9H2,1H3Key: RPQUGMLCZLGZTG-UHFFFAOYSA-N InChI=1/C12H19NO2/c1-3-4-5-6-7-8-9-15-12(14)11(2)10-13/h2-9H2,1H3Key: RPQUGMLCZLGZTG-UHFFFAOYAE
SMILES N#CC(C(OCCCCCCCC)=O)=C
Properties
Chemical formula	C₁₂H₁₉NO₂
Molar mass	209.289 g·mol
Appearance	Colorless liquid
Solubility in water	Reacts
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). N verify (what is ?) Infobox references

Tracking categories (test):

SizeSet

Chemical compound