Misplaced Pages

Golidocitinib: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 06:19, 24 December 2024 editBoghog (talk | contribs)Autopatrolled, Extended confirmed users, IP block exemptions, New page reviewers, Pending changes reviewers, Rollbackers, Template editors137,738 edits consistent citation formatting← Previous edit Revision as of 06:26, 24 December 2024 edit undoBoghog (talk | contribs)Autopatrolled, Extended confirmed users, IP block exemptions, New page reviewers, Pending changes reviewers, Rollbackers, Template editors137,738 edits added missing data to the drug boxTag: nowiki addedNext edit →
Line 1: Line 1:
{{cs1 config|name-list-style=vanc|display-authors=6}}

{{cs1 config|name-list-style=vanc|display-authors=6}} {{cs1 config|name-list-style=vanc|display-authors=6}}
{{Infobox drug {{Infobox drug
Line 5: Line 7:
| type = <!-- empty --> | type = <!-- empty -->
| image = Golidocitinib.svg | image = Golidocitinib.svg
⚫ | width =
| alt = | alt =
| caption = | caption =
| image2 =
| width2 =
| alt2 =
| caption2 =
| imageL =
| widthL =
| altL =
| imageR =
| widthR =
| altR =
| captionLR =

<!-- Clinical data --> <!-- Clinical data -->
| pronounce = | pronounce =
| tradename = 高瑞哲 | tradename = 高瑞哲 (Gao Ruizhe)
| Drugs.com = | Drugs.com =
| MedlinePlus = | MedlinePlus =
| licence_CA =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| licence_EU =
| DailyMedID =
| licence_US =
| pregnancy_AU =
| pregnancy_AU_comment = | pregnancy_AU_comment =
| pregnancy_category= | pregnancy_category=
| dependency_liability =
| addiction_liability =
| routes_of_administration = | routes_of_administration =
| class =
| ATCvet = | ATCvet =
| ATC_prefix = <!-- 'none' if uncategorised --> | ATC_prefix = <!-- 'none' if uncategorised -->
| ATC_suffix = | ATC_suffix =
| ATC_supplemental =

<!-- Legal status -->
<!-- Legal status --> <!-- Legal status -->
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled --> | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled -->
Line 39: Line 64:
| legal_UN_comment = | legal_UN_comment =
| legal_status = Rx in China | legal_status = Rx in China

<!-- Pharmacokinetic data --> <!-- Pharmacokinetic data -->
| bioavailability = | bioavailability =
Line 48: Line 74:
| duration_of_action= | duration_of_action=
| excretion = | excretion =

<!-- Identifiers --> <!-- Identifiers -->
| synonyms = AZD-4205, AZD4205, JAK1-IN-3 | CAS_number = 2091134-68-6
| CAS_supplemental =
| CAS_number = 2091134-68-6
| PubChem = 126715380 | PubChem = 126715380
| PubChemSubstance =
⚫ | UNII = 3BY9Z3M34G
| IUPHAR_ligand =
| DrugBank = | DrugBank =
| ChemSpiderID =
| UNII = 3BY9Z3M34G
| KEGG = D12502
| ChEBI =
| ChEMBL = 4577523
| NIAID_ChemDB =
| PDB_ligand =
| synonyms = AZD-4205, AZD4205, JAK1-IN-3

<!-- Chemical and physical data --> <!-- Chemical and physical data -->
| IUPAC_name = (2''R'')-''N''-pyrimidin-4-yl]-1''H''-indol-7-yl]-2-(4-methylpiperazin-1-yl)propanamide | IUPAC_name = <nowiki>(2R)-N-pyrimidin-4-yl]-1H-indol-7-yl]-2-(4-methylpiperazin-1-yl)propanamide</nowiki>
| C = 25 | H = 31 | N = 9 | O = 2 | C=25 | H=31 | N=9 | O=2
| molecular_weight =
| SMILES = C(C(=O)NC1=CC=CC2=C1NC=C2C3=NC(=NC=C3)NC4=CN(N=C4OC)C)N5CCN(CC5)C
| Jmol =
| StdInChI = InChI=1S/C25H31N9O2/c1-16(34-12-10-32(2)11-13-34)23(35)28-20-7-5-6-17-18(14-27-22(17)20)19-8-9-26-25(29-19)30-21-15-33(3)31-24(21)36-4/h5-9,14-16,27H,10-13H2,1-4H3,(H,28,35)(H,26,29,30)/t16-/m1/s1
| StdInChI_comment =
| StdInChIKey = CVCVOSPZEVINRM-MRXNPFEDSA-N
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}} }}


Revision as of 06:26, 24 December 2024

Pharmaceutical compound
Golidocitinib
Clinical data
Trade names高瑞哲 (Gao Ruizhe)
Other namesAZD-4205, AZD4205, JAK1-IN-3
Legal status
Legal status
  • Rx in China
Identifiers
IUPAC name
  • (2R)-N-pyrimidin-4-yl]-1H-indol-7-yl]-2-(4-methylpiperazin-1-yl)propanamide
CAS Number
PubChem CID
UNII
KEGG
ChEMBL
Chemical and physical data
FormulaC25H31N9O2
Molar mass489.584 g·mol
3D model (JSmol)
SMILES
  • C(C(=O)NC1=CC=CC2=C1NC=C2C3=NC(=NC=C3)NC4=CN(N=C4OC)C)N5CCN(CC5)C
InChI
  • InChI=InChI=1S/C25H31N9O2/c1-16(34-12-10-32(2)11-13-34)23(35)28-20-7-5-6-17-18(14-27-22(17)20)19-8-9-26-25(29-19)30-21-15-33(3)31-24(21)36-4/h5-9,14-16,27H,10-13H2,1-4H3,(H,28,35)(H,26,29,30)/t16-/m1/s1
  • Key:CVCVOSPZEVINRM-MRXNPFEDSA-N

Golidocitinib is a pharmaceutical drug for the treatment of cancer. In June 2024, it was given conditional approval in China for the treatment of relapsed or refractory peripheral T-cell lymphoma.

Golidocitinib is classified as a Janus kinase inhibitor.

References

  1. Keam SJ (October 2024). "Golidocitinib: First Approval". Drugs. 84 (10): 1319–1324. doi:10.1007/s40265-024-02089-2. PMID 39298087.
  2. Song Y, Malpica L, Cai Q, Zhao W, Zhou K, Wu J, et al. (January 2024). "Golidocitinib, a selective JAK1 tyrosine-kinase inhibitor, in patients with refractory or relapsed peripheral T-cell lymphoma (JACKPOT8 Part B): a single-arm, multinational, phase 2 study". The Lancet. Oncology. 25 (1): 117–125. doi:10.1016/S1470-2045(23)00589-2. PMID 38092009.
  3. Jin J, Zhang L, Zou L, Li Z, Wu H, Zhou K, et al. (2024). "Maintenance Therapy of Golidocitinib, a JAK1 Selective Inhibitor, in Patients with Peripheral T Cell Lymphomas after First-Line Systemic Therapy: Updates of the Phase 2 Study (JACKPOT26)". Blood. 144: 6368. doi:10.1182/blood-2024-211891.
Stub icon

This antineoplastic or immunomodulatory drug article is a stub. You can help Misplaced Pages by expanding it.

Categories: