Misplaced Pages

Emrusolmin: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 19:10, 24 December 2024 editBoghog (talk | contribs)Autopatrolled, Extended confirmed users, IP block exemptions, New page reviewers, Pending changes reviewers, Rollbackers, Template editors137,644 edits added missing data to drug boxTag: nowiki added← Previous edit Revision as of 19:22, 24 December 2024 edit undoBoghog (talk | contribs)Autopatrolled, Extended confirmed users, IP block exemptions, New page reviewers, Pending changes reviewers, Rollbackers, Template editors137,644 edits consistent citation formattingNext edit →
Line 1: Line 1:

{{cs1 config|name-list-style=vanc|display-authors=6}} {{cs1 config|name-list-style=vanc|display-authors=6}}
{{Infobox drug {{Infobox drug
Line 110: Line 109:
}} }}


'''Emrusolmin''' (development code '''Anle138b''') is an experimental drug for the treatment of neurodegenerative diseases. It is an inhibitor of protein aggregation, particularly preventing the aggregation of ] which is implicated in the development of ].<ref>{{cite journal | doi = 10.1007/s00401-013-1114-9 | title = Anle138b: A novel oligomer modulator for disease-modifying therapy of neurodegenerative diseases such as prion and Parkinson's disease | date = 2013 | last1 = Wagner | first1 = Jens | last2 = Ryazanov | first2 = Sergey | last3 = Leonov | first3 = Andrei | last4 = Levin | first4 = Johannes | last5 = Shi | first5 = Song | last6 = Schmidt | first6 = Felix | last7 = Prix | first7 = Catharina | last8 = Pan-Montojo | first8 = Francisco | last9 = Bertsch | first9 = Uwe | last10 = Mitteregger-Kretzschmar | first10 = Gerda | last11 = Geissen | first11 = Markus | last12 = Eiden | first12 = Martin | last13 = Leidel | first13 = Fabienne | last14 = Hirschberger | first14 = Thomas | last15 = Deeg | first15 = Andreas A. | last16 = Krauth | first16 = Julian J. | last17 = Zinth | first17 = Wolfgang | last18 = Tavan | first18 = Paul | last19 = Pilger | first19 = Jens | last20 = Zweckstetter | first20 = Markus | last21 = Frank | first21 = Tobias | last22 = Bähr | first22 = Mathias | last23 = Weishaupt | first23 = Jochen H. | last24 = Uhr | first24 = Manfred | last25 = Urlaub | first25 = Henning | last26 = Teichmann | first26 = Ulrike | last27 = Samwer | first27 = Matthias | last28 = Bötzel | first28 = Kai | last29 = Groschup | first29 = Martin | last30 = Kretzschmar | first30 = Hans | journal = Acta Neuropathologica | volume = 125 | issue = 6 | pages = 795–813 | pmid = 23604588 | pmc = 3661926 }}</ref><ref>{{cite journal | doi = 10.1016/j.ymeth.2023.04.002 | title = Anle138b interaction in α-synuclein aggregates by dynamic nuclear polarization NMR | date = 2023 | last1 = Dervişoğlu | first1 = Rıza | last2 = Antonschmidt | first2 = Leif | last3 = Nimerovsky | first3 = Evgeny | last4 = Sant | first4 = Vrinda | last5 = Kim | first5 = Myeongkyu | last6 = Ryazanov | first6 = Sergey | last7 = Leonov | first7 = Andrei | last8 = Fuentes-Monteverde | first8 = Juan Carlos | last9 = Wegstroth | first9 = Melanie | last10 = Giller | first10 = Karin | last11 = Mathies | first11 = Guinevere | last12 = Giese | first12 = Armin | last13 = Becker | first13 = Stefan | last14 = Griesinger | first14 = Christian | last15 = Andreas | first15 = Loren B. | journal = Methods | volume = 214 | pages = 18–27 | pmid = 37037308 }}</ref><ref>{{cite journal | doi = 10.1038/s41467-022-32797-w | title = The clinical drug candidate anle138b binds in a cavity of lipidic α-synuclein fibrils | date = 2022 | last1 = Antonschmidt | first1 = Leif | last2 = Matthes | first2 = Dirk | last3 = DervişOğLu | first3 = Rıza | last4 = Frieg | first4 = Benedikt | last5 = Dienemann | first5 = Christian | last6 = Leonov | first6 = Andrei | last7 = Nimerovsky | first7 = Evgeny | last8 = Sant | first8 = Vrinda | last9 = Ryazanov | first9 = Sergey | last10 = Giese | first10 = Armin | last11 = Schröder | first11 = Gunnar F. | last12 = Becker | first12 = Stefan | last13 = De Groot | first13 = Bert L. | last14 = Griesinger | first14 = Christian | last15 = Andreas | first15 = Loren B. | journal = Nature Communications | volume = 13 | issue = 1 | page = 5385 | pmid = 36104315 | pmc = 9474542 }}</ref> Other proteins it inhibits the aggregation of include ]<ref>{{cite journal | doi = 10.1007/s00401-015-1483-3 | title = Reducing tau aggregates with anle138b delays disease progression in a mouse model of tauopathies | date = 2015 | last1 = Wagner | first1 = Jens | last2 = Krauss | first2 = Sybille | last3 = Shi | first3 = Song | last4 = Ryazanov | first4 = Sergey | last5 = Steffen | first5 = Julia | last6 = Miklitz | first6 = Carolin | last7 = Leonov | first7 = Andrei | last8 = Kleinknecht | first8 = Alexander | last9 = Göricke | first9 = Bettina | last10 = Weishaupt | first10 = Jochen H. | last11 = Weckbecker | first11 = Daniel | last12 = Reiner | first12 = Anne M. | last13 = Zinth | first13 = Wolfgang | last14 = Levin | first14 = Johannes | last15 = Ehninger | first15 = Dan | last16 = Remy | first16 = Stefan | last17 = Kretzschmar | first17 = Hans A. | last18 = Griesinger | first18 = Christian | last19 = Giese | first19 = Armin | last20 = Fuhrmann | first20 = Martin | journal = Acta Neuropathologica | volume = 130 | issue = 5 | pages = 619–631 | pmid = 26439832 | pmc = 4612332 }}</ref> which is associated with ] (AD) and ], and ]<ref>{{cite journal | doi = 10.15252/emmm.201707825 | title = The diphenylpyrazole compound anle138b blocks Aβ channels and rescues disease phenotypes in a mouse model for amyloid pathology | date = 2018 | last1 = Martinez Hernandez | first1 = Ana | last2 = Urbanke | first2 = Hendrik | last3 = Gillman | first3 = Alan L. | last4 = Lee | first4 = Joon | last5 = Ryazanov | first5 = Sergey | last6 = Agbemenyah | first6 = Hope Y. | last7 = Benito | first7 = Eva | last8 = Jain | first8 = Gaurav | last9 = Kaurani | first9 = Lalit | last10 = Grigorian | first10 = Gayane | last11 = Leonov | first11 = Andrei | last12 = Rezaei-Ghaleh | first12 = Nasrollah | last13 = Wilken | first13 = Petra | last14 = Arce | first14 = Fernando Teran | last15 = Wagner | first15 = Jens | last16 = Fuhrman | first16 = Martin | last17 = Caruana | first17 = Mario | last18 = Camilleri | first18 = Angelique | last19 = Vassallo | first19 = Neville | last20 = Zweckstetter | first20 = Markus | last21 = Benz | first21 = Roland | last22 = Giese | first22 = Armin | last23 = Schneider | first23 = Anja | last24 = Korte | first24 = Martin | last25 = Lal | first25 = Ratnesh | last26 = Griesinger | first26 = Christian | last27 = Eichele | first27 = Gregor | last28 = Fischer | first28 = Andre | journal = EMBO Molecular Medicine | volume = 10 | pages = 32–47 | pmid = 29208638 }}</ref> which is associated with AD. '''Emrusolmin''' (development code '''Anle138b''') is an experimental drug for the treatment of neurodegenerative diseases. It is an inhibitor of protein aggregation, particularly preventing the aggregation of ] which is implicated in the development of ].<ref>{{cite journal | doi = 10.1007/s00401-013-1114-9 | title = Anle138b: A novel oligomer modulator for disease-modifying therapy of neurodegenerative diseases such as prion and Parkinson's disease | date = 2013 | vauthors = Wagner J, Ryazanov S, Leonov A, Levin J, Shi S, Schmidt F, Prix C, Pan-Montojo F, Bertsch U, Mitteregger-Kretzschmar G, Geissen M, Eiden M, Leidel F, Hirschberger T, Deeg AA, Krauth JJ, Zinth W, Tavan P, Pilger J, Zweckstetter M, Frank T, Bähr M, Weishaupt JH, Uhr M, Urlaub H, Teichmann U, Samwer M, Bötzel K, Groschup M, Kretzschmar H | journal = Acta Neuropathologica | volume = 125 | issue = 6 | pages = 795–813 | pmid = 23604588 | pmc = 3661926 }}</ref><ref>{{cite journal | doi = 10.1016/j.ymeth.2023.04.002 | title = Anle138b interaction in α-synuclein aggregates by dynamic nuclear polarization NMR | date = 2023 | vauthors = Dervişoğlu R, Antonschmidt L, Nimerovsky E, Sant V, Kim M, Ryazanov S, Leonov A, Fuentes-Monteverde JC, Wegstroth M, Giller K, Mathies G, Giese A, Becker S, Griesinger C, Andreas LB | journal = Methods | volume = 214 | pages = 18–27 | pmid = 37037308 }}</ref><ref>{{cite journal | doi = 10.1038/s41467-022-32797-w | title = The clinical drug candidate anle138b binds in a cavity of lipidic α-synuclein fibrils | date = 2022 | vauthors = Antonschmidt L, Matthes D, DervişOğLu R, Frieg B, Dienemann C, Leonov A, Nimerovsky E, Sant V, Ryazanov S, Giese A, Schröder GF, Becker S, De Groot BL, Griesinger C, Andreas LB | journal = Nature Communications | volume = 13 | issue = 1 | page = 5385 | pmid = 36104315 | pmc = 9474542 }}</ref> Other proteins it inhibits the aggregation of include ]<ref>{{cite journal | doi = 10.1007/s00401-015-1483-3 | title = Reducing tau aggregates with anle138b delays disease progression in a mouse model of tauopathies | date = 2015 | vauthors = Wagner J, Krauss S, Shi S, Ryazanov S, Steffen J, Miklitz C, Leonov A, Kleinknecht A, Göricke B, Weishaupt JH, Weckbecker D, Reiner AM, Zinth W, Levin J, Ehninger D, Remy S, Kretzschmar HA, Griesinger C, Giese A, Fuhrmann M | journal = Acta Neuropathologica | volume = 130 | issue = 5 | pages = 619–631 | pmid = 26439832 | pmc = 4612332 }}</ref> which is associated with ] (AD) and ], and ]<ref>{{cite journal | doi = 10.15252/emmm.201707825 | title = The diphenylpyrazole compound anle138b blocks Aβ channels and rescues disease phenotypes in a mouse model for amyloid pathology | date = 2018 | vauthors = Martinez Hernandez A, Urbanke H, Gillman AL, Lee J, Ryazanov S, Agbemenyah HY, Benito E, Jain G, Kaurani L, Grigorian G, Leonov A, Rezaei-Ghaleh N, Wilken P, Arce FT, Wagner J, Fuhrman M, Caruana M, Camilleri A, Vassallo N, Zweckstetter M, Benz R, Giese A, Schneider A, Korte M, Lal R, Griesinger C, Eichele G, Fischer A | journal = EMBO Molecular Medicine | volume = 10 | pages = 32–47 | pmid = 29208638 }}</ref> which is associated with AD.


It is currently in clinical trials for Parkinson's disease and ].<ref>{{cite web | url = https://adisinsight.springer.com/drugs/800046788 | title = Emrusolmin - Modag | publisher = AdisInsight }}</ref> It is currently in clinical trials for Parkinson's disease and ].<ref>{{cite web | url = https://adisinsight.springer.com/drugs/800046788 | title = Emrusolmin - Modag | work = AdisInsight | publisher = Springer Nature Switzerland AG }}</ref>


==References== ==References==

Revision as of 19:22, 24 December 2024

Pharmaceutical compound
Emrusolmin
Clinical data
Other namesAnle138b, TEV-56286
Legal status
Legal status
  • Investigational
Identifiers
IUPAC name
  • 5-(1,3-benzodioxol-5-yl)-3-(3-bromophenyl)-1H-pyrazole
CAS Number
PubChem CID
DrugBank
UNII
KEGG
ChEBI
ChEMBL
Chemical and physical data
FormulaC16H11BrN2O2
Molar mass343.180 g·mol
3D model (JSmol)
SMILES
  • C1OC2=C(O1)C=C(C=C2)C3=CC(=NN3)C4=CC(=CC=C4)Br
InChI
  • InChI=InChI=1S/C16H11BrN2O2/c17-12-3-1-2-10(6-12)13-8-14(19-18-13)11-4-5-15-16(7-11)21-9-20-15/h1-8H,9H2,(H,18,19)
  • Key:RCQIIBJSUWYYFU-UHFFFAOYSA-N

Emrusolmin (development code Anle138b) is an experimental drug for the treatment of neurodegenerative diseases. It is an inhibitor of protein aggregation, particularly preventing the aggregation of α-synuclein which is implicated in the development of Parkinson's disease. Other proteins it inhibits the aggregation of include tau which is associated with Alzheimer's disease (AD) and tauopathy, and amyloid beta which is associated with AD.

It is currently in clinical trials for Parkinson's disease and multiple system atrophy.

References

  1. Wagner J, Ryazanov S, Leonov A, Levin J, Shi S, Schmidt F, et al. (2013). "Anle138b: A novel oligomer modulator for disease-modifying therapy of neurodegenerative diseases such as prion and Parkinson's disease". Acta Neuropathologica. 125 (6): 795–813. doi:10.1007/s00401-013-1114-9. PMC 3661926. PMID 23604588.
  2. Dervişoğlu R, Antonschmidt L, Nimerovsky E, Sant V, Kim M, Ryazanov S, et al. (2023). "Anle138b interaction in α-synuclein aggregates by dynamic nuclear polarization NMR". Methods. 214: 18–27. doi:10.1016/j.ymeth.2023.04.002. PMID 37037308.
  3. Antonschmidt L, Matthes D, DervişOğLu R, Frieg B, Dienemann C, Leonov A, et al. (2022). "The clinical drug candidate anle138b binds in a cavity of lipidic α-synuclein fibrils". Nature Communications. 13 (1): 5385. doi:10.1038/s41467-022-32797-w. PMC 9474542. PMID 36104315.
  4. Wagner J, Krauss S, Shi S, Ryazanov S, Steffen J, Miklitz C, et al. (2015). "Reducing tau aggregates with anle138b delays disease progression in a mouse model of tauopathies". Acta Neuropathologica. 130 (5): 619–631. doi:10.1007/s00401-015-1483-3. PMC 4612332. PMID 26439832.
  5. Martinez Hernandez A, Urbanke H, Gillman AL, Lee J, Ryazanov S, Agbemenyah HY, et al. (2018). "The diphenylpyrazole compound anle138b blocks Aβ channels and rescues disease phenotypes in a mouse model for amyloid pathology". EMBO Molecular Medicine. 10: 32–47. doi:10.15252/emmm.201707825. PMID 29208638.
  6. "Emrusolmin - Modag". AdisInsight. Springer Nature Switzerland AG.
Stub icon

This drug article relating to the nervous system is a stub. You can help Misplaced Pages by expanding it.

Categories: