Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 15:04, 17 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456671290 of page Galantamine for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit Revision as of 15:05, 17 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457267475 of page Gallamine_triethiodide for the Chem/Drugbox validation project (updated: 'ChemSpiderID', 'DrugBank', 'ChEMBL').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| Verifiedfields = changed
⚫ | verifiedrevid = 443831212
| Watchedfields = changed
| IUPAC_name = (4a''S'',6''R'',8a''S'')- 5,6,9,10,11,12- hexahydro- 3-methoxy- 11-methyl- 4a''H''- benzofuro benzazepin- 6-ol
⚫ | verifiedrevid = 396142022
| image = Galantamine.svg
| IUPAC_name = 2,2’,2’’-tris(N,N,N-triethylethanaminium) triiodide
| width = 175
| image = Gallamine triethiodide.svg


<!--Clinical data--> <!--Clinical data-->
| tradename = Razadyne | tradename =
| Drugs.com = {{drugs.com|monograph|razadyne}} | Drugs.com = {{drugs.com|international|gallamine-triethiodide}}
| pregnancy_category =
| MedlinePlus = a699058
| pregnancy_category = B | legal_status =
⚫ | routes_of_administration =
| legal_status = Rx
⚫ | routes_of_administration = Oral


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = 80 to 100% | bioavailability =
| protein_bound = 18% | protein_bound =
| metabolism =
| metabolism = ] partially ]:]/] substrate
| elimination_half-life = 7 hours | elimination_half-life =
| excretion = ] (95%, of which 32% unchanged), fecal (5%) | excretion =


<!--Identifiers--> <!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}} | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 357-70-0 | CAS_number = 65-29-2
| ATC_prefix = N06 | ATC_prefix = M03
| ATC_suffix = DA04 | ATC_suffix = AC02
| ATC_supplemental =
| PubChem = 9651 | PubChem = 6172
| IUPHAR_ligand = 356
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00674 | DrugBank = DB00483
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 9272 | ChemSpiderID = 60750
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 0D3Q044KCA | UNII = Q3254X40X2
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = D04292 | KEGG = D02292
| ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 42944 | ChEBI = 503442
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 659 | ChEMBL = 1476
| chemical_formula = C<sub>30</sub>H<sub>60</sub>N<sub>3</sub>O<sub>3</sub><sup>+3</sup> · 3 I<sup>-</sup> (gallamine triethiodide)<BR />C<sub>24</sub>H<sub>45</sub>N<sub>3</sub>O<sub>3</sub> (gallamine)


| molecular_weight = 891.529 g/mol (gallamine triethiodide)<br />423.633 g/mol<br> (gallamine)
<!--Chemical data-->
| smiles = ...O(c1c(OCC(CC)(CC)CC)cccc1OCC(CC)(CC)CC)CC(CC)(CC)CC
| C=17 | H=21 | N=1 | O=3
| InChI = 1S/C30H60N3O3.3HI/c1-10-31(11-2,12-3)22-25-34-28-20-19-21-29(35-26-23-32(13-4,14-5)15-6)30(28)36-27-24-33(16-7,17-8)18-9;;;/h19-21H,10-18,22-27H2,1-9H3;3*1H/q+3;;;/p-3
| molecular_weight = 287.354&nbsp;g/mol
| smiles = O(c2c1O4C(O)/C=C\43c1c(cc2)CN(C)CC3)C
| InChI = 1/C17H21NO3/c1-18-8-7-17-6-5-12(19)9-14(17)21-16-13(20-2)4-3-11(10-18)15(16)17/h3-6,12,14,19H,7-10H2,1-2H3/t12-,14-,17-/m0/s1
| InChIKey = ASUTZQLVASHGKV-JDFRZJQEBY
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C17H21NO3/c1-18-8-7-17-6-5-12(19)9-14(17)21-16-13(20-2)4-3-11(10-18)15(16)17/h3-6,12,14,19H,7-10H2,1-2H3/t12-,14-,17-/m0/s1 | StdInChI = 1S/C24H45N3O3/c1-7-25(8-2)16-19-28-22-14-13-15-23(29-20-17-26(9-3)10-4)24(22)30-21-18-27(11-5)12-6/h13-15H,7-12,16-21H2,1-6H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ASUTZQLVASHGKV-JDFRZJQESA-N | StdInChIKey = ICLWTJIMXVISSR-UHFFFAOYSA-N
| melting_point = 126.5
}} }}

Revision as of 15:05, 17 November 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 457267475 of page Gallamine_triethiodide with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
AHFS/Drugs.comInternational Drug Names
ATC code
Identifiers
IUPAC name
  • 2,2’,2’’-tris(N,N,N-triethylethanaminium) triiodide
CAS Number
PubChem CID
IUPHAR/BPS
DrugBank
ChemSpider
UNII
KEGG
ChEBI
ChEMBL
Chemical and physical data
FormulaC30H60N3O3 · 3 I (gallamine triethiodide)
C24H45N3O3 (gallamine)
Molar mass891.529 g/mol (gallamine triethiodide)
423.633 g/mol
(gallamine)
3D model (JSmol)
SMILES
  • ...O(c1c(OCC(CC)(CC)CC)cccc1OCC(CC)(CC)CC)CC(CC)(CC)CC
InChI
  • InChI=1S/C24H45N3O3/c1-7-25(8-2)16-19-28-22-14-13-15-23(29-20-17-26(9-3)10-4)24(22)30-21-18-27(11-5)12-6/h13-15H,7-12,16-21H2,1-6H3
  • Key:ICLWTJIMXVISSR-UHFFFAOYSA-N
  (what is this?)  (verify)