Revision as of 11:44, 23 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456658928 of page Levobunolol for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL').← Previous edit |
Revision as of 11:45, 23 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456582801 of page Levobupivacaine for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 407705939 |
|
| verifiedrevid = 403750431 |
|
| IUPAC_name = (''S'')-5-{oxy}-3,4-dihydronaphthalen-1(2''H'')-one |
|
| IUPAC_name = (''S'')-1-butyl-''N''-(2,6-dimethylphenyl)<br />piperidine-2-carboxamide |
|
| image = Levobunolol structural formulae.png |
|
| image = Levobupivacaine.png |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = Betagan |
|
| tradename = |
|
| Drugs.com = {{drugs.com|monograph|levobunolol-hydrochloride}} |
|
| Drugs.com = {{drugs.com|CONS|levobupivacaine}} |
|
| MedlinePlus = a686011 |
|
| pregnancy_AU = B3 |
|
|
| legal_AU = S4 |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
⚫ |
| routes_of_administration = ] |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category = C |
|
|
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD --> |
|
|
| legal_US = Rx-only |
|
⚫ |
| routes_of_administration = ] (]s) |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = n/a |
⚫ |
| elimination_half-life = 20 hours |
|
|
|
| metabolism = ] |
|
⚫ |
| elimination_half-life = 2–2.6 hours |
|
|
| excretion = ] 70%, ] 24% |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 47141-42-4 |
|
| CAS_number = 27262-47-1 |
|
| ATC_prefix = S01 |
|
| ATC_prefix = N01 |
|
| ATC_suffix = ED03 |
|
| ATC_suffix = BB10 |
|
| PubChem = 39468 |
|
| PubChem = 92253 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB01210 |
|
| DrugBank = DB01002 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 36089 |
|
| ChemSpiderID = 83289 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = G6317AOI7K |
|
| UNII = A5H73K9U3W |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D08115 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI = 6438 |
|
| ChEBI = 6149 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 1201237 --> |
|
| ChEMBL = <!-- blanked - oldvalue: 1201193 --> |
|
| C=17 | H=25 | N=1 | O=3 |
|
| C=18 | H=28 | N=2 | O=1 |
|
| molecular_weight = 291.385 g/mol |
|
| molecular_weight = 288.43 g/mol |
|
| smiles = O=C2c1cccc(OC(O)CNC(C)(C)C)c1CCC2 |
|
| smiles = O=C(Nc1c(cccc1C)C)2N(CCCC)CCCC2 |
|
| InChI = 1/C17H25NO3/c1-17(2,3)18-10-12(19)11-21-16-9-5-6-13-14(16)7-4-8-15(13)20/h5-6,9,12,18-19H,4,7-8,10-11H2,1-3H3/t12-/m0/s1 |
|
| InChI = 1/C18H28N2O/c1-4-5-12-20-13-7-6-11-16(20)18(21)19-17-14(2)9-8-10-15(17)3/h8-10,16H,4-7,11-13H2,1-3H3,(H,19,21)/t16-/m0/s1 |
|
| InChIKey = IXHBTMCLRNMKHZ-LBPRGKRZBR |
|
| InChIKey = LEBVLXFERQHONN-INIZCTEOBJ |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C17H25NO3/c1-17(2,3)18-10-12(19)11-21-16-9-5-6-13-14(16)7-4-8-15(13)20/h5-6,9,12,18-19H,4,7-8,10-11H2,1-3H3/t12-/m0/s1 |
|
| StdInChI = 1S/C18H28N2O/c1-4-5-12-20-13-7-6-11-16(20)18(21)19-17-14(2)9-8-10-15(17)3/h8-10,16H,4-7,11-13H2,1-3H3,(H,19,21)/t16-/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = IXHBTMCLRNMKHZ-LBPRGKRZSA-N |
|
| StdInChIKey = LEBVLXFERQHONN-INIZCTEOSA-N |
|
}} |
|
}} |