| Revision as of 13:29, 23 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456761507 of page Matairesinol for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 13:31, 23 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457003604 of page Matuzumab for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 400294983 |
|
| verifiedrevid = 445634976 |
|
|
|
|
| Reference = <ref> at ]</ref> |
|
|
|
<!--Monoclonal antibody data--> |
|
| Name = Matairesinol |
|
|
|
| type = mab |
|
| ImageFile = Matairesinol.png |
|
|
| ImageSize = 200px |
|
| mab_type = mab |
|
|
| source = zu |
|
| ImageName = Chemical structure of matairesinol |
|
|
|
| target = ] |
|
| IUPACName = (3''R'',4''R'')-3,4-bisoxolan-2-one |
|
|
|
|
|
| OtherNames = (αR,βR)-α,β-Bis(4-hydroxy-3-methoxybenzyl)butyrolactone |
|
|
|
<!--Clinical data--> |
|
|Section1= {{Chembox Identifiers |
|
|
|
| tradename = |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 106491 |
|
| pregnancy_AU = |
|
|
| pregnancy_US = |
|
| InChI = 1S/C20H22O6/c1-24-18-9-12(3-5-16(18)21)7-14-11-26-20(23)15(14)8-13-4-6-17(22)19(10-13)25-2/h3-6,9-10,14-15,21-22H,7-8,11H2,1-2H3/t14-,15+/m0/s1 |
|
|
|
| pregnancy_category = |
|
| InChIKey = MATGKVZWFZHCLI-LSDHHAIUBP |
|
|
|
| legal_AU = |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| legal_CA = |
|
| StdInChI = 1S/C20H22O6/c1-24-18-9-12(3-5-16(18)21)7-14-11-26-20(23)15(14)8-13-4-6-17(22)19(10-13)25-2/h3-6,9-10,14-15,21-22H,7-8,11H2,1-2H3/t14-,15+/m0/s1 |
|
|
|
| legal_UK = |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| legal_US = |
|
| StdInChIKey = MATGKVZWFZHCLI-LSDHHAIUSA-N |
|
|
|
| legal_status = clinical development failed |
|
| InChIKey1 = MATGKVZWFZHCLI-LSDHHAIUSA-N |
|
|
|
| routes_of_administration = |
| ⚫ |
| CASNo = <!-- blanked - oldvalue: 580-72-3 --> |
|
|
|
|
| ⚫ |
| CASNo_Ref = {{cascite|correct|??}}= |
|
|
|
<!--Pharmacokinetic data--> |
|
| CASOther = |
|
|
|
| bioavailability = N/A |
|
| PubChem = 119205 |
|
|
|
| protein_bound = |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 425148 |
|
| metabolism = |
|
|
| elimination_half-life = |
| ⚫ |
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
|
| DrugBank = DB04200 |
|
| excretion = |
|
|
|
|
| SMILES = O=C2OC(Cc1cc(OC)c(O)cc1)2Cc3ccc(O)c(OC)c3 |
|
|
|
<!--Identifiers--> |
|
| InChI = |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| MeSHName = |
|
|
|
| ChemSpiderID = NA |
|
}} |
|
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
|Section2= {{Chembox Properties |
|
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 339186-68-4 --> |
|
| C=20|H=22|O=6 |
|
|
|
| ATC_prefix = none |
|
| ExactMass = 358.141638 u |
|
|
| Appearance = |
|
| ATC_suffix = |
|
| Density = |
|
| PubChem = |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| MeltingPt = <!-- °C --> |
|
|
| BoilingPt = <!-- °C --> |
|
| DrugBank = |
|
|
|
|
| Solubility = |
|
|
|
<!--Chemical data--> |
|
}} |
|
|
|
| chemical_formula = |
|
|
|
|
|
| molecular_weight = |
|
}} |
|
}} |
