| Revision as of 09:44, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 462235331 of page Triphenylmethyl_radical for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 09:44, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 462181660 of page Sufentanil for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| ImageFile = Triphenylmethylradical.png |
|
|
|
| verifiedrevid = 416774995 |
| ⚫ |
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
|
|
| IUPAC_name = ''N''--''N''-phenylpropanamide |
|
| ImageName = Kekulé, skeletal formula of the triphenylmethyl radical |
|
|
|
| image = Sufentanil.svg |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| width = 200px |
| ⚫ |
| ChemSpiderID = 10627185 |
|
|
|
| image2 = Sufentanil-xtal-3D-balls-A.png |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
|
|
| SMILES = c1ccc(cc1)(c1ccccc1)c1ccccc1 |
|
|
|
<!--Clinical data--> |
|
| SMILES1 = C1=CC=C(C=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
|
|
|
| tradename = Sufenta |
|
| StdInChI = 1S/C19H15/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
|
|
|
| Drugs.com = {{drugs.com|monograph|sufenta}} |
| ⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| legal_UK = Class A |
| ⚫ |
| StdInChIKey = OHSJPLSEQNCRLW-UHFFFAOYSA-N |
|
|
|
| legal_US = Schedule II |
| ⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| routes_of_administration = Injection |
|
}} |
|
|
|
|
|
| Section2 = {{Chembox Properties |
|
|
|
<!--Pharmacokinetic data--> |
|
| C = 19 |
|
|
|
| elimination_half-life = 265 minutes |
|
| H = 15 |
|
|
|
|
|
| ExactMass = 243.117375480 g mol<sup>-1</sup> |
|
|
|
<!--Identifiers--> |
|
}} |
|
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 56030-54-7 |
|
|
| ATC_prefix = N01 |
|
|
| ATC_suffix = AH03 |
|
|
| PubChem = 41693 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00708 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 38043 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = AFE2YW0IIZ |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D05938 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 9316 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 658 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=22 | H=30 | N=2 | O=2 | S=1 |
|
|
| molecular_weight = 386.552 g/mol |
|
|
| smiles = O=C(N(c1ccccc1)C2(COC)CCN(CC2)CCc3sccc3)CC |
|
|
| InChI = 1/C22H30N2O2S/c1-3-21(25)24(19-8-5-4-6-9-19)22(18-26-2)12-15-23(16-13-22)14-11-20-10-7-17-27-20/h4-10,17H,3,11-16,18H2,1-2H3 |
|
|
| InChIKey = GGCSSNBKKAUURC-UHFFFAOYAS |
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C22H30N2O2S/c1-3-21(25)24(19-8-5-4-6-9-19)22(18-26-2)12-15-23(16-13-22)14-11-20-10-7-17-27-20/h4-10,17H,3,11-16,18H2,1-2H3 |
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = GGCSSNBKKAUURC-UHFFFAOYSA-N |
|
|
| melting_point = 97 |
|
}} |
|
}} |
