Revision as of 14:18, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,054 edits Saving copy of the {{drugbox}} taken from revid 456636462 of page Norfenefrine for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 14:18, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,054 edits Saving copy of the {{drugbox}} taken from revid 456965919 of page Norgestimate for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
⚫ |
| verifiedrevid = 408343690 |
|
| Watchedfields = changed |
|
|
|
| IUPAC_name = (13-ethyl-17-ethynyl-3-hydroxyimino- 1,2,6,7,8,9,10,11,12,14,15,16- dodecahydrocyclopenta phenanthren-17-yl) acetate |
⚫ |
| verifiedrevid = 408778577 |
|
|
⚫ |
| image = Norgestimate.svg |
|
| IUPAC_name = 3-(2-amino-1-hydroxyethyl)phenol |
|
⚫ |
| image = Norfenefrine.png |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|international|norfenefrine}} |
|
| Drugs.com = {{drugs.com|CONS|norgestimate}} |
|
|
| MedlinePlus = a601050 |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL / P / POM / CD --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
Line 24: |
Line 23: |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = 12-30 hours |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 536-21-0 --> |
|
| CAS_number = 35189-28-7 |
|
| ATC_prefix = C01 |
|
| ATC_prefix = G03 |
|
| ATC_suffix = CA05 |
|
| ATC_suffix = AA11 |
|
|
| ATC_supplemental = |
|
| PubChem = 4538 |
|
| PubChem = 6540478 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = DB00957 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4379 |
|
| ChemSpiderID = 5022837 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = D2P3M6SRN5 |
|
| UNII = C291HFX4DY |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D08286 |
|
| KEGG = D05209 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = 358040 |
|
| ChEBI = 50815 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
|
|
|
| ChEMBL = <!-- blanked - oldvalue: 1200934 --> |
|
<!--Chemical data--> |
|
|
| C=8 | H=11 | N=1 | O=2 |
|
| C=23 | H=31 | N=1 | O=3 |
|
| molecular_weight = 153.178 g/mol |
|
| molecular_weight = 369.497 g/mol |
|
|
| smiles = O=C(O2(C#C)CC14(CC12CC)3/C(=C\C(=N\O)CC3)CC4)C |
|
| smiles = OC(c1cc(O)ccc1)CN |
|
|
|
| InChI = 1/C23H31NO3/c1-4-22-12-10-19-18-9-7-17(24-26)14-16(18)6-8-20(19)21(22)11-13-23(22,5-2)27-15(3)25/h2,14,18-21,26H,4,6-13H2,1,3H3/b24-17+/t18-,19+,20+,21-,22-,23-/m0/s1 |
|
| InChI = 1/C8H11NO2/c9-5-8(11)6-2-1-3-7(10)4-6/h1-4,8,10-11H,5,9H2 |
|
|
| InChIKey = LRCXRAABFLIVAI-UHFFFAOYAV |
|
| InChIKey = KIQQMECNKUGGKA-NMYWJIRABS |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C8H11NO2/c9-5-8(11)6-2-1-3-7(10)4-6/h1-4,8,10-11H,5,9H2 |
|
| StdInChI = 1S/C23H31NO3/c1-4-22-12-10-19-18-9-7-17(24-26)14-16(18)6-8-20(19)21(22)11-13-23(22,5-2)27-15(3)25/h2,14,18-21,26H,4,6-13H2,1,3H3/b24-17+/t18-,19+,20+,21-,22-,23-/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = LRCXRAABFLIVAI-UHFFFAOYSA-N |
|
| StdInChIKey = KIQQMECNKUGGKA-NMYWJIRASA-N |
|
}} |
|
}} |