Revision as of 11:51, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 460568464 of page Pergolide for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit |
Revision as of 11:51, 5 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456622048 of page Perhexiline for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 410251613 |
|
| verifiedrevid = 408794545 |
|
| IUPAC_name = (8β)-8--6-propylergoline |
|
|
|
| IUPAC_name = 2-(2,2-dicyclohexylethyl)piperidine |
|
| image = Pergolid Structural Formulae V.1.svg |
|
|
|
| image = Perhexiline structure.svg |
|
| width = 300px |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|monograph|pergolide-mesylate}} |
|
| Drugs.com = {{drugs.com|international|perhexiline}} |
|
| pregnancy_category = B |
|
| pregnancy_category = |
|
| legal_status = '''Withdrawn''' <small>(])</small> |
|
| legal_status = |
|
| routes_of_administration = Oral |
|
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = Dose Dependent |
|
| protein_bound = 90% |
|
|
| metabolism = Extensively hepatic |
|
| metabolism = Saturable Hepatic |
|
| elimination_half-life = 27 hours |
|
| elimination_half-life = Dose Dependent |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 66104-22-1 |
|
| CAS_number = 6621-47-2 |
|
| ATC_prefix = N04 |
|
| ATC_prefix = C08 |
|
| ATC_suffix = BC02 |
|
| ATC_suffix = EX02 |
|
| PubChem = 47811 |
|
| PubChem = 4746 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
| IUPHAR_ligand = 48 |
|
|
⚫ |
| DrugBank = DB01074 |
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = DB01186 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 43503 |
|
| ChemSpiderID = 4584 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 24MJ822NZ9 |
|
| UNII = KU65374X44 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D08339 |
|
| KEGG = D08340 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 35553 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 531 |
|
| ChEMBL = 75880 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=19 | H=26 | N=2 | S=1 |
|
| C=19 | H=35 | N=1 |
|
| molecular_weight = 314.489 g/mol |
|
| molecular_weight = 277.488 |
|
| smiles = S(C)C2C3c4cccc1c4c(cn1)C3N(C2)CCC |
|
| smiles = N3C(CC(C1CCCCC1)C2CCCCC2)CCCC3 |
|
| InChI = 1/C19H26N2S/c1-3-7-21-11-13(12-22-2)8-16-15-5-4-6-17-19(15)14(10-20-17)9-18(16)21/h4-6,10,13,16,18,20H,3,7-9,11-12H2,1-2H3/t13-,16-,18-/m1/s1 |
|
| InChI = 1/C19H35N/c1-3-9-16(10-4-1)19(17-11-5-2-6-12-17)15-18-13-7-8-14-20-18/h16-20H,1-15H2 |
|
| InChIKey = YEHCICAEULNIGD-MZMPZRCHBJ |
|
| InChIKey = CYXKNKQEMFBLER-UHFFFAOYAN |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C19H26N2S/c1-3-7-21-11-13(12-22-2)8-16-15-5-4-6-17-19(15)14(10-20-17)9-18(16)21/h4-6,10,13,16,18,20H,3,7-9,11-12H2,1-2H3/t13-,16-,18-/m1/s1 |
|
| StdInChI = 1S/C19H35N/c1-3-9-16(10-4-1)19(17-11-5-2-6-12-17)15-18-13-7-8-14-20-18/h16-20H,1-15H2 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = YEHCICAEULNIGD-MZMPZRCHSA-N |
|
| StdInChIKey = CYXKNKQEMFBLER-UHFFFAOYSA-N |
|
| synonyms = <small>(6a''R'',9''R'',10a''R'')-9-(methylthiomethyl)-7-propyl-4,6,6a,7,8,9,10,10a-octahydroindoloquinoline</small> |
|
|
}} |
|
}} |