Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 12:04, 5 December 2011 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 462871996 of page Phenidone for the Chem/Drugbox validation project (updated: '').← Previous edit		Revision as of 12:04, 5 December 2011 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456801764 of page Phenindione for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|~~chembox~~}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|drugbox}}) taken from revid of page ] with values updated to verified values.}}
	{{~~chembox~~		{{Drugbox
			\| Verifiedfields = changed
	\| verifiedrevid = ~~412523026~~		\| verifiedrevid = 408954109
	\| Name = Phenidone
			\| IUPAC_name = 2-phenyl-1''H''-indene-1,3(2''H'')-dione
	\| ImageFile = phenidone.svg
			\| image = Phenindione.svg
	\| ImageSize =

	\| ImageName =
			<!--Clinical data-->
	\| ImageFile1 = phenidone-spaceFill.png
			\| tradename =
	\| ImageSize1 =
			\| Drugs.com = {{drugs.com\|international\|phenindione}}
	\| ImageName1 =
			\| pregnancy_AU = D
	\| IUPACName = 1-phenyl-3-pyrazolidinone
			\| pregnancy_US = <!-- A / B / C / D / X -->
	\| OtherNames =
			\| pregnancy_category = Passes into ]
	\| Section1 = {{Chembox Identifiers
			\| legal_AU = <!-- Unscheduled / S2 / S4 / S8 -->
	\| SMILES = O=C2NN(c1ccccc1)CC2
			\| legal_UK = <!-- GSL / P / POM / CD -->
⚫	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
			\| legal_US = <!-- OTC / Rx-only -->
⚫	\| ChemSpiderID = ~~6823~~
	\| ~~PubChem~~ = ~~7090~~		\| legal_status =
			\| routes_of_administration = Oral
	\| InChI = 1/C9H10N2O/c12-9-6-7-11(10-9)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,12)

	\| InChIKey = CMCWWLVWPDLCRM-UHFFFAOYAF
			<!--Pharmacokinetic data-->
			\| bioavailability =
			\| protein_bound = 88%
			\| metabolism =
			\| elimination_half-life = 5 to 10 hours
			\| excretion =

			<!--Identifiers-->
		⚫	\| CASNo_Ref = {{cascite\|correct\|CAS}}
			\| CAS_number_Ref = {{cascite\|correct\|??}}
			\| CAS_number = 83-12-5
			\| ATC_prefix = B01
			\| ATC_suffix = AA02
			\| ATC_supplemental =
			\| PubChem = 4760
			\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}
			\| DrugBank = DB00498
		⚫	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
		⚫	\| ChemSpiderID = 4596
			\| UNII_Ref = {{fdacite\|correct\|FDA}}
			\| UNII = 5M7Y6274ZE
			\| KEGG_Ref = {{keggcite\|correct\|kegg}}
			\| KEGG = D08354
			\| ChEBI_Ref = {{ebicite\|changed\|EBI}}
			\| ChEBI = 8066
	\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}		\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}
	\| ChEMBL = ~~7660~~		\| ChEMBL = 711

			<!--Chemical data-->
			\| C=15 \| H=10 \| O=2
			\| molecular_weight = 222.239 g/mol
			\| smiles = O=C2c1ccccc1C(=O)C2c3ccccc3
			\| InChI = 1/C15H10O2/c16-14-11-8-4-5-9-12(11)15(17)13(14)10-6-2-1-3-7-10/h1-9,13H
			\| InChIKey = NFBAXHOPROOJAW-UHFFFAOYAZ
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChI = 1S/~~C9H10N2O~~/~~c12~~-9-6-7-11(10-~~9)8-4~~-2-1-3-5-8/h1-5H,~~6-7H2,(H,10,12)~~		\| StdInChI = 1S/C15H10O2/c16-14-11-8-4-5-9-12(11)15(17)13(14)10-6-2-1-3-7-10/h1-9,13H
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = ~~CMCWWLVWPDLCRM~~-UHFFFAOYSA-N		\| StdInChIKey = NFBAXHOPROOJAW-UHFFFAOYSA-N
	\| CASNo = 92-43-3
⚫	\| CASNo_Ref = {{cascite\|correct\|CAS}}
	\| EINECS = 202-155-1
	}}
	\| Section2 = {{Chembox Properties
	\| Formula = C<sub>9</sub>H<sub>10</sub>N<sub>2</sub>O
	\| MolarMass = 162.19
	\| Appearance = Crystal leaflets or needles
	\| Density =
	\| Solubility = 10 g/100 ml at 100 °C
	\| Solubility1 = 10 g/100 ml (hot)
	\| Solvent1 = ethanol
	\| Solubility2 = practically insoluble
	\| Solvent2 = diethyl ether
	\| MeltingPtC = 121
	\| pKa =
	\| Viscosity =
	\| Dipole =
	}}
	\| Section7 = {{Chembox Hazards
	\| ExternalMSDS =
	\| MainHazards = Harmful if swallowed
	\| RPhrases = {{R20}} {{R22}}
	}}
	<!-- \| Section8 = {{Chembox Related
	\| Function =
	\| OtherFunctn = }} -->
	}}		}}

Revision as of 12:04, 5 December 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 456801764 of page Phenindione with values updated to verified values.

WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data

AHFS/Drugs.com	International Drug Names
Pregnancy category	AU: D Passes into breast milk
Routes of administration	Oral
ATC code	B01AA02 (WHO)
Pharmacokinetic data
Protein binding	88%
Elimination half-life	5 to 10 hours
Identifiers
IUPAC name 2-phenyl-1H-indene-1,3(2H)-dione
CAS Number	83-12-5
PubChem CID	4760
DrugBank	DB00498
ChemSpider	4596
UNII	5M7Y6274ZE
KEGG	D08354
ChEBI	CHEBI:8066
ChEMBL	ChEMBL711
Chemical and physical data
Formula	C₁₅H₁₀O₂
Molar mass	222.239 g/mol g·mol
3D model (JSmol)	Interactive image
SMILES O=C2c1ccccc1C(=O)C2c3ccccc3
InChI InChI=1S/C15H10O2/c16-14-11-8-4-5-9-12(11)15(17)13(14)10-6-2-1-3-7-10/h1-9,13H Key:NFBAXHOPROOJAW-UHFFFAOYSA-N
(what is this?) (verify)