Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 12:05, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457743985 of page Pheniramine for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 12:05, 5 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456799834 of page Phenmetrazine for the Chem/Drugbox validation project (updated: 'ChEMBL').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
| verifiedrevid = 422474657 | verifiedrevid = 409759788
| IUPAC_name = ''N'',''N''-dimethyl-3-phenyl-3-pyridin-2-yl-propan-1-amine | IUPAC_name = 3-methyl-2-phenylmorpholine
| image = Pheniramine.svg | image = Phenmetrazine.svg
| width = 125


<!--Clinical data--> <!--Clinical data-->
| tradename = Tussionexpennkinetic | tradename =
| legal_AU =
| Drugs.com = {{drugs.com|international|pheniramine}}
| legal_CA = Schedule IV
| MedlinePlus = a606008
| legal_UK = Class B
| pregnancy_category = A
| legal_US = Schedule II
| legal_status = | legal_status =
| routes_of_administration = Oral ; ] { as ] or slow ] } ; Topical { as opthalmic solution } | routes_of_administration = Oral, ], ]d, ]d, ]


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
⚫ | elimination_half-life = 8 hours
| bioavailability =
⚫ | excretion = ]
| protein_bound =
| metabolism = ] ], ] and ]
⚫ | elimination_half-life =
⚫ | excretion = ]


<!--Identifiers--> <!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}} | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 86-21-5 | CAS_number = 134-49-6
| ATC_prefix = R06 | ATC_prefix = none
| ATC_suffix = AB05 | PubChem = 4762
| PubChem = 4761
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} | DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB01620 | DrugBank = DB00830
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4597 | ChemSpiderID = 4598
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 134FM9ZZ6M | UNII = XA501VL3VR
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08355 | KEGG = C07432
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1193 | ChEMBL = <!-- blanked - oldvalue: 1201208 -->
⚫ | C=11 | H=15 | N=1 | O=1

⚫ | molecular_weight = 177.2456
<!--Chemical data-->
| smiles = O2C(c1ccccc1)C(NCC2)C
⚫ | C=16 | H=20 | N=2
| InChI = 1/C11H15NO/c1-9-11(13-8-7-12-9)10-5-3-2-4-6-10/h2-6,9,11-12H,7-8H2,1H3
⚫ | molecular_weight = 240.343 g/mol
| InChIKey = OOBHFESNSZDWIU-UHFFFAOYAX
| smiles = n1ccccc1C(c2ccccc2)CCN(C)C
| InChI = 1/C16H20N2/c1-18(2)13-11-15(14-8-4-3-5-9-14)16-10-6-7-12-17-16/h3-10,12,15H,11,13H2,1-2H3
| InChIKey = IJHNSHDBIRRJRN-UHFFFAOYAU
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H20N2/c1-18(2)13-11-15(14-8-4-3-5-9-14)16-10-6-7-12-17-16/h3-10,12,15H,11,13H2,1-2H3 | StdInChI = 1S/C11H15NO/c1-9-11(13-8-7-12-9)10-5-3-2-4-6-10/h2-6,9,11-12H,7-8H2,1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = IJHNSHDBIRRJRN-UHFFFAOYSA-N | StdInChIKey = OOBHFESNSZDWIU-UHFFFAOYSA-N
}} }}

Revision as of 12:05, 5 December 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 456799834 of page Phenmetrazine with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
Routes of
administration		Oral, Intravenous, Vaporized, Insufflated, Suppository
ATC code
  • none
Legal status
Legal status
Pharmacokinetic data
Elimination half-life8 hours
ExcretionRenal
Identifiers
IUPAC name
  • 3-methyl-2-phenylmorpholine
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
Chemical and physical data
FormulaC11H15NO
Molar mass177.2456 g·mol
3D model (JSmol)
SMILES
  • O2C(c1ccccc1)C(NCC2)C
InChI
  • InChI=1S/C11H15NO/c1-9-11(13-8-7-12-9)10-5-3-2-4-6-10/h2-6,9,11-12H,7-8H2,1H3
  • Key:OOBHFESNSZDWIU-UHFFFAOYSA-N
  (what is this?)  (verify)