Revision as of 12:12, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Saving copy of the {{drugbox}} taken from revid 457135650 of page Phenylbutazone for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit |
Revision as of 12:13, 5 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Saving copy of the {{drugbox}} taken from revid 457166872 of page Phenylephrine for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 408955546 |
|
| verifiedrevid = 419188388 |
|
| IUPAC_name = 4-butyl-1,2-diphenyl-pyrazolidine-3,5-dione |
|
| IUPAC_name = (''R'')-3-phenol |
|
| image = Phenylbutazone.svg |
|
| image = Phenylephrine.png |
|
|
| image2 = phenylephrine3D.png |
|
| width = 200px |
|
|
| drug_name = Phenylbutazone |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
|
| Drugs.com = {{drugs.com|monograph|phenylephrine-hydrochloride}} |
|
| tradename = Butazolidine |
|
|
|
| MedlinePlus = a606008 |
|
| pregnancy_category = |
|
|
| legal_status = rx-only |
|
| pregnancy_AU = B2 |
|
|
| pregnancy_US = C |
|
| routes_of_administration = |
|
|
|
| legal_UK = GSL |
|
|
| legal_US = OTC |
|
|
| routes_of_administration = Oral, intranasal, ophthalmic, intravenous, intramuscular |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = 38% through GI tract |
|
| protein_bound = |
|
| protein_bound = 95% |
|
| metabolism = |
|
| metabolism = ] (]) |
|
| elimination_half-life = |
|
| elimination_half-life = 2.1 to 3.4 hours |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 50-33-9 |
|
| CAS_number = 59-42-7 |
|
|
| CAS_supplemental = <br/> {{CAS|61-76-7}} (]) <!-- Also CAS verified --> |
|
| ATC_prefix = M01 |
|
|
| ATC_suffix = AA01 |
|
| ATC_prefix = C01 |
|
|
| ATC_suffix = CA06 |
|
| ATC_supplemental = {{ATC|M02|AA01}} |
|
|
|
| ATC_supplemental = {{ATC|R01|AA04}}, {{ATC|R01|AB01}}, {{ATC|R01|BA03}}, {{ATC|S01|FB01}}, {{ATC|S01|GA05}} |
|
| PubChem = 4781 |
|
| PubChem = 6041 |
|
|
| IUPHAR_ligand = 485 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB00812 |
|
| DrugBank = DB00388 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4617 |
|
| ChemSpiderID = 5818 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = GN5P7K3T8S |
|
| UNII = 1WS297W6MV |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D00510 |
|
| KEGG = D08365 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI = 48574 |
|
| ChEBI = 8093 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 101 |
|
| ChEMBL = 1215 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=19 | H=20 | N=2 | O=2 |
|
| C=9 | H=13 | N=1 | O=2 |
|
| molecular_weight = 308.374 g/mol |
|
| molecular_weight = 167.205 g/mol |
|
| smiles = O=C2N(c1ccccc1)N(C(=O)C2CCCC)c3ccccc3 |
|
| smiles = O(c1cc(O)ccc1)CNC |
|
| InChI = 1/C19H20N2O2/c1-2-3-14-17-18(22)20(15-10-6-4-7-11-15)21(19(17)23)16-12-8-5-9-13-16/h4-13,17H,2-3,14H2,1H3 |
|
| InChI = 1/C9H13NO2/c1-10-6-9(12)7-3-2-4-8(11)5-7/h2-5,9-12H,6H2,1H3/t9-/m0/s1 |
|
| InChIKey = VYMDGNCVAMGZFE-UHFFFAOYAL |
|
| InChIKey = SONNWYBIRXJNDC-VIFPVBQEBB |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C19H20N2O2/c1-2-3-14-17-18(22)20(15-10-6-4-7-11-15)21(19(17)23)16-12-8-5-9-13-16/h4-13,17H,2-3,14H2,1H3 |
|
| StdInChI = 1S/C9H13NO2/c1-10-6-9(12)7-3-2-4-8(11)5-7/h2-5,9-12H,6H2,1H3/t9-/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = VYMDGNCVAMGZFE-UHFFFAOYSA-N |
|
| StdInChIKey = SONNWYBIRXJNDC-VIFPVBQESA-N |
|
}} |
|
}} |