| Revision as of 14:14, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444066147 of page Prephytoene_diphosphate for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 14:15, 5 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 458268867 of page Priliximab for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 444064303 |
|
| verifiedrevid = 458268007 |
|
|ImageFile=Prephytoene diphosphate.png |
|
|
|
| image = |
|
|ImageSize=250px |
|
|
|
|
|
|IUPACName=-2-cyclopropyl]methyl phosphono hydrogen phosphate |
|
|
|
<!--Monoclonal antibody data--> |
|
|OtherNames=Prephytoene pyrophosphate |
|
|
|
| type = mab |
|
|Section1={{Chembox Identifiers |
|
|
|
| mab_type = mab |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 4517882 |
|
| source = xi/o |
|
|
| target = ] |
|
| InChI = 1/C40H68O7P2/c1-31(2)17-11-19-33(5)21-13-23-35(7)25-15-26-37(9)29-38-39(30-46-49(44,45)47-48(41,42)43)40(38,10)28-16-27-36(8)24-14-22-34(6)20-12-18-32(3)4/h17-18,21-22,25,27,29,38-39H,11-16,19-20,23-24,26,28,30H2,1-10H3,(H,44,45)(H2,41,42,43)/b33-21+,34-22+,35-25+,36-27+,37-29+ |
|
|
|
|
|
| InChIKey = RVCNKTPCHZNAAO-QKUGLALCBM |
|
|
|
<!--Clinical data--> |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| tradename = |
|
| StdInChI = 1S/C40H68O7P2/c1-31(2)17-11-19-33(5)21-13-23-35(7)25-15-26-37(9)29-38-39(30-46-49(44,45)47-48(41,42)43)40(38,10)28-16-27-36(8)24-14-22-34(6)20-12-18-32(3)4/h17-18,21-22,25,27,29,38-39H,11-16,19-20,23-24,26,28,30H2,1-10H3,(H,44,45)(H2,41,42,43)/b33-21+,34-22+,35-25+,36-27+,37-29+ |
|
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| StdInChIKey = RVCNKTPCHZNAAO-QKUGLALCSA-N |
|
|
|
| pregnancy_category = |
| ⚫ |
| CASNo = <!-- blanked - oldvalue: 38005-61-7 --> |
|
|
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
| ⚫ |
| PubChem = 5365949 |
|
|
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ChEBI = 14885 |
|
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| SMILES = O=P(O)(O)OP(=O)(O)OCC1C(\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)C)C1(CC/C=C(/CC\C=C(/C)CC\C=C(/C)C)C)C |
|
|
|
| legal_status = |
|
}} |
|
|
|
| routes_of_administration = |
|
|Section2={{Chembox Properties |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| Formula=C<sub>40</sub>H<sub>68</sub>O<sub>7</sub>P<sub>2</sub> |
|
|
|
| ChemSpiderID = NA |
|
| MolarMass=722.91 g/mol |
|
|
|
|
|
| Appearance= |
|
|
|
<!--Pharmacokinetic data--> |
|
| Density= |
|
|
|
| bioavailability = |
|
| MeltingPt= |
|
|
|
| protein_bound = |
|
| BoilingPt= |
|
|
|
| metabolism = |
|
| Solubility= |
|
|
|
| elimination_half-life = |
|
}} |
|
|
|
| excretion = |
|
|Section3={{Chembox Hazards |
|
|
|
|
|
| MainHazards= |
|
|
|
<!--Identifiers--> |
|
| FlashPt= |
|
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| Autoignition= |
|
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 147191-91-1 --> |
|
}} |
|
|
|
| ATC_prefix = none |
|
|
| ATC_suffix = |
|
⚫ |
| PubChem = |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
|
|
|
|
<!--Chemical data--> |
|
|
| chemical_formula = |
|
|
|
|
|
| molecular_weight = |
|
}} |
|
}} |
