Revision as of 14:33, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 449585183 of page Properidine for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 14:34, 5 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 455964807 of page Propiconazole for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 443267009 |
|
| verifiedrevid = 430980069 |
|
| IUPAC_name = isopropyl 1-methyl-4-phenylpiperidine-4-carboxylate |
|
|
|
|Reference=<ref>''Merck Index'', 11th Edition, '''7830'''.</ref> |
|
| image = Properidine.svg |
|
|
|
|ImageFile=Propiconazole.png |
|
| width = 139px |
|
|
|
|ImageSize=180px |
|
|
|
|
|
|IUPACName=1-methyl]-1,2,4-triazole |
|
<!--Clinical data--> |
|
|
|
|OtherNames= |
|
| tradename = |
|
|
|
|Section1= {{Chembox Identifiers |
|
| routes_of_administration = |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
|
⚫ |
| ChemSpiderID = 39402 |
|
<!--Identifiers--> |
|
|
|
| InChI = 1/C15H17Cl2N3O2/c1-2-3-12-7-21-15(22-12,8-20-10-18-9-19-20)13-5-4-11(16)6-14(13)17/h4-6,9-10,12H,2-3,7-8H2,1H3 |
|
| CAS_number = <!-- blanked - oldvalue: 561-76-2 --> |
|
|
|
| InChIKey = STJLVHWMYQXCPB-UHFFFAOYAJ |
|
| ATC_prefix = none |
|
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
⚫ |
| PubChem = 62373 |
|
|
|
| ChEMBL = 560579 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 56161 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
⚫ |
| UNII = R1493W1CJ0 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=16 | H=23 | N=1 | O=2 |
|
|
| molecular_weight = 261.36 g/mol |
|
|
| smiles = O=C(OC(C)C)C2(c1ccccc1)CCN(C)CC2 |
|
|
| InChI = 1/C16H23NO2/c1-13(2)19-15(18)16(9-11-17(3)12-10-16)14-7-5-4-6-8-14/h4-8,13H,9-12H2,1-3H3 |
|
|
| InChIKey = XJKQCILVUHXVIQ-UHFFFAOYAW |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C16H23NO2/c1-13(2)19-15(18)16(9-11-17(3)12-10-16)14-7-5-4-6-8-14/h4-8,13H,9-12H2,1-3H3 |
|
| StdInChI = 1S/C15H17Cl2N3O2/c1-2-3-12-7-21-15(22-12,8-20-10-18-9-19-20)13-5-4-11(16)6-14(13)17/h4-6,9-10,12H,2-3,7-8H2,1H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = XJKQCILVUHXVIQ-UHFFFAOYSA-N |
|
| StdInChIKey = STJLVHWMYQXCPB-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| synonyms = Ipropethidine |
|
|
|
| CASNo=60207-90-1 |
|
⚫ |
| PubChem=43234 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = C11121 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
⚫ |
| UNII = 142KW8TBSR |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 8489 |
|
|
| SMILES = Clc1ccc(c(Cl)c1)C2(OCC(O2)CCC)Cn3ncnc3 |
|
|
}} |
|
|
|Section2= {{Chembox Properties |
|
|
| Formula=C<sub>15</sub>H<sub>17</sub>Cl<sub>2</sub>N<sub>3</sub>O<sub>2</sub> |
|
|
| MolarMass=342.22038 |
|
|
| Appearance= |
|
|
| Density= |
|
|
| MeltingPt= |
|
|
| BoilingPt=180 °C at 0.1 mmHg |
|
|
| Solubility=100 ppm at 20 °C |
|
|
}} |
|
|
|Section3= {{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |