Revision as of 14:34, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 455964807 of page Propiconazole for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 14:34, 5 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 455524509 of page Propidium_iodide for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 430980069 |
|
| verifiedrevid = 439273118 |
|
⚫ |
|ImageFile=Propidium iodide.png |
|
|Reference=<ref>''Merck Index'', 11th Edition, '''7830'''.</ref> |
|
|
⚫ |
|ImageSize=200px |
⚫ |
|ImageFile=Propiconazole.png |
|
|
|
|IUPACName= |
⚫ |
|ImageSize=180px |
|
|
|IUPACName=1-methyl]-1,2,4-triazole |
|
|
|OtherNames= |
|
|OtherNames= |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 39402 |
|
| ChemSpiderID = 94732 |
|
⚫ |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| InChI = 1/C15H17Cl2N3O2/c1-2-3-12-7-21-15(22-12,8-20-10-18-9-19-20)13-5-4-11(16)6-14(13)17/h4-6,9-10,12H,2-3,7-8H2,1H3 |
|
|
⚫ |
| ChEMBL = 345124 |
|
| InChIKey = STJLVHWMYQXCPB-UHFFFAOYAJ |
|
|
|
| InChI = 1/C27H33N4.2HI/c1-4-31(3,5-2)17-9-16-30-26-19-22(29)13-15-24(26)23-14-12-21(28)18-25(23)27(30)20-10-7-6-8-11-20;;/h6-8,10-15,18-19,29H,4-5,9,16-17,28H2,1-3H3;2*1H/q+1;;/p-1 |
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
|
| InChIKey = XJMOSONTPMZWPB-REWHXWOFAB |
⚫ |
| ChEMBL = 560579 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C15H17Cl2N3O2/c1-2-3-12-7-21-15(22-12,8-20-10-18-9-19-20)13-5-4-11(16)6-14(13)17/h4-6,9-10,12H,2-3,7-8H2,1H3 |
|
| StdInChI = 1S/C27H33N4.2HI/c1-4-31(3,5-2)17-9-16-30-26-19-22(29)13-15-24(26)23-14-12-21(28)18-25(23)27(30)20-10-7-6-8-11-20;;/h6-8,10-15,18-19,29H,4-5,9,16-17,28H2,1-3H3;2*1H/q+1;;/p-1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = STJLVHWMYQXCPB-UHFFFAOYSA-N |
|
| StdInChIKey = XJMOSONTPMZWPB-UHFFFAOYSA-M |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=60207-90-1 |
|
| CASNo=25535-16-4 |
|
| PubChem=43234 |
|
| PubChem=104981 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| KEGG = C11121 |
|
| ChEBI = 51240 |
|
|
| SMILES = CC(C)(CC)CCC1c2cc(ccc2c3ccc(cc3c1c4ccccc4)N)N.. |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = 142KW8TBSR |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 8489 |
|
|
| SMILES = Clc1ccc(c(Cl)c1)C2(OCC(O2)CCC)Cn3ncnc3 |
|
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>15</sub>H<sub>17</sub>Cl<sub>2</sub>N<sub>3</sub>O<sub>2</sub> |
|
| Formula=C<sub>27</sub>H<sub>34</sub>I<sub>2</sub>N<sub>4</sub> |
|
| MolarMass=342.22038 |
|
| MolarMass=668.3946 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
|
| BoilingPt= |
|
| BoilingPt=180 °C at 0.1 mmHg |
|
|
| Solubility=100 ppm at 20 °C |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |