Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 14:39, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 423410780 of page Propyl_gallate for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 14:40, 5 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456520942 of page Propylamine for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| Verifiedfields = changed
| verifiedrevid = 417944155 | verifiedrevid = 412566413
| Name = Propyl gallate
| ImageFile = Propyl gallate.svg | Name = Propylamine
| ImageSize = 220px | ImageFile = Propylamine.png
| ImageName = Propyl gallate | ImageSize = 120px
| ImageName = Propylamine
| IUPACName = Propyl&nbsp;3,4,5-trihydroxybenzoate
| IUPACName = Propan-1-amine
| OtherNames = Gallic acid, propyl ester<br>''n''-Propyl gallate<br>E310
| OtherNames = ''n''-Propylamine<br />1-Aminopropane
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 39870
| SMILES = CCCN
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4778 | ChemSpiderID = 7564
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8D4SNN7V92
| InChI = 1/C10H12O5/c1-2-3-15-10(14)6-4-7(11)9(13)8(12)5-6/h4-5,11-13H,2-3H2,1H3
| InChIKey = ZTHYODDOHIVTJV-UHFFFAOYAT
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 7983 | ChEMBL = 14409
| PubChem = 7852
| InChI = 1/C3H9N/c1-2-3-4/h2-4H2,1H3
| InChIKey = WGYKZJWCGVVSQN-UHFFFAOYAG
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C10H12O5/c1-2-3-15-10(14)6-4-7(11)9(13)8(12)5-6/h4-5,11-13H,2-3H2,1H3 | StdInChI = 1S/C3H9N/c1-2-3-4/h2-4H2,1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ZTHYODDOHIVTJV-UHFFFAOYSA-N | StdInChIKey = WGYKZJWCGVVSQN-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 121-79-9 | CASNo = 107-10-8
| EINECS = 204-498-2 | RTECS =
| PubChem = 4947
| SMILES = O=C(OCCC)c1cc(O)c(O)c(O)c1
| MeSHName = Propyl+Gallate
}} }}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| Formula = ]<sub>10</sub>]<sub>12</sub>]<sub>5</sub> | Formula = C<sub>3</sub>H<sub>9</sub>N
| MolarMass = 212.20 g/mol | MolarMass = 59.11 g/mol
| Appearance = White crystalline powder | Appearance = Colorless liquid
| Density = | Density = 0.719 g/cm<sup>3</sup>, liquid
| MeltingPt = 150&nbsp;°C
| BoilingPt = Decomposes
| Solubility = | Solubility =
| MeltingPtC = -83
| BoilingPtC = 48
| pKa = 10.53<ref>Hall, H.K., ''J. Am. Chem. Soc.'', '''1957''', ''79'', 5441.</ref>
| Viscosity =
}} }}
| Section3 = {{Chembox Hazards | Section3 = {{Chembox Structure
| Dipole =
}}
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| MainHazards = | MainHazards =
| FlashPt = | FlashPt =
| Autoignition = | RPhrases =
| SPhrases =
}}
| Section8 = {{Chembox Related
| Function = ]s
| OtherFunctn = ]<br>]
| OtherCpds =
}} }}
}} }}

Revision as of 14:40, 5 December 2011

This page contains a copy of the infobox ({{chembox}}) taken from revid 456520942 of page Propylamine with values updated to verified values.
Propylamine
Propylamine
Names
IUPAC name Propan-1-amine
Other names n-Propylamine
1-Aminopropane
Identifiers
CAS Number
3D model (JSmol)
ChEBI
ChEMBL
ChemSpider
PubChem CID
InChI
  • InChI=1S/C3H9N/c1-2-3-4/h2-4H2,1H3Key: WGYKZJWCGVVSQN-UHFFFAOYSA-N
  • InChI=1/C3H9N/c1-2-3-4/h2-4H2,1H3Key: WGYKZJWCGVVSQN-UHFFFAOYAG
SMILES
  • CCCN
Properties
Chemical formula C3H9N
Molar mass 59.11 g/mol
Appearance Colorless liquid
Density 0.719 g/cm, liquid
Melting point −83 °C (−117 °F; 190 K)
Boiling point 48 °C (118 °F; 321 K)
Acidity (pKa) 10.53
Related compounds
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound
  1. Hall, H.K., J. Am. Chem. Soc., 1957, 79, 5441.