Revision as of 14:39, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 423410780 of page Propyl_gallate for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 14:40, 5 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456520942 of page Propylamine for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 417944155 |
|
| verifiedrevid = 412566413 |
|
| Name = Propyl gallate |
|
|
| ImageFile = Propyl gallate.svg |
|
| Name = Propylamine |
|
| ImageSize = 220px |
|
| ImageFile = Propylamine.png |
|
| ImageName = Propyl gallate |
|
| ImageSize = 120px |
|
|
| ImageName = Propylamine |
|
| IUPACName = Propyl 3,4,5-trihydroxybenzoate |
|
|
|
| IUPACName = Propan-1-amine |
|
| OtherNames = Gallic acid, propyl ester<br>''n''-Propyl gallate<br>E310 |
|
|
|
| OtherNames = ''n''-Propylamine<br />1-Aminopropane |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 39870 |
|
|
| SMILES = CCCN |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4778 |
|
| ChemSpiderID = 7564 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 8D4SNN7V92 |
|
|
| InChI = 1/C10H12O5/c1-2-3-15-10(14)6-4-7(11)9(13)8(12)5-6/h4-5,11-13H,2-3H2,1H3 |
|
|
| InChIKey = ZTHYODDOHIVTJV-UHFFFAOYAT |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 7983 |
|
| ChEMBL = 14409 |
|
⚫ |
| PubChem = 7852 |
|
|
| InChI = 1/C3H9N/c1-2-3-4/h2-4H2,1H3 |
|
|
| InChIKey = WGYKZJWCGVVSQN-UHFFFAOYAG |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C10H12O5/c1-2-3-15-10(14)6-4-7(11)9(13)8(12)5-6/h4-5,11-13H,2-3H2,1H3 |
|
| StdInChI = 1S/C3H9N/c1-2-3-4/h2-4H2,1H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ZTHYODDOHIVTJV-UHFFFAOYSA-N |
|
| StdInChIKey = WGYKZJWCGVVSQN-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 121-79-9 |
|
| CASNo = 107-10-8 |
|
| EINECS = 204-498-2 |
|
| RTECS = |
⚫ |
| PubChem = 4947 |
|
|
| SMILES = O=C(OCCC)c1cc(O)c(O)c(O)c1 |
|
|
| MeSHName = Propyl+Gallate |
|
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula = ]<sub>10</sub>]<sub>12</sub>]<sub>5</sub> |
|
| Formula = C<sub>3</sub>H<sub>9</sub>N |
|
| MolarMass = 212.20 g/mol |
|
| MolarMass = 59.11 g/mol |
|
| Appearance = White crystalline powder |
|
| Appearance = Colorless liquid |
|
| Density = |
|
| Density = 0.719 g/cm<sup>3</sup>, liquid |
|
| MeltingPt = 150 °C |
|
|
| BoilingPt = Decomposes |
|
|
| Solubility = |
|
| Solubility = |
|
|
| MeltingPtC = -83 |
|
|
| BoilingPtC = 48 |
|
|
| pKa = 10.53<ref>Hall, H.K., ''J. Am. Chem. Soc.'', '''1957''', ''79'', 5441.</ref> |
|
|
| Viscosity = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
| Section3 = {{Chembox Structure |
|
|
| Dipole = |
|
|
}} |
|
|
| Section7 = {{Chembox Hazards |
|
|
| ExternalMSDS = |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| RPhrases = |
|
|
| SPhrases = |
|
|
}} |
|
|
| Section8 = {{Chembox Related |
|
|
| Function = ]s |
|
|
| OtherFunctn = ]<br>] |
|
|
| OtherCpds = |
|
}} |
|
}} |
|
}} |
|
}} |