Revision as of 16:24, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 469831220 of page Ammonia_borane for the Chem/Drugbox validation project (updated: 'ChemSpiderID', 'StdInChI', 'StdInChIKey', 'CASNo').← Previous edit | Revision as of 16:24, 9 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 469888543 of page CHAPS_detergent for the Chem/Drugbox validation project (updated: 'StdInChI', 'StdInChIKey').Next edit → | ||
Line 1: | Line 1: | ||
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} | {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} | ||
{{Chembox | {{Chembox | ||
| Verifiedfields = changed | | Verifiedfields = changed | ||
⚫ | | verifiedrevid = 459989405 | ||
| Watchedfields = changed | |||
| ImageFile = CHAPS.png | |||
⚫ | | verifiedrevid = |
||
| ImageName = Structural formula of CHAPS detergent | |||
| ImageFile = Ammonia-borane-from-xtal-3D-balls.png | |||
| PIN = 3--1-<br /> | |||
⚫ | | |
||
propanesulfonate | |||
| ImageSize = 121 | |||
| SystematicName = 3-{Dimethyl[3-(4-{5,9,16-trihydroxy-2,15-<br /> | |||
| ImageName = Ball and stick model of ammonia borane | |||
dimethyltetracyclo<br /> | |||
| IUPACName = Ammonia borane | |||
heptadecan-14-yl}pentanamido)propyl]<br /> | |||
| OtherNames = Borazane | |||
azaniumyl}propane-1-sulfonate | |||
| OtherNames = 3-{Dimethyl[3-(4-{5,9,16-trihydroxy-2,15-<br /> | |||
dimethyltetracyclo<br /> | |||
heptadecan-14-yl}pentanamido)propyl]aminio}<br /> | |||
propane-1-sulfonate | |||
| Section1 = {{Chembox Identifiers | | Section1 = {{Chembox Identifiers | ||
| Abbreviations = CHAPS | |||
⚫ | | |
||
| InChI = 1/C32H58N2O7S/c1-21(8-11-29(38)33-14-6-15-34(4,5)16-7-17-42(39,40)41)24-9-10-25-30-26(20-28(37)32(24,25)3)31(2)13-12-23(35)18-22(31)19-27(30)36/h21-28,30,35-37H,6-20H2,1-5H3,(H-,33,38,39,40,41)/t21-,22+,23-,24-,25+,26+,27-,28+,30+,31+,32-/m1/s1 | |||
| CASNo = <!-- blanked - oldvalue: 13774-81-7 --> | |||
| InChIKey = UMCMPZBLKLEWAF-BCTGSCMUBQ | |||
⚫ | | |
||
| SMILES1 = S(=O)(=O)CCC(C)(C)CCCNC(=O)CC(C)4CC32(1((C(O)CC1)C2O)C)C(O)34C | |||
⚫ | | PubChem_Ref = {{Pubchemcite |
||
| InChI1 = 1S/C32H58N2O7S/c1-21(8-11-29(38)33-14-6-15-34(4,5)16-7-17-42(39,40)41)24-9-10-25-30-26(20-28(37)32(24,25)3)31(2)13-12-23(35)18-22(31)19-27(30)36/h21-28,30,35-37H,6-20H2,1-5H3,(H-,33,38,39,40,41)/t21-,22+,23-,24-,25+,26+,27-,28+,30+,31+,32-/m1/s1 | |||
⚫ | | ChemSpiderID = |
||
| InChIKey1 = UMCMPZBLKLEWAF-BCTGSCMUSA-N | |||
⚫ | | ChemSpiderID_Ref = {{chemspidercite| |
||
| |
| CASNo = 75621-03-3 | ||
⚫ | | CASNo_Ref = {{cascite|correct|CAS}} | ||
| SMILES1 = | |||
⚫ | | ChEMBL_Ref = {{ebicite|correct|EBI}} | ||
| StdInChI = 1S/BH3.H3N/h2*1H3 | |||
| ChEMBL = 450950 | |||
⚫ | | |
||
⚫ | | PubChem = 107670 | ||
⚫ | | |
||
⚫ | | PubChem_Ref = {{Pubchemcite}} | ||
⚫ | | |
||
| PubChem1 = 24883538 | |||
| PubChem1_Comment = (),(5''R'',7''S'',<br /> | |||
16''S'') | |||
| PubChem1_Ref = {{Pubchemcite}} | |||
| PubChem2 = 10371606 | |||
| PubChem2_Comment = (),(1''S'',5''R'',11''S'',<br /> | |||
16''S'') | |||
| PubChem2_Ref = {{Pubchemcite}} | |||
| PubChem3 = 25244640 | |||
| PubChem3_Comment = (4''R''),(2''S'',5''R'',7''S'',<br /> | |||
15''R'',16''S'') | |||
| PubChem3_Ref = {{Pubchemcite}} | |||
| PubChem4 = 18397788 | |||
| PubChem4_Comment = (4''R''),(2''S'',5''R'',<br /> | |||
14''R'',15''R'',16''S'') | |||
| PubChem4_Ref = {{Pubchemcite}} | |||
| PubChem5 = 9895216 | |||
| PubChem5_Comment = (4''S''),<br /> | |||
(2''S'',5''R'',14''R'',15''S'',16''S'') | |||
| PubChem5_Ref = {{Pubchemcite}} | |||
⚫ | | ChemSpiderID = 96843 | ||
⚫ | | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = C11321 | |||
| MeSHName = 3-((3-Cholamidopropyl)dimethylammonium)-1-propanesulfonate | |||
| SMILES = CC(CCC(=O)NCCC(C)(C)CCCS()(=O)=O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C | |||
⚫ | | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | ||
| StdInChI = 1S/C32H58N2O7S/c1-21(8-11-29(38)33-14-6-15-34(4,5)16-7-17-42(39,40)41)24-9-10-25-30-26(20-28(37)32(24,25)3)31(2)13-12-23(35)18-22(31)19-27(30)36/h21-28,30,35-37H,6-20H2,1-5H3,(H-,33,38,39,40,41)/t21-,22+,23-,24-,25+,26+,27-,28+,30+,31+,32-/m1/s1 | |||
⚫ | | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | ||
⚫ | | StdInChIKey = UMCMPZBLKLEWAF-BCTGSCMUSA-N | ||
}} | }} | ||
| Section2 = {{Chembox Properties | | Section2 = {{Chembox Properties | ||
| C=32|H=58|N=2|O=7|S=1 | |||
| H = 6 | |||
| |
| LogP = -4.32 (predicted)}} | ||
| N = 1 | |||
| ExactMass = 31.059329663 g mol<sup>-1</sup> | |||
| Appearance = Colorless solid | |||
| Density = 0.780 g cm<sup>-3</sup> | |||
| MeltingPtC = 104 | |||
}} | |||
| Section3 = {{Chembox Structure | |||
| CrystalStruct = I4mm (orthorhombic, < 200K)(tetragonal, >200K) | |||
| Coordination = Tetragonal at B and N | |||
| MolShape = Tetrahydral at B and N | |||
| Dipole = 5.2 D | |||
}} | |||
| Section4 = {{Chembox Hazards | |||
| RPhrases = {{R5}} | |||
| SPhrases = {{S14}}, {{S15}}, {{S26}}, {{S36/37/39}} | |||
}} | |||
| Section8 = {{Chembox Related | |||
| OtherCpds = ]<br /> | |||
]<br /> | |||
]<br /> | |||
]<br /> | |||
}} | |||
}} | }} |
Revision as of 16:24, 9 January 2012
This page contains a copy of the infobox ({{chembox}}) taken from revid 469888543 of page CHAPS_detergent with values updated to verified values. |
{{Chembox
| Verifiedfields = changed
| verifiedrevid = 459989405
| ImageFile = CHAPS.png
| ImageName = Structural formula of CHAPS detergent
| PIN = 3--1-
propanesulfonate
| SystematicName = 3-{Dimethyl[3-(4-{5,9,16-trihydroxy-2,15-
dimethyltetracyclo
heptadecan-14-yl}pentanamido)propyl]
azaniumyl}propane-1-sulfonate
| OtherNames = 3-{Dimethyl[3-(4-{5,9,16-trihydroxy-2,15-
dimethyltetracyclo
heptadecan-14-yl}pentanamido)propyl]aminio}
propane-1-sulfonate
| Section1 = ! colspan=2 style="background: #f8eaba; text-align: center;" |Identifiers
|-
|
CAS Number|
|-
|
3D model (JSmol)|
|-
| Abbreviations | CHAPS |-
| ChEMBL
|
|- | ChemSpider
|
|-
| KEGG
|
|- | MeSH | 3-((3-Cholamidopropyl)dimethylammonium)-1-propanesulfonate |-
|
PubChem CID|
- 107670
- 24883538 (),(5R,7S,
16S) - 10371606 (),(1S,5R,11S,
16S) - 25244640 (4R),(2S,5R,7S,
15R,16S) - 18397788 (4R),(2S,5R,
14R,15R,16S) - 9895216 (4S),
(2S,5R,14R,15S,16S)
|-
| colspan="2" |
InChI- InChI=1S/C32H58N2O7S/c1-21(8-11-29(38)33-14-6-15-34(4,5)16-7-17-42(39,40)41)24-9-10-25-30-26(20-28(37)32(24,25)3)31(2)13-12-23(35)18-22(31)19-27(30)36/h21-28,30,35-37H,6-20H2,1-5H3,(H-,33,38,39,40,41)/t21-,22+,23-,24-,25+,26+,27-,28+,30+,31+,32-/m1/s1Key: UMCMPZBLKLEWAF-BCTGSCMUSA-N
- InChI=1/C32H58N2O7S/c1-21(8-11-29(38)33-14-6-15-34(4,5)16-7-17-42(39,40)41)24-9-10-25-30-26(20-28(37)32(24,25)3)31(2)13-12-23(35)18-22(31)19-27(30)36/h21-28,30,35-37H,6-20H2,1-5H3,(H-,33,38,39,40,41)/t21-,22+,23-,24-,25+,26+,27-,28+,30+,31+,32-/m1/s1Key: UMCMPZBLKLEWAF-BCTGSCMUBQ
- InChI=1S/C32H58N2O7S/c1-21(8-11-29(38)33-14-6-15-34(4,5)16-7-17-42(39,40)41)24-9-10-25-30-26(20-28(37)32(24,25)3)31(2)13-12-23(35)18-22(31)19-27(30)36/h21-28,30,35-37H,6-20H2,1-5H3,(H-,33,38,39,40,41)/t21-,22+,23-,24-,25+,26+,27-,28+,30+,31+,32-/m1/s1Key: UMCMPZBLKLEWAF-BCTGSCMUSA-N
|-
| colspan="2" |
SMILES- CC(CCC(=O)NCCC(C)(C)CCCS()(=O)=O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C
- S(=O)(=O)CCC(C)(C)CCCNC(=O)CC(C)4CC32(1((C(O)CC1)C2O)C)C(O)34C
|- | Section2 = ! colspan=2 style="background: #f8eaba; text-align: center;" |Properties
|-
|
Chemical formula| C32H58N2O7S
|- | Molar mass
| 614.88 g·mol
|-
| log P | -4.32 (predicted) |- }}