| Revision as of 12:31, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 467777703 of page Tetrabenazine for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 12:31, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 455418784 of page Tetraborane for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{chembox |
|
|
| ImageFile = Tetraborane-3D-balls.png |
|
| Watchedfields = changed |
|
|
|
| ImageSize = 200px |
|
| verifiedrevid = 419296654 |
|
|
|
| ImageName = ball-and-stick model of tetraborane |
|
| IUPAC_name = (''SS'',''RR'')-3-Isobutyl-9,10-dimethoxy-1,3,4,6,7,11b-hexahydro-pyridoisoquinolin-2-one |
|
|
|
| OtherNames = |
|
| image = (RR,SS)-Tetrabenazine Structural Formulae.png<!-- stereochemistry??? --> |
|
|
|
| IUPACName =tetraborane(10)<br />''arachno''-B<sub>4</sub>H<sub>10</sub> |
|
| image2 = Tetrabenazine3d.png |
|
|
|
| Section1 = {{Chembox Identifiers |
|
| imagename = 1 : 1 mixture (racemate) |
|
|
|
| CASNo = <!-- blanked - oldvalue: 18283-93-7 --> |
|
| drug_name = Tetrabenazine |
|
|
|
| ChEBI = 33592 |
|
|
|
|
⚫ |
| ChemSpiderID = 21865171 |
|
<!--Clinical data--> |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| tradename = Xenazine |
|
|
|
| InChI=1/B4H10/c5-1-3(5)2(7-3)4(1,3,6-1)8-2/h3-4H,1-2H2 |
|
| Drugs.com = {{drugs.com|CDI|tetrabenazine}} |
|
|
|
| InChIKey = WEYOKDYZYYMRSQ-UHFFFAOYAQ |
|
| pregnancy_category = C |
|
|
|
| StdInChI = 1S/B4H10/c5-1-3(5)2(7-3)4(1,3,6-1)8-2/h3-4H,1-2H2 |
|
| legal_status = ℞-only (US) |
|
|
⚫ |
| StdInChIKey = WEYOKDYZYYMRSQ-UHFFFAOYSA-N |
|
| routes_of_administration = Oral (tablets, 25 mg) |
|
|
|
}} |
|
|
|
|
|
| Section2 = {{Chembox Properties |
|
<!--Pharmacokinetic data--> |
|
|
|
| Reference = <ref>{{RubberBible62nd|page=B-84}}.</ref> |
|
| bioavailability = Low, extensive ] |
|
|
|
| Formula = B<sub>4</sub>H<sub>10</sub> |
|
| protein_bound = 82–85% |
|
|
|
| MolarMass = 53.32 g/mol |
|
| metabolism = ] (]-mediated) |
|
|
|
| Appearance = colourless gas |
|
| excretion = ] and fecal |
|
|
|
| Density = 2.3 kg m<sup>-3</sup> (gas) |
|
|
|
|
|
| Solvent = |
|
<!--Identifiers--> |
|
|
|
| SolubleOther = |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
|
| MeltingPt = −120.8 °C |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
|
| BoilingPt = 18 °C }} |
|
| CAS_number = 58-46-8 |
|
|
| ATC_prefix = N07 |
|
|
| ATC_suffix = XX06 |
|
|
| PubChem = 6018 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB04844 |
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ⚫ |
| ChemSpiderID = 5796 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = Z9O08YRN8O |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D08575 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 117785 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=19 | H=27 | N=1 | O=3 |
|
|
| molecular_weight = 317.427 g/mol |
|
|
| smiles = O=C3C(CC(C)C)CN2C(c1c(cc(OC)c(OC)c1)CC2)C3 |
|
|
| InChI = 1/C19H27NO3/c1-12(2)7-14-11-20-6-5-13-8-18(22-3)19(23-4)9-15(13)16(20)10-17(14)21/h8-9,12,14,16H,5-7,10-11H2,1-4H3 |
|
|
| InChIKey = MKJIEFSOBYUXJB-UHFFFAOYAN |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C19H27NO3/c1-12(2)7-14-11-20-6-5-13-8-18(22-3)19(23-4)9-15(13)16(20)10-17(14)21/h8-9,12,14,16H,5-7,10-11H2,1-4H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| ⚫ |
| StdInChIKey = MKJIEFSOBYUXJB-UHFFFAOYSA-N |
|
|
| synonyms = Ro-1-9569 |
|
|
}} |
|
}} |
