Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 13:00, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,054 edits Saving copy of the {{chembox}} taken from revid 465715899 of page Thiirane for the Chem/Drugbox validation project (updated: 'KEGG').← Previous edit Revision as of 13:00, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,054 edits Saving copy of the {{chembox}} taken from revid 455772276 of page Thioacetamide for the Chem/Drugbox validation project (updated: 'KEGG').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{chembox
| Verifiedfields = changed | Verifiedfields = changed
| verifiedrevid = 418298272
| Watchedfields = changed
| Name = Thioacetamide
| verifiedrevid = 433987901
| ImageFile = TA.png
| ImageFile2 = Ethylene-sulfide-3D-balls.png
| ImageSize = 140px
| ImageFile2_Ref = {{chemboximage|correct|??}}
| ImageName = Structural formula
| ImageSize2 = 121
| ImageFile1 = Thioacetamide-3D-balls.png
| ImageName2 = Ball and model of thiirane
| ImageSize1 = 170px
| ImageFileL1 = Ethylene-sulfide-2D-skeletal.png
| ImageName1 = Ball-and-stick model
| ImageFileL1_Ref = {{chemboximage|correct|??}}
| PIN = Ethanethioamide
| ImageSizeL1 = 121
| IUPACName = Thioacetamide
| ImageNameL1 = Skeletal formula of thiirane
| OtherNames = acetothioamide, TAA, thioacetimidic acid, TA
| ImageFileR1 = Ethylene-sulfide-3D-vdW.png
| ImageFileR1_Ref = {{chemboximage|correct|??}}
| ImageSizeR1 = 121
| ImageNameR1 = Spacefill model of thiirane
| SystematicName = Thiirane<ref name = "thiirane (CHEBI:30977)" >{{Cite web|url = http://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:30977|title = thiirane (CHEBI:30977)|work = Chemical Entities of Biological Interest (ChEBI)|location = UK|publisher = European Bioinformatics Institute}}</ref>
| OtherNames = 2,3-Dihydrothiirene<ref name = "thiirane (CHEBI:30977)" /><br />
Ethylene sulfide<ref name = "thiirane (CHEBI:30977)" /><br />
Thiacyclopropane<ref name = "thiirane (CHEBI:30977)" />
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| UNII_Ref = {{fdacite|changed|FDA}}
| CASNo = 420-12-2
| UNII = 075T165X8M
| CASNo_Ref = {{cascite|correct|CAS}}
| ChEBI_Ref = {{ebicite|changed|EBI}}
| PubChem = 9865
| ChEBI = 32497
| PubChem_Ref = {{Pubchemcite|correct|pubchem}}
| SMILES = S=C(N)C
| ChemSpiderID = 9481
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2006126
| EINECS = 206-993-9
| UNNumber = 1992 | PubChem = 2723949
| InChI = 1/C2H5NS/c1-2(3)4/h1H3,(H2,3,4)
| KEGG = <!-- blanked - oldvalue: C19419 -->
| InChIKey = YUKQRDCYNOVPGJ-UHFFFAOYAD
| KEGG_Ref = {{keggcite|correct|kegg}}
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| MeSHName = ethylene+sulfide
| ChEMBL = 38737
| ChEBI_Ref = {{ebicite|changed|EBI}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| ChEBI = 30977
| StdInChI = 1S/C2H5NS/c1-2(3)4/h1H3,(H2,3,4)
| RTECS = KX3500000
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| Beilstein = 102379
| StdInChIKey = YUKQRDCYNOVPGJ-UHFFFAOYSA-N
| Gmelin = 1278
| SMILES = C1CS1 | CASNo = 62-55-5
| CASNo_Ref = {{cascite|correct|CAS}}
| StdInChI = 1S/C2H4S/c1-2-3-1/h1-2H2
| RTECS = AC8925000
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| KEGG_Ref = {{keggcite|changed|kegg}}
| StdInChIKey = VOVUARRWDCVURC-UHFFFAOYSA-N
| KEGG = <!-- blanked - oldvalue: C19302 -->
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
}} }}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| Formula = C<sub>2</sub>H<sub>5</sub>NS
| C = 2
| H = 4 | MolarMass = 75.13 g/mol
| Appearance = colourless crystals, slight ] odor
| S = 1
| Density = 1.269 g/cm³<!--from X-ray structure -->
| ExactMass = 60.003370818 g mol<sup>−1</sup>
| Appearance = Pale, yellow liquid | Solubility = good, with hydrolysis
| MeltingPt = 115 °C
| Density = 1.01 g cm<sup>−3</sup>
| MeltingPtC = -109 | BoilingPt = decomp.
}}
| BoilingPtK = 329
| Section3 = {{Chembox Structure
| VaporPressure = 28.6 kPa (at 20 °C)
| CrystalStruct = ]
}}
| Dipole =
| Section4 = {{Chembox Thermochemistry
}}
| DeltaHf = 51-53 kJ mol<sup>-1</sup>
| Section7 = {{Chembox Hazards
| DeltaHc = -2.0126 MJ mol<sup>-1</sup>
| ExternalMSDS =
}}
| MainHazards = stench
| Section5 = {{Chembox Hazards
| FlashPt = ?°C
| GHSPictograms = {{GHS flame}} {{GHS corrosion}} {{GHS skull and crossbones}}
| RPhrases = R22 R36 R37 R45
| GHSSignalWord = '''DANGER'''
| SPhrases = S45 S53
| HPhrases = {{H-phrases|225|301|318|331}}
}}
| PPhrases = {{P-phrases|210|261|280|301+310|305+351+338|311}}
| Section8 = {{Chembox Related
| EUClass = {{Hazchem F}} {{Hazchem T}}
| OtherCpds = ], dithioacetic acid
| RPhrases = {{R11}}, {{R23/25}}, {{R41}}
}}
| SPhrases = {{S16}}, {{S36/37/39}}, {{S45}}
| NFPA-F = 4
| NFPA-H = 3
| NFPA-R = 2
| FlashPt = 10 °C
}}
| Section6 = {{Chembox Related
| Function = ]
| OtherFunctn = ]<br />]<br />]
}}
}} }}

Revision as of 13:00, 10 January 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 455772276 of page Thioacetamide with values updated to verified values.
Thioacetamide
Structural formula
Structural formula
Ball-and-stick model
Ball-and-stick model
Names
IUPAC name Thioacetamide
Preferred IUPAC name Ethanethioamide
Other names acetothioamide, TAA, thioacetimidic acid, TA
Identifiers
CAS Number
3D model (JSmol)
ChEBI
ChEMBL
ChemSpider
PubChem CID
RTECS number
  • AC8925000
UNII
InChI
  • InChI=1S/C2H5NS/c1-2(3)4/h1H3,(H2,3,4)Key: YUKQRDCYNOVPGJ-UHFFFAOYSA-N
  • InChI=1/C2H5NS/c1-2(3)4/h1H3,(H2,3,4)Key: YUKQRDCYNOVPGJ-UHFFFAOYAD
SMILES
  • S=C(N)C
Properties
Chemical formula C2H5NS
Molar mass 75.13 g/mol
Appearance colourless crystals, slight mercaptan odor
Density 1.269 g/cm³
Melting point 115 °C
Boiling point decomp.
Solubility in water good, with hydrolysis
Structure
Crystal structure monoclinic
Hazards
Occupational safety and health (OHS/OSH):
Main hazards stench
Flash point ?°C
Related compounds
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic