Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 13:00, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 455772276 of page Thioacetamide for the Chem/Drugbox validation project (updated: 'KEGG').← Previous edit Revision as of 13:00, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447556549 of page Thioacetazone for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{Drugbox
⚫ | verifiedrevid = 443222189
| Verifiedfields = changed
| IUPAC_name = ''N''-{4-phenyl}acetamide
⚫ | verifiedrevid = 418298272
| image = Thioacetazone.svg
| Name = Thioacetamide

| ImageFile = TA.png
<!--Clinical data-->
| ImageSize = 140px
| tradename =
| ImageName = Structural formula
| Drugs.com = {{drugs.com|international|thioacetazone}}
| ImageFile1 = Thioacetamide-3D-balls.png
| routes_of_administration = Oral
| ImageSize1 = 170px

| ImageName1 = Ball-and-stick model
<!--Identifiers-->
| PIN = Ethanethioamide
⚫ | CAS_number = <!-- blanked - oldvalue: 104-06-3 -->
| IUPACName = Thioacetamide
| ATC_prefix = J04
| OtherNames = acetothioamide, TAA, thioacetimidic acid, TA
| ATC_suffix = AM04
| Section1 = {{Chembox Identifiers
⚫ | ChEMBL = 375492
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = 075T165X8M | PubChem = 9568512
| ChEBI_Ref = {{ebicite|changed|EBI}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChEBI = 32497
| SMILES = S=C(N)C | ChemSpiderID = 7843221
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = MMG78X7SSR
| ChemSpiderID = 2006126
⚫ | KEGG_Ref = {{keggcite|correct|kegg}}
| PubChem = 2723949
| KEGG = D08584
| InChI = 1/C2H5NS/c1-2(3)4/h1H3,(H2,3,4)

| InChIKey = YUKQRDCYNOVPGJ-UHFFFAOYAD
<!--Chemical data-->
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| C=10 | H=12 | N=4 | O=1 | S=1
⚫ | ChEMBL = 38737
| molecular_weight = 236.3
| smiles = O=C(Nc1ccc(cc1)\C=N\NC(=S)N)C
| InChI = 1/C10H12N4OS/c1-7(15)13-9-4-2-8(3-5-9)6-12-14-10(11)16/h2-6H,1H3,(H,13,15)(H3,11,14,16)/b12-6+
| InChIKey = SRVJKTDHMYAMHA-WUXMJOGZBW
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C2H5NS/c1-2(3)4/h1H3,(H2,3,4) | StdInChI = 1S/C10H12N4OS/c1-7(15)13-9-4-2-8(3-5-9)6-12-14-10(11)16/h2-6H,1H3,(H,13,15)(H3,11,14,16)/b12-6+
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = YUKQRDCYNOVPGJ-UHFFFAOYSA-N | StdInChIKey = SRVJKTDHMYAMHA-WUXMJOGZSA-N
| synonyms = <small>''N''-phenyl]acetamide</small>
| CASNo = 62-55-5
| CASNo_Ref = {{cascite|correct|CAS}}
| RTECS = AC8925000
⚫ | KEGG_Ref = {{keggcite|changed|kegg}}
⚫ | KEGG = <!-- blanked - oldvalue: C19302 -->
}}
| Section2 = {{Chembox Properties
| Formula = C<sub>2</sub>H<sub>5</sub>NS
| MolarMass = 75.13 g/mol
| Appearance = colourless crystals, slight ] odor
| Density = 1.269 g/cm³<!--from X-ray structure -->
| Solubility = good, with hydrolysis
| MeltingPt = 115 °C
| BoilingPt = decomp.
}}
| Section3 = {{Chembox Structure
| CrystalStruct = ]
| Dipole =
}}
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| MainHazards = stench
| FlashPt = ?°C
| RPhrases = R22 R36 R37 R45
| SPhrases = S45 S53
}}
| Section8 = {{Chembox Related
| OtherCpds = ], dithioacetic acid
}}
}} }}

Revision as of 13:00, 10 January 2012

This page contains a copy of the infobox ({{drugbox}}) taken from revid 447556549 of page Thioacetazone with values updated to verified values.

{{Drugbox | verifiedrevid = 443222189 | IUPAC_name = N-{4-phenyl}acetamide | image = Thioacetazone.svg

| tradename = | Drugs.com = International Drug Names | routes_of_administration = Oral

| CAS_number = | ATC_prefix = J04 | ATC_suffix = AM04 | ChEMBL = 375492 | PubChem = 9568512 | DrugBank_Ref = | ChemSpiderID_Ref = | ChemSpiderID = 7843221 | UNII_Ref = | UNII = MMG78X7SSR | KEGG_Ref = | KEGG = D08584

| C=10 | H=12 | N=4 | O=1 | S=1 | molecular_weight = 236.3 | smiles = O=C(Nc1ccc(cc1)\C=N\NC(=S)N)C | InChI = 1/C10H12N4OS/c1-7(15)13-9-4-2-8(3-5-9)6-12-14-10(11)16/h2-6H,1H3,(H,13,15)(H3,11,14,16)/b12-6+ | InChIKey = SRVJKTDHMYAMHA-WUXMJOGZBW | StdInChI_Ref = | StdInChI = 1S/C10H12N4OS/c1-7(15)13-9-4-2-8(3-5-9)6-12-14-10(11)16/h2-6H,1H3,(H,13,15)(H3,11,14,16)/b12-6+ | StdInChIKey_Ref = | StdInChIKey = SRVJKTDHMYAMHA-WUXMJOGZSA-N | synonyms = N-phenyl]acetamide }}