Revision as of 13:20, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 411959587 of page Thioproscaline for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 13:20, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 468444172 of page Thioridazine for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{drugbox | Verifiedfields = changed |
|
{{chembox |
|
|
|
| Watchedfields = changed |
|
| verifiedrevid = 411958620 |
|
| verifiedrevid = 416502199 |
|
| ImageFile = Thioproscaline.png |
|
|
|
| IUPAC_name = 10-{2-ethyl}-<BR>2-methylsulfanylphenothiazine |
|
| ImageSize = |
|
|
|
| image = Thioridazine-2D-skeletal.png |
|
| IUPACName = 2-ethanamine |
|
|
| OtherNames = |
|
| width = 175 |
|
|
| image2 = Thioridazine3d.png |
|
| Section1 = {{Chembox Identifiers |
|
|
|
|
|
|
<!--Clinical data--> |
|
|
| Drugs.com = {{drugs.com|CDI|thioridazine}} |
|
|
| MedlinePlus = a682119 |
|
|
| pregnancy_category = Only if clearly needed |
|
|
| legal_status = RX-only-medication, non-narcotic |
|
|
| routes_of_administration = oral (tablets, concentration, sometimes syrup) |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = incomplete |
|
|
| metabolism = hepatic |
|
|
| elimination_half-life = 7–13 hours (up to 20 hours) |
|
|
| excretion = feces |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 50-52-2 |
|
|
| ATC_prefix = N05 |
|
|
| ATC_suffix = AC02 |
|
⚫ |
| PubChem = 5452 |
|
|
| IUPHAR_ligand = 100 |
|
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
|
| DrugBank = DB00679 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 21106393 |
|
| ChemSpiderID = 5253 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| InChI = 1/C13H21NO2S/c1-4-7-17-13-11(15-2)8-10(5-6-14)9-12(13)16-3/h8-9H,4-7,14H2,1-3H3 |
|
|
|
| UNII = N3D6TG58NI |
|
| InChIKey = BQFDSMXQCJFKCH-UHFFFAOYAY |
|
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D00373 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 9566 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 127855 |
|
| ChEMBL = 479 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=21 | H=26 | N=2 | S=2 |
|
|
| molecular_weight = 370.577 |
|
|
| smiles = S(c2cc1N(c3c(Sc1cc2)cccc3)CCC4N(C)CCCC4)C |
|
|
| InChI = 1/C21H26N2S2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(24-2)15-19(21)23/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C13H21NO2S/c1-4-7-17-13-11(15-2)8-10(5-6-14)9-12(13)16-3/h8-9H,4-7,14H2,1-3H3 |
|
| StdInChI = 1S/C21H26N2S2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(24-2)15-19(21)23/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = BQFDSMXQCJFKCH-UHFFFAOYSA-N |
|
| StdInChIKey = KLBQZWRITKRQQV-UHFFFAOYSA-N |
|
| CASNo = <!-- blanked - oldvalue: 90109-55-0 --> |
|
⚫ |
| PubChem = |
|
|
| SMILES = COc1cc(cc(OC)c1SCCC)CCN}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>13</sub>H<sub>21</sub>NO<sub>2</sub>S |
|
|
| MolarMass = 255.376 g/mol |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = |
|
|
| BoilingPt = |
|
|
| Solubility = }} |
|
|
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| Autoignition = }} |
|
|
}} |
|
}} |