Revision as of 13:40, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444407725 of page Tocofersolan for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 13:40, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 459240436 of page Tocopheryl_acetate for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
⚫ |
| verifiedrevid = 419011964 |
|
|
| ImageFile1 = Tocopheryl acetate.png |
|
|
| ImageSize1 = 200px |
|
|
| ImageFile2= Tocopheryl_acetate_3d_structure.png |
|
|
| ImageSize2 = 200px |
|
|
| IUPACName = chroman-6-yl] acetate |
|
|
| OtherNames = Tocopherol acetate <br>Vitamin E acetate |
|
⚫ |
| Section1 = {{Chembox Identifiers |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 77987 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = O03S90U1F2 |
|
| UNII = A7E6112E4N |
|
|
| InChI = 1/C31H52O3/c1-21(2)13-10-14-22(3)15-11-16-23(4)17-12-19-31(9)20-18-28-26(7)29(33-27(8)32)24(5)25(6)30(28)34-31/h21-23H,10-20H2,1-9H3/t22-,23-,31-/m1/s1 |
⚫ |
| verifiedrevid = 437190318 |
|
|
|
| InChIKey = ZAKOWWREFLAJOT-CEFNRUSXBQ |
|
|ImageFile=Tocophersolan.png |
|
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|ImageSize=250px |
|
|
|
| ChEMBL = 1047 |
|
|IUPACName=α--2''H''-1-benzopyran-6-yl]oxy]-1,4-dioxobutyl]-ω-hydroxy-poly(oxy-1,2-ethanediyl) |
|
|
|OtherNames=Tocofersolan; Vitamin E PEG succinate; α-Tocopherol polyethylene glycol succinate; Liqui-E |
|
⚫ |
|Section1={{Chembox Identifiers |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 64498 |
|
|
| InChI1 = 1/C35H58O6/c1-24(2)12-9-13-25(3)14-10-15-26(4)16-11-20-35(8)21-19-30-29(7)33(27(5)28(6)34(30)41-35)40-32(38)18-17-31(37)39-23-22-36/h24-26,36H,9-23H2,1-8H3 |
|
|
| InChIKey1 = AOBORMOPSGHCAX-UHFFFAOYAU |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C35H58O6/c1-24(2)12-9-13-25(3)14-10-15-26(4)16-11-20-35(8)21-19-30-29(7)33(27(5)28(6)34(30)41-35)40-32(38)18-17-31(37)39-23-22-36/h24-26,36H,9-23H2,1-8H3 |
|
| StdInChI = 1S/C31H52O3/c1-21(2)13-10-14-22(3)15-11-16-23(4)17-12-19-31(9)20-18-28-26(7)29(33-27(8)32)24(5)25(6)30(28)34-31/h21-23H,10-20H2,1-9H3/t22-,23-,31-/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = AOBORMOPSGHCAX-UHFFFAOYSA-N |
|
| StdInChIKey = ZAKOWWREFLAJOT-CEFNRUSXSA-N |
|
| CASNo = <!-- blanked - oldvalue: 9002-96-4 --> |
|
| CASNo = 58-95-7 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| PubChem=9938056 |
|
|
| ATCCode_prefix = A11 |
|
| PubChem = 86472 |
|
⚫ |
| SMILES = O=C(Oc2c(c(c1O(CCc1c2C)(C)CCC(C)CCC(C)CCCC(C)C)C)C)C |
|
| ATCCode_suffix = HA08 |
|
⚫ |
| SMILES = O=C(OCCO)CCC(=O)Oc2c(c(c1OC(CCc1c2C)(C)CCCC(C)CCCC(C)CCCC(C)C)C)C |
|
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula=(C<sub>2</sub>H<sub>4</sub>O)<sub>n</sub>C<sub>33</sub>H<sub>54</sub>O<sub>5</sub> |
|
| Formula = C<sub>31</sub>H<sub>52</sub>O<sub>3</sub> |
|
| MolarMass=Variable |
|
| MolarMass = 472.743 g/mol |
|
| Appearance= |
|
| Appearance = |
|
| Density= |
|
| Density = |
|
| MeltingPt= |
|
| MeltingPt = |
|
| BoilingPt= |
|
| BoilingPt = |
|
| Solubility= |
|
| Solubility = |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards = |
|
| FlashPt= |
|
| FlashPt = |
|
| Autoignition= |
|
| Autoignition = |
|
}} |
|
}} |
|
}} |
|
}} |