Revision as of 14:29, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 457003185 of page Trisulfane for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').← Previous edit |
Revision as of 14:30, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 458437763 of page Troglitazone for the Chem/Drugbox validation project (updated: 'DrugBank', 'CAS_number').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 456480794 |
|
| verifiedrevid = 458436759 |
|
|
| IUPAC_name = (''RS'')-5-(4-benzyl)thiazolidine-2,4-dione |
|
| ImageFile = Trisulfane.png |
|
|
|
| image = Troglitazone structure.png |
|
| SystematicName = Trisulfane<ref>{{Cite web|title = trisulfane (CHEBI:50365)|url = https://www.ebi.ac.uk/chebi/searchId.do?chebiId=50365|work = Chemical Entities of Biological Interest (ChEBI)|publisher = European Bioinformatics Institute|accessdate = 27 September 2011|location = UK|date = 18 August 2008|at = Main}}</ref> |
|
|
|
| width = 220px |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| imagename = Chemical structure of troglitazone |
⚫ |
| CASNo_Ref = {{cascite|changed|??}} |
|
|
|
| drug_name = Troglitazone |
⚫ |
| CASNo = <!-- blanked - oldvalue: 13845-23-3 --> |
|
|
|
|
⚫ |
| PubChem = 166718 |
|
|
|
<!--Clinical data--> |
|
| PubChem_Ref = {{Pubchemite|correct|Pubchem}} |
|
|
|
| tradename = |
⚫ |
| ChemSpiderID = 145860 |
|
|
|
| pregnancy_category = |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChEBI = 50365 |
|
| legal_status = |
|
|
| routes_of_administration = |
⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
|
|
|
| ChEMBL = <!-- blanked - oldvalue: 1235793 --> |
|
|
|
<!--Pharmacokinetic data--> |
⚫ |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
|
| bioavailability = |
|
| Beilstein = 3903006 |
|
|
| Gmelin = 25473 |
|
| protein_bound = |
|
| SMILES = SSS |
|
| metabolism = |
|
|
| elimination_half-life = 16-34 hours |
|
| StdInChI = 1S/H2S3/c1-3-2/h1-2H |
|
|
|
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
<!--Identifiers--> |
⚫ |
| StdInChIKey = KBMBVTRWEAAZEY-UHFFFAOYSA-N |
|
|
⚫ |
| CAS_number_Ref = {{cascite|changed|??}} |
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 97322-87-7 --> |
|
}} |
|
|
|
| ATC_prefix = A10 |
|
| Section2 = {{Chembox Properties |
|
|
| H = 2 |
|
| ATC_suffix = BG01 |
|
| S = 3 |
|
| ATC_supplemental = |
|
⚫ |
| PubChem = 5591 |
|
| ExactMass = 97.931862134 g mol<sup>-1</sup> |
|
|
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
| LogP = 1.237 |
|
|
| pKa = 5.826 |
|
| DrugBank = DB00197 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| pKb = 8.171 |
|
|
⚫ |
| ChemSpiderID = 5389 |
|
}} |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = I66ZZ0ZN0E |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D00395 |
|
⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 9753 |
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 408 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=24 | H=27 | N=1 | O=5 | S=1 |
|
|
| molecular_weight = 441.541 g/mol |
|
|
| smiles = O=C1NC(=O)SC1Cc4ccc(OCC3(Oc2c(c(c(O)c(c2CC3)C)C)C)C)cc4 |
|
|
| InChI = 1/C24H27NO5S/c1-13-14(2)21-18(15(3)20(13)26)9-10-24(4,30-21)12-29-17-7-5-16(6-8-17)11-19-22(27)25-23(28)31-19/h5-8,19,26H,9-12H2,1-4H3,(H,25,27,28) |
|
|
| InChIKey = GXPHKUHSUJUWKP-UHFFFAOYAV |
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C24H27NO5S/c1-13-14(2)21-18(15(3)20(13)26)9-10-24(4,30-21)12-29-17-7-5-16(6-8-17)11-19-22(27)25-23(28)31-19/h5-8,19,26H,9-12H2,1-4H3,(H,25,27,28) |
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = GXPHKUHSUJUWKP-UHFFFAOYSA-N |
|
}} |
|
}} |