Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 15:18, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 470612308 of page Dextromethorphan for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit Revision as of 15:19, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 470612306 of page Nadolol for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
| verifiedrevid = 460119608 | verifiedrevid = 461105623
| IUPAC_name = (2''R'',3''S'')-5-{oxy}-1,2,3,4-tetrahydronaphthalene-2,3-diol
| IUPAC_name = (+)-3-methoxy-17-methyl-(9α,13α,14α)-morphinan
| image = Dextromethorphan.svg | image = Nadolol.svg
| image2 = Dextromethorphan-from-xtal-3D-balls-A.png


<!--Clinical data--> <!--Clinical data-->
| tradename = Delsym | tradename = Corgard
| Drugs.com = {{drugs.com|monograph|dextromethorphan-hydrochloride}} | Drugs.com = {{drugs.com|monograph|nadolol}}
| MedlinePlus = a682492 | MedlinePlus = a682666
| pregnancy_AU = A | pregnancy_AU =
| pregnancy_US = C | pregnancy_US = C
| pregnancy_category =
| legal_AU = S2
| legal_US = OTC | legal_UK = POM
| legal_US = Rx-only
| legal_status =
| routes_of_administration = Oral | routes_of_administration = Oral


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability =
| bioavailability = 11%<ref>{{cite journal | last1 = Kukanich | first1 = B. | last2 = Papich | first2 = M. G. | title = Plasma profile and pharmacokinetics of dextromethorphan after intravenous and oral administration in healthy dogs | journal = Journal of Veterinary Pharmacology and Therapeutics | volume = 27 | issue = 5 | pages = 337–41 | year = 2004 | pmid = 15500572 | doi = 10.1111/j.1365-2885.2004.00608.x}}</ref>
| protein_bound = 30%
| metabolism = Hepatic (liver) enzymes: major ], minor ], and minor ]
| metabolism = Nil
| elimination_half-life = 1.4–3.9 hours | elimination_half-life = 14-24 hours
| excretion = ] | excretion = ] and fecal (unchanged)


<!--Identifiers--> <!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}} | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 125-71-3 | CAS_number = 42200-33-9
| ATC_prefix = R05 | ATC_prefix = C07
| ATC_suffix = DA09 | ATC_suffix = AA12
| PubChem = 15978238 | PubChem = 39147
| IUPHAR_ligand = 554
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} | DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB00514 | DrugBank = DB01203
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 13109865 | ChemSpiderID = 35815
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 7355X3ROTS | UNII = FEN504330V
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D03742 | KEGG = D00432
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 52440 | ChEMBL = 649


<!--Chemical data--> <!--Chemical data-->
| C=18 | H=25 | N=1 | O=1 | C=17 | H=27 | N=1 | O=4
| molecular_weight = 271.4 g/mol | molecular_weight = 309.401 g/mol
| smiles = O(c1ccc3c(c1)24((N(CC2)C)C3)CCCC4)C | smiles = OC(CNC(C)(C)C)COc1cccc2c1C(O)(O)C2
| InChI = 1/C18H25NO/c1-19-10-9-18-8-4-3-5-15(18)17(19)11-13-6-7-14(20-2)12-16(13)18/h6-7,12,15,17H,3-5,8-11H2,1-2H3/t15-,17+,18+/m1/s1 | InChI = 1/C17H27NO4/c1-17(2,3)18-9-12(19)10-22-16-6-4-5-11-7-14(20)15(21)8-13(11)16/h4-6,12,14-15,18-21H,7-10H2,1-3H3/t12?,14-,15+/m1/s1
| InChIKey = MKXZASYAUGDDCJ-NJAFHUGGBD | InChIKey = VWPOSFSPZNDTMJ-UCWKZMIHBD
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H25NO/c1-19-10-9-18-8-4-3-5-15(18)17(19)11-13-6-7-14(20-2)12-16(13)18/h6-7,12,15,17H,3-5,8-11H2,1-2H3/t15-,17+,18+/m1/s1 | StdInChI = 1S/C17H27NO4/c1-17(2,3)18-9-12(19)10-22-16-6-4-5-11-7-14(20)15(21)8-13(11)16/h4-6,12,14-15,18-21H,7-10H2,1-3H3/t12?,14-,15+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = MKXZASYAUGDDCJ-NJAFHUGGSA-N | StdInChIKey = VWPOSFSPZNDTMJ-UCWKZMIHSA-N
| melting_point = 111
}} }}

Revision as of 15:19, 10 January 2012

This page contains a copy of the infobox ({{drugbox}}) taken from revid 470612306 of page Nadolol with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
Trade namesCorgard
AHFS/Drugs.comMonograph
MedlinePlusa682666
Routes of
administration		Oral
ATC code
Legal status
Legal status
Pharmacokinetic data
Protein binding30%
MetabolismNil
Elimination half-life14-24 hours
ExcretionRenal and fecal (unchanged)
Identifiers
IUPAC name
  • (2R,3S)-5-{oxy}-1,2,3,4-tetrahydronaphthalene-2,3-diol
CAS Number
PubChem CID
IUPHAR/BPS
DrugBank
ChemSpider
UNII
KEGG
ChEMBL
Chemical and physical data
FormulaC17H27NO4
Molar mass309.401 g/mol g·mol
3D model (JSmol)
SMILES
  • OC(CNC(C)(C)C)COc1cccc2c1C(O)(O)C2
InChI
  • InChI=1S/C17H27NO4/c1-17(2,3)18-9-12(19)10-22-16-6-4-5-11-7-14(20)15(21)8-13(11)16/h4-6,12,14-15,18-21H,7-10H2,1-3H3/t12?,14-,15+/m1/s1
  • Key:VWPOSFSPZNDTMJ-UCWKZMIHSA-N
  (what is this?)  (verify)