Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 12:15, 15 February 2012 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 476638225 of page Hydrogen_fluoride for the Chem/Drugbox validation project (updated: '').← Previous edit		Revision as of 12:15, 15 February 2012 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 476578369 of page Lithium_carbonate for the Chem/Drugbox validation project (updated: 'ChEMBL').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{chembox		{{chembox
			\| Verifiedfields = changed
	\| verifiedrevid = ~~451480940~~		\| verifiedrevid = 462092421
	\| Name = Hydrogen fluoride
			\| Name = Lithium carbonate
	\| ImageFileL1 = Hydrogen-fluoride-2D-dimensions.png
			\| ImageFile = Lithium carbonate.jpg
	\| ImageSizeL1 = 120
			\| ImageSize = 225px
	\| ImageFileR1 = Hydrogen-fluoride-3D-vdW.png
			\| ImageName = Lithium carbonate
	\| ImageSizeR1 = 120
			\| IUPACName = Lithium carbonate
			\| OtherNames = Dilithium carbonate, Carbolith, Cibalith-S, Duralith, Eskalith, Lithane, Lithizine, Lithobid, Lithonate, Lithotabs Priadel, ]
	\| Section1 = {{Chembox Identifiers		\| Section1 = {{Chembox Identifiers
		⚫	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
		⚫	\| ChemSpiderID = 10654
	\| UNII_Ref = {{fdacite\|correct\|FDA}}		\| UNII_Ref = {{fdacite\|correct\|FDA}}
	\| UNII = ~~RGL5YE86CZ~~		\| UNII = 2BMD2GNA4V
	\| ~~KEGG_Ref~~ = {{~~keggcite~~\|~~correct~~\|~~kegg~~}}		\| ChEMBL_Ref = {{ebicite\|changed\|EBI}}
			\| ChEMBL = <!-- blanked - oldvalue: 1200826 -->
	\| KEGG = C16487
	\| InChI = 1/FH/~~h1H~~		\| InChI = 1/CH2O3.2Li/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2
			\| InChIKey = XGZVUEUWXADBQD-NUQVWONBAY
	\| ChEBI_Ref = {{ebicite\|correct\|EBI}}		\| ChEBI_Ref = {{ebicite\|correct\|EBI}}
	\| ChEBI = ~~29228~~		\| ChEBI = 6504
	\| SMILES = F		\| SMILES = ..C()=O
	\| InChIKey = KRHYYFGTRYWZRS-UHFFFAOYAC
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChI = 1S/FH/~~h1H~~		\| StdInChI = 1S/CH2O3.2Li/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = ~~KRHYYFGTRYWZRS~~-UHFFFAOYSA-N		\| StdInChIKey = XGZVUEUWXADBQD-UHFFFAOYSA-L
	\| CASNo = ~~7664~~-39-3		\| CASNo = 554-13-2
	\| CASNo_Ref = {{cascite\|correct\|CAS}}		\| CASNo_Ref = {{cascite\|correct\|CAS}}
		⚫	\| PubChem = 11125
⚫	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
			\| RTECS = OJ5800000
⚫	\| ChemSpiderID = ~~14214~~
			\| KEGG_Ref = {{keggcite\|correct\|kegg}}
⚫	\| PubChem = ~~16211014~~
	\| ~~RTECS~~ = ~~MW7875000~~		\| KEGG = D00801
	\| EINECS =
	}}		}}
	\| Section2 = {{Chembox Properties		\| Section2 = {{Chembox Properties
			\| Formula = Li<sub>2</sub>CO<sub>3</sub>
	\| H = 1
			\| MolarMass = 73.891 g/mol
	\| F = 1
	\| Appearance = ~~colorless~~ ~~gas~~		\| Appearance = Odorless white powder
	\| Density = 1.15 g/~~L, gas (25 °C)~~<br />~~0.99 g/mL, liquid (19.5~~ ~~°C)~~		\| Density = 2.11 g/cm<sup>3</sup>
	\| ~~Solubility~~ = ~~miscible~~		\| MeltingPtC = 723
	\| ~~MeltingPtC~~ = ~~-83.6~~		\| BoilingPtC = 1310
	\| ~~BoilingPtC~~ = 19.5		\| Boiling_notes = decomp.
			\| Solubility = 15.4 g/L (0 °C) <br /> 13.2 g/L (20 °C) <br /> 7.2 g/L (100 °C)
	\| RefractIndex = 1.00001
			\| SolubleOther = insoluble in ] and ]
	\| pKa = 3.2
			\| RefractIndex = 1.428 <ref>Pradyot Patnaik. ''Handbook of Inorganic Chemicals''. McGraw-Hill, 2002, ISBN 0070494398</ref>
	}}
	\| Section3 = {{Chembox Structure
	\| MolShape = ]
	\| Dipole = 1.86 ]
	\| Coordination =
	\| CrystalStruct =
	}}		}}
	\| Section4 = {{Chembox Thermochemistry		\| Section4 = {{Chembox Thermochemistry
	\| DeltaHf = ~~−13~~.66 kJ/g ~~(gas) <br /> −14.99 kJ/g (liquid)~~		\| DeltaHf = −16.46 kJ/g
	\| DeltaHc =		\| DeltaHc =
	\| Entropy = ~~8.687 J/g K (gas)~~		\| Entropy =
	\| HeatCapacity =		\| HeatCapacity = 1.341 J/(g·K)
	}}		}}
	\| Section7 = {{Chembox Hazards		\| Section7 = {{Chembox Hazards
			\| ExternalMSDS =
	\| ExternalMSDS =
	\| ~~EUClass~~ =		\| EUIndex = Not listed
	\| ~~EUIndex~~ =		\| MainHazards = irritant
	\| NFPA-H = 4
	\| NFPA-F = 0
	\| NFPA-R = 1
	\| NFPA-O =
⚫	\| FlashPt =
	\| RPhrases =		\| RPhrases =
	\| SPhrases =		\| SPhrases =
		⚫	\| FlashPt = Non-flammable
			\| LD50 = 525 mg/kg
	}}		}}
	\| Section8 = {{Chembox Related		\| Section8 = {{Chembox Related
	\| ~~OtherAnions~~ = ]<br />]<br />]		\| OtherCations = ]<br/>]<br/>]<br/>]
	\| OtherCations = ]
	\| OtherCpds = ]
	}}		}}
	}}		}}

Revision as of 12:15, 15 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 476578369 of page Lithium_carbonate with values updated to verified values.

Lithium carbonate
Names

IUPAC name Lithium carbonate
Other names Dilithium carbonate, Carbolith, Cibalith-S, Duralith, Eskalith, Lithane, Lithizine, Lithobid, Lithonate, Lithotabs Priadel, Zabuyelite
Identifiers
CAS Number	554-13-2
3D model (JSmol)	Interactive image
ChEBI	CHEBI:6504
ChemSpider	10654
KEGG	D00801
PubChem CID	11125
RTECS number	OJ5800000
UNII	2BMD2GNA4V
InChI InChI=1S/CH2O3.2Li/c2-1(3)4;;/h(H2,2,3,4);;/q;2+1/p-2Key: XGZVUEUWXADBQD-UHFFFAOYSA-L InChI=1/CH2O3.2Li/c2-1(3)4;;/h(H2,2,3,4);;/q;2+1/p-2Key: XGZVUEUWXADBQD-NUQVWONBAY
SMILES ..C()=O
Properties
Chemical formula	Li₂CO₃
Molar mass	73.891 g/mol
Appearance	Odorless white powder
Density	2.11 g/cm
Melting point	723 °C (1,333 °F; 996 K)
Boiling point	1,310 °C (2,390 °F; 1,580 K)
Solubility in water	15.4 g/L (0 °C) 13.2 g/L (20 °C) 7.2 g/L (100 °C)
Solubility	insoluble in acetone and ethanol
Refractive index (n_D)	1.428
Thermochemistry
Heat capacity (C)	1.341 J/(g·K)
Std enthalpy of formation (Δ_fH₂₉₈)	−16.46 kJ/g
Hazards
Occupational safety and health (OHS/OSH):
Main hazards	irritant
Flash point	Non-flammable
Lethal dose or concentration (LD, LC):
LD₅₀ (median dose)	525 mg/kg
Related compounds
Other cations	Sodium carbonate Potassium carbonate Rubidium carbonate Caesium carbonate
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). N verify (what is ?) Infobox references

Tracking categories (test):

SizeSet

Chemical compound

Pradyot Patnaik. Handbook of Inorganic Chemicals. McGraw-Hill, 2002, ISBN 0070494398