Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 12:57, 15 February 2012 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,071 edits Saving copy of the {{chembox}} taken from revid 472787562 of page Sedoheptulose_7-phosphate for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit		Revision as of 12:57, 15 February 2012 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,071 edits Saving copy of the {{chembox}} taken from revid 474344817 of page Tabun_(nerve_agent) for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{chembox		{{chembox
	\| Verifiedfields = changed		\| Verifiedfields = changed
	\| verifiedrevid = ~~464388344~~		\| verifiedrevid = 417192414
			\| Name = Tabun
	\| ImageFile = Sedoheptulose 7-phosphate.svg
			\| ImageFile1 = GA-3D-balls-by-AHRLS-2011.png
	\| ImageSize =
			\| ImageSize1=200px
	\| IUPACName =
			\| ImageFile2 = Tabun-2D-skeletal-by-AHRLS.png
	\| OtherNames =
			\| ImageSize2=200px
			\| IUPACName = Ethyl ''N'',''N''-Dimethylphosphoramidocyanidate
			\| OtherNames = GA; Ethyl dimethylphosphoramidocyanidate; Dimethylaminoethoxy-cyanophosphine oxide; Dimethylamidoethoxyphosphoryl cyanide; Ethyl dimethylaminocyanophosphonate; Ethyl ester of dimethylphosphoroamidocyanidic acid; Ethyl phosphorodimethylamidocyanidate; Cyanodimethylaminoethoxyphosphine oxide; Dimethylaminoethodycyanophosphine oxide; EA1205
	\| Section1 = {{Chembox Identifiers		\| Section1 = {{Chembox Identifiers
			\| Abbreviations =
	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}		\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
	\| ChemSpiderID = ~~144663~~		\| ChemSpiderID = 6254
	\| InChI = 1/C7H15O10P/c8-1-3(9)5(11)7(13)6(12)4(10)2-17-18(14,15)16/h4-8,10-13H,1-2H2,(H2,14,15,16)/t4-,5-,6-,7+/m1/s1
		⚫	\| ChEMBL_Ref = {{ebicite\|changed\|EBI}}
	\| InChIKey = JDTUMPKOJBQPKX-GBNDHIKLBF
			\| ChEMBL = 446997
			\| InChI = 1/C5H11N2O2P/c1-4-9-10(8,5-6)7(2)3/h4H2,1-3H3
			\| InChIKey = PJVJTCIRVMBVIA-UHFFFAOYAG
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChI = 1S/~~C7H15O10P~~/c8-1-3(9)5~~(11~~)7(~~13)6(12)4(10)~~2~~-17-18(14,15~~)16/~~h4-8,10-13H~~,1-~~2H2,(H2,14,15,16)/t4-,5-,6-,7+/m1/s1~~		\| StdInChI = 1S/C5H11N2O2P/c1-4-9-10(8,5-6)7(2)3/h4H2,1-3H3
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = ~~JDTUMPKOJBQPKX~~-~~GBNDHIKLSA~~-N		\| StdInChIKey = PJVJTCIRVMBVIA-UHFFFAOYSA-N
	\| CASNo_Ref = {{cascite\|~~changed~~\|??}}		\| CASNo_Ref = {{cascite\|correct\|??}}
	\| CASNo = <!-- blanked - oldvalue: ~~2646~~-35-7 -->		\| CASNo = <!-- blanked - oldvalue: 77-81-6 -->
	\| ~~PubChem~~ = ~~165007~~		\| EINECS =
			\| PubChem =
⚫	\| ~~ChEBI_Ref~~ = {{ebicite\|~~correct~~\|EBI}}
			\| SMILES = N#CP(=O)(OCC)N(C)C
⚫	\| ChEBI = ~~15721~~
			\| InChI =
	\| SMILES = O=P(O)(OC(O)(O)(O)(O)C(=O)CO)O
			\| RTECS =
	\| MeSHName = sedoheptulose+7-phosphate
			\| MeSHName =
	}}
			\| ChEBI_Ref = {{ebicite\|correct\|EBI}}
		⚫	\| ChEBI =
			\| KEGG_Ref = {{keggcite\|correct\|kegg}}
			\| KEGG =
			\| ATCCode_prefix =
			\| ATCCode_suffix =
			\| ATC_Supplemental =}}
	\| Section2 = {{Chembox Properties		\| Section2 = {{Chembox Properties
			\| C=5 \| H =11 \| N=2 \| O=2 \| P=1
	\| Formula = C<sub>7</sub>H<sub>15</sub>O<sub>10</sub>P
			\| Appearance = Colorless to brown liquid
	\| MolarMass = 290.162 g/mol
			\| Density = 1.0887 g/cm³ at 25 °C<br />1.102 g/cm³ at 20 °C
	\| Appearance =
	\| ~~Density~~ =		\| MeltingPtC = -50
	\| ~~MeltingPt~~ =		\| BoilingPtC = 247.5
			\| Solubility = 9.8 g/100 g at 25 °C <br /> 7.2 g/100 g at 20 °C
	\| BoilingPt =
			\| SolubleOther =
	}}
			\| Solvent =
⚫	\| ~~Section3~~ = {{Chembox Hazards
	\| ~~Solubility~~ =		\| LogP =
			\| VaporPressure = 0.07 mmHg (9 Pa)
	\| MainHazards =
	\| ~~FlashPt~~ =		\| HenryConstant =
			\| AtmosphericOHRateConstant =
⚫	\| Autoignition =
			\| pKa =
	}}
			\| pKb = }}
			\| Section5 = {{Chembox Pharmacology
			\| AdminRoutes =
			\| Bioavail =
			\| Metabolism =
			\| HalfLife =
			\| ProteinBound =
			\| Excretion =
			\| Legal_status =
			\| Legal_US =
			\| Legal_UK =
			\| Legal_AU =
			\| Legal_CA =
			\| PregCat =
			\| PregCat_AU =
			\| PregCat_US = }}
		⚫	\| Section7 = {{Chembox Hazards
			\| ExternalMSDS =
			\| EUClass =
			\| EUIndex =
			\| MainHazards = Highly Toxic. Fires involving this chemical may result in the formation of ]
			\| NFPA-H = 4
			\| NFPA-F = 2
			\| NFPA-R = 1
			\| NFPA-O =
			\| RPhrases =
			\| SPhrases =
			\| RSPhrases =
			\| FlashPt = 78 °C
		⚫	\| Autoignition =
			\| ExploLimits =
			\| LD50 =
			\| PEL = }}
			\| Section8 = {{Chembox Related
			\| OtherAnions =
			\| OtherCations =
			\| OtherFunctn =
			\| Function =
			\| OtherCpds = }}
	}}		}}

Revision as of 12:57, 15 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 474344817 of page Tabun_(nerve_agent) with values updated to verified values.

Tabun
Names


IUPAC name Ethyl N,N-Dimethylphosphoramidocyanidate
Other names GA; Ethyl dimethylphosphoramidocyanidate; Dimethylaminoethoxy-cyanophosphine oxide; Dimethylamidoethoxyphosphoryl cyanide; Ethyl dimethylaminocyanophosphonate; Ethyl ester of dimethylphosphoroamidocyanidic acid; Ethyl phosphorodimethylamidocyanidate; Cyanodimethylaminoethoxyphosphine oxide; Dimethylaminoethodycyanophosphine oxide; EA1205
Identifiers
3D model (JSmol)	Interactive image
ChEMBL	ChEMBL446997
ChemSpider	6254
InChI InChI=1S/C5H11N2O2P/c1-4-9-10(8,5-6)7(2)3/h4H2,1-3H3Key: PJVJTCIRVMBVIA-UHFFFAOYSA-N Key: PJVJTCIRVMBVIA-UHFFFAOYAG
SMILES N#CP(=O)(OCC)N(C)C
Properties
Chemical formula	C₅H₁₁N₂O₂P
Molar mass	162.129 g·mol
Appearance	Colorless to brown liquid
Density	1.0887 g/cm³ at 25 °C 1.102 g/cm³ at 20 °C
Melting point	−50 °C (−58 °F; 223 K)
Boiling point	247.5 °C (477.5 °F; 520.6 K)
Solubility in water	9.8 g/100 g at 25 °C 7.2 g/100 g at 20 °C
Vapor pressure	0.07 mmHg (9 Pa)
Hazards
Occupational safety and health (OHS/OSH):
Main hazards	Highly Toxic. Fires involving this chemical may result in the formation of hydrogen cyanide
NFPA 704 (fire diamond)	4 2 1
Flash point	78 °C
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). N verify (what is ?) Infobox references

Tracking categories (test):

SizeSet

Chemical compound