Revision as of 13:30, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 473652045 of page Pentaerythritol_tetranitrate for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 13:30, 15 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 474182361 of page Pyrophosphoric_acid for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 464197954 |
|
| verifiedrevid = 470454597 |
|
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageFile = PETN.svg |
|
|
|
| ImageFile = Pyrophosphoric-acid-2D.png |
|
| ImageSize = 190px |
|
|
|
| ImageName = Chemical structure of pyrophosphoric acid |
|
| ImageAlt = Skeletal formula |
|
|
| ImageFile1 = PETN-from-xtal-2006-3D-balls-B.png |
|
| ImageFile1 = Pyrophosphoric-acid-3D-vdW.png |
|
|
| ImageName1 = 3D model of pyrophosphoric acid |
|
| ImageSize1 = 210px |
|
|
|
| IUPACName = Diphosphoric acid<br />μ-oxido-bis(dihydroxidooxidophosphorus) |
|
| ImageAlt1 = Ball-and-stick model |
|
|
|
| OtherNames = Diphosphoric acid |
|
|IUPACName= nitrate |
|
|
⚫ |
| Section1 = {{Chembox Identifiers |
|
|OtherNames= |
|
|
⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
⚫ |
|Section1={{Chembox Identifiers |
|
|
| CASNo= 78-11-5 |
|
| ChEBI = 29888 |
|
|
| SMILES = O=P(O)(O)OP(=O)(O)O |
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| PubChem=6518 |
|
| PubChem = 1023 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| ATCCode_prefix = C01 |
|
|
|
| UNII = 4E862E7GRQ |
|
| ATCCode_suffix = DA05 |
|
|
|
| InChI = 1/H4O7P2/c1-8(2,3)7-9(4,5)6/h(H2,1,2,3)(H2,4,5,6) |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| InChIKey = XPPKVPWEQAFLFU-UHFFFAOYAX |
⚫ |
| ChemSpiderID = 6271 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 466659 |
|
| ChEMBL = 1160571 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C5H8N4O12/c10-6(11)18-1-5(2-19-7(12)13,3-20-8(14)15)4-21-9(16)17/h1-4H2 |
|
| StdInChI = 1S/H4O7P2/c1-8(2,3)7-9(4,5)6/h(H2,1,2,3)(H2,4,5,6) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = TZRXHJWUDPFEEY-UHFFFAOYSA-N |
|
| StdInChIKey = XPPKVPWEQAFLFU-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| SMILES = C(C(CO(=O))(CO(=O))CO(=O))O(=O) |
|
|
|
| CASNo = 2466-09-3 |
|
| InChI = InChI=1S/C5H8N4O12/c10-6(11)18-1-5(2-19-7(12)13,3-20-8(14)15)4-21-9(16)17/h1-4H2 |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
⚫ |
}} |
|
|
⚫ |
| ChemSpiderID = 996 |
⚫ |
|Section2={{Chembox Properties |
|
|
⚫ |
}} |
|
| C = 5 | H = 8 | N = 4 | O = 12 |
|
|
⚫ |
| Section2 = {{Chembox Properties |
|
| Appearance=White crystalline solid<ref name=army1>{{Cite journal |
|
|
|
| Formula = H<sub>4</sub>P<sub>2</sub>O<sub>7</sub> |
|
|url=http://chppm-www.apgea.army.mil/erawg/tox/files/WTA%28PETN%29_FINAL.pdf |
|
|
|
| MolarMass = 177.98 g/mol |
|
|title=Wildlife Toxicity Assessment for pentaerythritol tetranitrate |
|
|
|
| Density = |
|
|date=November 2001 |
|
|
|
| MeltingPt = 71.5 °C |
|
|publisher=U.S. Army Center for Health Promotion and Preventive Medicine |
|
|
|
| BoilingPt = |
|
|postscript=<!-- Bot inserted parameter. Either remove it; or change its value to "." for the cite to end in a ".", as necessary. -->{{inconsistent citations}} |
|
|
|
| Solubility = Extremely soluble |
|
}}</ref> |
|
|
|
| SolubleOther = Very soluble in ], ] |
|
| Density=1.77 g/cm<sup>3</sup> at 20 °C |
|
|
⚫ |
}} |
|
| MeltingPtC=141.3 |
|
|
| BoilingPtC=180 |
|
|
| Boiling_notes=decomposes above 150 °C |
|
|
| Solubility= |
|
⚫ |
}} |
|
|
| Section3 = {{Chembox Explosive |
|
|
| ShockSens = Medium |
|
|
| FrictionSens = Medium |
|
|
| ExplosiveV = 8400 m/s (density 1.7 g/cm<small>3</small>) |
|
|
| REFactor = 1.66}} |
|
|
|Section4={{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition=190 °C |
|
|
}} |
|
|
| Section5 = {{Chembox Pharmacology |
|
|
| AdminRoutes = |
|
|
| Bioavail = |
|
|
| Metabolism = |
|
|
| HalfLife = |
|
|
| ProteinBound = |
|
|
| Excretion = |
|
|
| Legal_status = |
|
|
| Legal_US = |
|
|
| Legal_UK = |
|
|
| Legal_AU = |
|
|
| Legal_CA = |
|
|
| PregCat = |
|
|
| PregCat_AU = |
|
|
| PregCat_US = }} |
|
|
}} |
|
}} |