Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 13:35, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 474663576 of page Acridine_orange for the Chem/Drugbox validation project (updated: 'ChEBI', 'KEGG', 'CASNo').← Previous edit Revision as of 13:35, 15 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 472296269 of page Aluminium_borohydride for the Chem/Drugbox validation project (updated: 'CASNo').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{chembox
⚫ | verifiedrevid = 427611348
| Verifiedfields = changed
| ImageFile = Aluminium-borohydride-2D-from-xtal.png
⚫ | verifiedrevid = 457803101
| ImageSize =
| ImageFile = Acridine Orange.png
| ImageName = Acridine orange | ImageName = Structural formula of the aluminium borohydride molecule
| IUPACName = Aluminium borohydride
| PIN = ''N'',''N'',''N<nowiki>'</nowiki>'',''N<nowiki>'</nowiki>''-Tetramethylacridine-3,6-diamine
| OtherNames = Aluminum borohydride, aluminium tetrahydroborate, aluminum tetrahydroborate
| SystematicName = 3-''N'',3-''N'',6-''N'',6-''N''-Tetramethylacridine-3,6-diamine
| Reference = <ref name="hand">
| OtherNames = 3,6-Acridinediamine<br />
{{Cite book
Acridine Orange Base<br />
| last = Lide
Acridine Orange NO<br />
| first = David R.
Basic Orange 14<br />
| author-link =
Euchrysine<br />
| last2 =
Rhoduline Orange<br />
| first2 =
Rhoduline Orange N<br />
| author2-link =
Rhoduline Orange NO<br />
| publication-date =
Solvent Orange 15<br />
| date =
Waxoline Orange A
| year = 1998
| title = Handbook of Chemistry and Physics
| edition = 87
| volume =
| series =
| publication-place = Boca Raton, FL
| place =
| publisher = CRC Press
| id =
| isbn = 0-8493-0594-2
| doi =
| oclc =
| pages = 4–39
| url =
| accessdate =
}}</ref>
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChEMBL = 81880 | ChemSpiderID = 55734
| InChI = 1/Al.3BH4/h;3*1H4/q+3;3*-1
| InChIKey = LNJYEMMRSAGORU-UHFFFAOYAC
| SMILES = ...
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C17H19N3/c1-19(2)14-7-5-12-9-13-6-8-15(20(3)4)11-17(13)18-16(12)10-14/h5-11H,1-4H3 | StdInChI = 1S/Al.3BH4/h;3*1H4/q+3;3*-1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = DPKHZNPWBDQZCN-UHFFFAOYSA-N | StdInChIKey = LNJYEMMRSAGORU-UHFFFAOYSA-N
⚫ | CASNo = <!-- blanked - oldvalue: 16962-07-5 -->
| CASNo_Ref = {{cascite|changed|??}} | CASNo_Ref = {{cascite|correct|??}}=
⚫ | CASNo = <!-- blanked - oldvalue: 494-38-2 -->
| PubChem = 62344 | RTECS =
⚫ | EINECS =
| PubChem_Ref = {{Pubchemcite}}
| ChemSpiderID = 56136 | PubChem =
⚫ }}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | EINECS = 200-614-0
| MeSHName = Acridine+orange
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = <!-- blanked - oldvalue: 234241 -->
| RTECS = AR7601000
| SMILES = n1c3c(cc2c1cc(N(C)C)cc2)ccc(c3)N(C)C
| InChI = 1/C17H19N3/c1-19(2)14-7-5-12-9-13-6-8-15(20(3)4)11-17(13)18-16(12)10-14/h5-11H,1-4H3
| InChIKey = DPKHZNPWBDQZCN-UHFFFAOYAJ
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = <!-- blanked - oldvalue: C19315 -->
⚫ }}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
|C=17|H=19|N=3| | Al = 1 | B = 3 | H = 12
| Appearance = Orange powder | Appearance = colorless liquid
| Density =
⚫ }}
| MeltingPtC = -64.5
⚫ | Section7 = {{Chembox Hazards
| BoilingPtC = 44.5
| EUClass = {{Hazchem_Xi}} {{Hazchem_N}}
| NFPA-H = 2 | Solubility = reacts
⚫ }}
⚫ | NFPA-F = 0
| Section3 = {{Chembox Structure
| NFPA-R = 0
| CrystalStruct =
| SPhrases = {{S26}} {{S28}} {{S37}} {{S45}}
| Coordination =
⚫ }}
| MolShape =
⚫ }}
⚫ | Section4 = {{Chembox Hazards
⚫ | EUClass =
| FlashPt = Spontaneously ignites
| NFPA-H = |NFPA-F = |NFPA-R =
}}
}} }}

Revision as of 13:35, 15 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 472296269 of page Aluminium_borohydride with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Structural formula of the aluminium borohydride molecule
Names
IUPAC name Aluminium borohydride
Other names Aluminum borohydride, aluminium tetrahydroborate, aluminum tetrahydroborate
Identifiers
3D model (JSmol)
ChemSpider
InChI
  • InChI=1S/Al.3BH4/h;3*1H4/q+3;3*-1Key: LNJYEMMRSAGORU-UHFFFAOYSA-N
  • InChI=1/Al.3BH4/h;3*1H4/q+3;3*-1Key: LNJYEMMRSAGORU-UHFFFAOYAC
SMILES
  • ...
Properties
Chemical formula AlB3H12
Molar mass 71.51 g·mol
Appearance colorless liquid
Melting point −64.5 °C (−84.1 °F; 208.7 K)
Boiling point 44.5 °C (112.1 °F; 317.6 K)
Solubility in water reacts
Hazards
Flash point Spontaneously ignites
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkY verify (what is  ?) Infobox references
Chemical compound
  1. Lide, David R. (1998). Handbook of Chemistry and Physics (87 ed.). Boca Raton, FL: CRC Press. pp. 4–39. ISBN 0-8493-0594-2.