Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 10:43, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 477141077 of page Sulfur_dioxide for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit Revision as of 10:43, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 477138251 of page Amoxicillin/clavulanic_acid for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
| verifiedrevid = 476993456 | verifiedrevid = 476999187

| ImageFile = Sulfur-dioxide-2D.svg
<!--Combo data-->
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageSize = 160 | type = combo
| component1 = Amoxicillin
| ImageName = Skeletal formula sulfur dioxide with assorted dimensions
| class1 = ]
| ImageFile1 = Sulfur-dioxide-3D-vdW.png
| component2 = Clavulanic acid
| ImageFile1_Ref = {{chemboximage|correct|??}}
| class2 = ]
| ImageSize1 = 140

| ImageName1 = Spacefill model of sulfur dioxide
<!--Clinical data-->
| IUPACName = Sulfur dioxide
| tradename =
| OtherNames = Sulfurous anhydride<br />
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
Sulfur(IV) oxide
| pregnancy_US = B
| Section1 = {{Chembox Identifiers
| pregnancy_category =
| CASNo = 7446-09-5
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| CASNo_Ref = {{cascite|correct|CAS}}
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| PubChem = 1119
| legal_UK = POM
| PubChem_Ref = {{Pubchemcite|correct|pubchem}}
| legal_US = Rx-only
| ChemSpiderID = 1087
| routes_of_administration = oral, ]
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| UNII = 0UZA3422Q4
<!--Identifiers-->
| UNII_Ref = {{fdacite|correct|FDA}}
| CAS_number_Ref = {{cascite|changed|??}}
| EINECS = 231-195-2
| CAS_number = <!-- blanked - oldvalue: 74469-00-4 -->
| UNNumber = 1079, 2037
| KEGG = D05961 | ATC_prefix = J01
| ATC_suffix = CR02
| KEGG_Ref = {{keggcite|correct|kegg}}
| PubChem = 6435923
| MeSHName = Sulfur+dioxide
| ChEBI_Ref = {{ebicite|correct|EBI}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChEBI = 18422 | ChemSpiderID = 4940608
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = <!-- blanked - oldvalue: 1235997 -->
| ChEMBL = <!-- blanked - oldvalue: 1697738 -->
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| smiles = .O=C(O)2N3C(=O)(NC(=O)(c1ccc(O)cc1)N)3SC2(C)C.C(=O)2C(/O1N2C(=O)C1)=C/CO
| RTECS = WS4550000
| InChI = 1/C16H19N3O5S.C8H9NO5.K/c1-16(2)11(15(23)24)19-13(22)10(14(19)25-16)18-12(21)9(17)7-3-5-8(20)6-4-7;10-2-1-4-7(8(12)13)9-5(11)3-6(9)14-4;/h3-6,9-11,14,20H,17H2,1-2H3,(H,18,21)(H,23,24);1,6-7,10H,2-3H2,(H,12,13);/q;;+1/p-1/b;4-1-;/t9-,10-,11+,14-;6-,7-;/m11./s1
| Beilstein = 3535237
| InChIKey = DWHGNUUWCJZQHO-UVRWOVEHBC
| Gmelin = 1443
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| SMILES = O=S=O
| StdInChI = 1S/C16H19N3O5S.C8H9NO5.K/c1-16(2)11(15(23)24)19-13(22)10(14(19)25-16)18-12(21)9(17)7-3-5-8(20)6-4-7;10-2-1-4-7(8(12)13)9-5(11)3-6(9)14-4;/h3-6,9-11,14,20H,17H2,1-2H3,(H,18,21)(H,23,24);1,6-7,10H,2-3H2,(H,12,13);/q;;+1/p-1/b;4-1-;/t9-,10-,11+,14-;6-,7-;/m11./s1
| StdInChI = 1S/O2S/c1-3-2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = DWHGNUUWCJZQHO-ZVDZYBSKSA-M
| InChI = 1/O2S/c1-3-2
| StdInChIKey = RAHZWNYVWXNFOC-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| InChIKey = RAHZWNYVWXNFOC-UHFFFAOYAT
}}
| Section2 = {{Chembox Properties
| Formula = {{Chem|SO|2}}
| MolarMass = 64.066 g mol<sup>−1</sup>
| ExactMass = 63.961899934 g mol<sup>−1</sup>
| Appearance = Colorless gas
| Density = 2.6288 kg m<sup>−3</sup>
| Solubility = 94 g dm<sup>−3</sup><ref>{{RubberBible87th}}</ref>
| MeltingPtK = 201
| BoilingPtC = −10
| VaporPressure = 237.2 kPa
| pKa = 1.81
| pKb = 12.19
| Viscosity = 0.403 cP (at 0 °C)
}}
| Section3 = {{Chembox Structure
| SpaceGroup = ''C''<sub>2''v''</sub>
| Coordination = Digonal
| MolShape = Dihedral
| Dipole = 1.62 D
}}
| Section4 = {{Chembox Thermochemistry
| DeltaHf = -296.81 kJ mol<sup>−1</sup>
| Entropy = 248.223 J K<sup>−1</sup> mol<sup>−1</sup>
}}
| Section5 = {{Chembox Hazards
| EUIndex = 016-011-00-9
| EUClass = {{Hazchem T}}
| RPhrases = {{R23}}, {{R34}}, {{R50}}
| SPhrases = {{S1/2}}, {{S9}}, {{S26}}, {{S36/37/39}}, {{S45}}
| NFPA-H = 3
| NFPA-F = 0
| NFPA-R = 0
| LD50 = 3000 ppm (30 min inhaled, mouse)
}}
| Section8 = {{Chembox Related
| Function = ] ]s
| OtherFunctn = ]<br/>]
| OtherCpds = ]<br />
]<br />
]<br />
]
}}
}} }}

Revision as of 10:43, 16 February 2012

This page contains a copy of the infobox ({{drugbox}}) taken from revid 477138251 of page Amoxicillin/clavulanic_acid with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Combination of
AmoxicillinPenicillin antibiotic
Clavulanic acidBeta-lactamase inhibitor
Clinical data
Routes of
administration
oral, iv
ATC code
Legal status
Legal status
Identifiers
PubChem CID
ChemSpider
Chemical and physical data
3D model (JSmol)
SMILES
  • .O=C(O)2N3C(=O)(NC(=O)(c1ccc(O)cc1)N)3SC2(C)C.C(=O)2C(/O1N2C(=O)C1)=C/CO
InChI
  • InChI=1S/C16H19N3O5S.C8H9NO5.K/c1-16(2)11(15(23)24)19-13(22)10(14(19)25-16)18-12(21)9(17)7-3-5-8(20)6-4-7;10-2-1-4-7(8(12)13)9-5(11)3-6(9)14-4;/h3-6,9-11,14,20H,17H2,1-2H3,(H,18,21)(H,23,24);1,6-7,10H,2-3H2,(H,12,13);/q;;+1/p-1/b;4-1-;/t9-,10-,11+,14-;6-,7-;/m11./s1
  • Key:DWHGNUUWCJZQHO-ZVDZYBSKSA-M
  (what is this?)  (verify)