Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 16:04, 16 February 2012 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 462880959 of page 1,2,3-Tribromopropane for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit		Revision as of 16:04, 16 February 2012 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 476141684 of page 1,2,3-Trichloropropane for the Chem/Drugbox validation project (updated: 'CASNo').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{Chembox		{{Chembox
			\| Verifiedfields = changed
	\| verifiedrevid = 399178650
			\| verifiedrevid = 456494356
	\| ImageFile = S-Tribromopropane.svg
			\| Name = 1,2,3-Trichloropropane
	\| ImageSize =
	\| ~~IUPACName~~ = 1,2,3-~~Tribromopropane~~		\| ImageFile1 = 1,2,3-trichloropropane.svg
			\| ImageSize1 = 200px
	\| OtherNames = 1,2,3-Tribromo-propan ; Glyceryl tribromohydrin ; Propane, 1,2,3-tribromo- ; S-Tribromopropane ; sym-Tribromopropane<ref name="lookchem"/>
			\| ImageFile2 = 1,2,3-Trichloropropane-3D-balls.png
			\| ImageSize2 = 200px
			\| ImageAlt =
			\| ImageCaption = Trichloropropane
			\| IUPACName = 1,2,3-Trichloropropane
			\| SystematicName = Trichloropropane
			\| OtherNames = TCP; Allyl trichloride; Glycerol trichlorohydrin; Trichlorohydrin
	\| Section1 = {{Chembox Identifiers		\| Section1 = {{Chembox Identifiers
			\| Abbreviations = TCP
	\| InChIKey = FHCLGDLYRUPKAM-UHFFFAOYAE
			\| CASNo = <!-- blanked - oldvalue: 96-18-4 -->
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
			\| CASNo_Comment =
	\| StdInChI = 1S/C3H5Br3/c4-1-3(6)2-5/h3H,1-2H2
			\| CASNo_Ref = {{cascite\|changed\|??}}
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
			\| CASNos =
	\| StdInChIKey = FHCLGDLYRUPKAM-UHFFFAOYSA-N
			\| CASOther =
	\| CASNo = <!-- blanked - oldvalue: 96-11-7 -->
			\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}
			\| ChEMBL = 346933
			\| PubChem =
			\| PubChem_Comment =
			\| PubChem5 =
			\| PubChem5_Comment =
			\| PubChemOther =
	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}		\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
	\| ChemSpiderID = ~~7007~~		\| ChemSpiderID = 7013
			\| ChemSpiderID_Comment =
	\| ChEBI = 18859
	\| ~~EINECS~~ = ~~202-478-8~~		\| ChemSpiderID5 =
			\| ChemSpiderIDOther =
	\| InChI = 1/C3H5Br3/c4-1-3(6)2-5/h3H,1-2H2
	\| ~~PubChem~~ = ~~7279~~		\| EINECS = 202-486-1
			\| EC-number =
	\| SMILES = BrC(CBr)CBr
			\| EINECSCASNO =
	}}
			\| UNNumber =
			\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}
			\| DrugBank =
			\| KEGG_Ref = {{keggcite\|correct\|kegg}}
			\| KEGG =
			\| MeSHName =
			\| ChEBI_Ref = {{ebicite\|correct\|EBI}}
			\| ChEBI =
			\| RTECS =
			\| ATCvet =
			\| ATCCode_prefix =
			\| ATCCode_suffix =
			\| ATC_Supplemental =
			\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
			\| StdInChI = 1S/C3H5Cl3/c4-1-3(6)2-5/h3H,1-2H2
			\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
			\| StdInChIKey = CFXQEHVMCRXUSD-UHFFFAOYSA-N
			\| SMILES =
			\| InChI =
			\| Beilstein =
			\| Gmelin =
			\| KEGG_Ref = {{keggcite\|correct\|kegg}}
			\| KEGG = C14400
			\| 3DMet =}}
	\| Section2 = {{Chembox Properties		\| Section2 = {{Chembox Properties
	\| Formula = C~~<sub>~~3~~</sub>~~H~~<sub>~~5~~</sub>Br<sub>~~3~~</sub>~~		\| Formula = {{chem\|C\|3\|H\|5\|Cl\|3}}
	\| MolarMass = ~~280~~.~~785~~ g~~/mol~~		\| MolarMass = 147.43 g
			\| Appearance = colorless or straw yellow transparent liquid
	\| Density = 2.398 g/cm<sup>3</sup><ref name="chemsynthesis">. Chemsynthesis.com. Retrieved on 2011-11-28.</ref>
			\| Density = 1.38g mol<sup>-1</sup>
	\| MeltingPt = 16–17 °C<ref name="chemsynthesis"/>
			\| MeltingPtC = -14
	\| BoilingPt = 220 °C<ref name="chemsynthesis"/>}}
			\| Melting_notes =
			\| BoilingPtC = 156.85
			\| Boiling_notes =
			\| LogP = 2.27
			\| VaporPressure = 3.1
			\| HenryConstant = 4.087 x 10<sup>-4</sup>
			\| AtmosphericOHRateConstant =
			\| pKa =
			\| pKb =
			\| Sheet Resistance =
			\| Methacrylate Equiv Wt =
			\| Bulk Conductivity = }}
			\| Section3 = {{Chembox Structure
			\| CrystalStruct =
			\| Coordination =
			\| MolShape = }}
			\| Section4 = {{Chembox Thermochemistry
			\| Solubility = 1,750 mg/L
			\| SolubleOther =
			\| Solvent = =
			\| DeltaHc =
			\| DeltaHf
			\| Entropy =
			\| HeatCapacity = }}
	\| Section7 = {{Chembox Hazards		\| Section7 = {{Chembox Hazards
	\| ExternalMSDS =		\| ExternalMSDS =
	\| EUClass =		\| EUClass =
	\| EUIndex =		\| EUIndex =
	\| MainHazards =		\| MainHazards =
	\| NFPA-H =		\| NFPA-H =
	\| NFPA-F =		\| NFPA-F =
	\| NFPA-R =		\| NFPA-R =
	\| NFPA-O =		\| NFPA-O =
	\| RPhrases =		\| RPhrases =
	\| SPhrases =		\| SPhrases =
	\| RSPhrases =		\| RSPhrases =
			\| FlashPt =
	\| FlashPt = 93 °C<ref name="chemblink">. Chemblink.com. Retrieved on 2011-11-28.</ref>
	\| Autoignition =		\| Autoignition =
	\| ExploLimits =		\| ExploLimits =
	\| LD50 =		\| LD50 =
	\| PEL = }}		\| PEL = }}
			\| Section8 = {{Chembox Related
			\| OtherAnions =
			\| OtherCations =
			\| OtherFunctn =
			\| Function =
			\| OtherCpds = }}
	}}		}}

Revision as of 16:04, 16 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 476141684 of page 1,2,3-Trichloropropane with values updated to verified values.

1,2,3-Trichloropropane
Names


IUPAC name 1,2,3-Trichloropropane
Systematic IUPAC name Trichloropropane
Other names TCP; Allyl trichloride; Glycerol trichlorohydrin; Trichlorohydrin
Identifiers
Abbreviations	TCP
ChEMBL	ChEMBL346933
ChemSpider	7013
EC Number	202-486-1
KEGG	C14400
InChI InChI=1S/C3H5Cl3/c4-1-3(6)2-5/h3H,1-2H2Key: CFXQEHVMCRXUSD-UHFFFAOYSA-N
Properties
Chemical formula	C ₃H ₅Cl ₃
Molar mass	147.43 g
Appearance	colorless or straw yellow transparent liquid
Density	1.38g mol
Melting point	−14 °C (7 °F; 259 K)
Boiling point	156.85 °C (314.33 °F; 430.00 K)
log P	2.27
Vapor pressure	3.1
Henry's law constant (k_H)	4.087 x 10
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). N verify (what is ?) Infobox references

Tracking categories (test):

SizeSet

Chemical compound