Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 16:20, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456418086 of page 1,3-Benzodioxole for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit Revision as of 16:20, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 475471115 of page 1,3-Bis(diphenylphosphino)propane for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{chembox
| Verifiedfields = changed
| verifiedrevid = 442344841 | verifiedrevid = 456367575
| ImageFileL1 = 1,3-Benzodioxole.png
|ImageFile=Dppp.png
| ImageFileL1_Ref = {{chemboximage|correct|??}}
|ImageSize=200px
| ImageSizeL1 = 121
|ImageFile1=Dppp-from-xtal-2005-3D-balls.png
| ImageNameL1 = Kekulé, skeletal formula of 1,3-benzodioxole
|IUPACName=Propane-1,3-diylbis(diphenylphosphane)
| ImageFileR1 = 1,3-Benzodioxole-3D-balls.png
|OtherNames=
| ImageFileR1_Ref = {{chemboximage|correct|??}}
|Section1={{Chembox Identifiers
| ImageSizeR1 = 121
| Abbreviations = DPPP
| ImageNameR1 = Ball and stick model of 1,3-benzodioxole
| Section1 = {{Chembox Identifiers
| CASNo = <!-- blanked - oldvalue: 274-09-9 -->
| PubChem = 9229
| PubChem_Ref = {{Pubchemcite|correct|pubchem}}
| ChemSpiderID = 13881169
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 73276
| EINECS = 205-992-0
| InChI = 1/C27H26P2/c1-5-14-24(15-6-1)28(25-16-7-2-8-17-25)22-13-23-29(26-18-9-3-10-19-26)27-20-11-4-12-21-27/h1-12,14-21H,13,22-23H2
| UNNumber = 1993
| InChIKey = LVEYOSJUKRVCCF-UHFFFAOYAP
| MeSHName = 1,3-Benzodioxole
| SMILES1 = c1ccc(cc1)P(CCCP(c2ccccc2)c3ccccc3)c4ccccc4
| ChEBI_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEBI = 38732
| RTECS = DA5600000 | ChEMBL = 73394
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| Beilstein = 115506
| StdInChI = 1S/C27H26P2/c1-5-14-24(15-6-1)28(25-16-7-2-8-17-25)22-13-23-29(26-18-9-3-10-19-26)27-20-11-4-12-21-27/h1-12,14-21H,13,22-23H2
| SMILES = C1Oc2ccccc2O1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| SMILES1 = C1OC2=C(O1)C=CC=C2
| StdInChIKey = LVEYOSJUKRVCCF-UHFFFAOYSA-N
| StdInChI = 1S/C7H6O2/c1-2-4-7-6(3-1)8-5-9-7/h1-4H,5H2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=6737-42-4
| InChI = 1/C7H6O2/c1-2-4-7-6(3-1)8-5-9-7/h1-4H,5H2
| PubChem=81219
| StdInChIKey = FTNJQNQLEGKTGD-UHFFFAOYSA-N
| SMILES = P(c1ccccc1)(c2ccccc2)CCCP(c3ccccc3)c4ccccc4
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| InChIKey = FTNJQNQLEGKTGD-UHFFFAOYAV
}}
| Section2 = {{Chembox Properties
| C = 7
| H = 6
| O = 2
| ExactMass = 122.036779436 g mol<sup>-1</sup>
| Density = 1.064 g cm<sup>-3</sup>
| BoilingPtK = 446
| LogP = 2.08
| VaporPressure = 1.6 kPa
}}
| Section3 = {{Chembox Thermochemistry
| DeltaHc = -3.428 MJ mol<sup>-1</sup>
}}
| Section4 = {{Chembox Hazards
| GHSPictograms = {{GHS exclamation mark}}
| GHSSignalWord = '''WARNING'''
| HPhrases = {{H-phrases|302|332}}
| EUClass = {{Hazchem Xn}}
| RPhrases = {{R20/22}}
| SPhrases = {{S22}}, {{S24/25}}
| NFPA-F = 2
| NFPA-H = 1
| NFPA-R = 0
| FlashPt = 61 °C
}} }}
|Section2={{Chembox Properties
| C = 27 | H = 26 | P = 2
| Appearance= white solid
| Density=
| MeltingPt=
| BoilingPt=
| Solubility= chlorocarbons
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| Autoignition=
}}
}} }}

Revision as of 16:20, 16 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 475471115 of page 1,3-Bis(diphenylphosphino)propane with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names
IUPAC name Propane-1,3-diylbis(diphenylphosphane)
Identifiers
CAS Number
3D model (JSmol)
Abbreviations DPPP
ChEMBL
ChemSpider
PubChem CID
InChI
  • InChI=1S/C27H26P2/c1-5-14-24(15-6-1)28(25-16-7-2-8-17-25)22-13-23-29(26-18-9-3-10-19-26)27-20-11-4-12-21-27/h1-12,14-21H,13,22-23H2Key: LVEYOSJUKRVCCF-UHFFFAOYSA-N
  • InChI=1/C27H26P2/c1-5-14-24(15-6-1)28(25-16-7-2-8-17-25)22-13-23-29(26-18-9-3-10-19-26)27-20-11-4-12-21-27/h1-12,14-21H,13,22-23H2Key: LVEYOSJUKRVCCF-UHFFFAOYAP
SMILES
  • P(c1ccccc1)(c2ccccc2)CCCP(c3ccccc3)c4ccccc4
  • c1ccc(cc1)P(CCCP(c2ccccc2)c3ccccc3)c4ccccc4
Properties
Chemical formula C27H26P2
Molar mass 412.453 g·mol
Appearance white solid
Solubility in water chlorocarbons
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound