Revision as of 16:24, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 475599869 of page 1,3-Indandione for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 16:25, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 457127254 of page 1,3-Propanedithiol for the Chem/Drugbox validation project (updated: 'ChEMBL').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 456364458 |
|
| verifiedrevid = 456364861 |
|
| ImageFile = 1,3-indanon.svg |
|
| Name = 1,3-Propanedithiol |
|
|
| ImageFile = H2pdt.png |
|
| ImageSize = 130px |
|
| ImageSize = 100px |
|
| ImageAlt = Skeletal formula |
|
|
|
| ImageName = 1,3-Propanedithiol |
|
| ImageFile1 = Indandione-3D-balls.png |
|
|
⚫ |
| IUPACName = Propane-1,3-dithiol |
|
| ImageSize1 = 160 |
|
|
|
| OtherNames = 1,3-dimercaptopropane |
|
| ImageAlt1 = Ball-and-stick model |
|
|
⚫ |
| Section1 = {{Chembox Identifiers |
⚫ |
|IUPACName=indane-1,3-dione |
|
|
|
| SMILES = SCCCS |
|
|OtherNames=Indandione; 1,3-Diketohydrindene; 1,3-Dioxoindane; 1,3-Hydrindendione |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
⚫ |
|Section1={{Chembox Identifiers |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChemSpiderID = 11322 |
|
| ChEBI = 44864 |
|
|
| ChemSpiderID = 13848090 |
|
| InChI = 1/C9H6O2/c10-8-5-9(11)7-4-2-1-3-6(7)8/h1-4H,5H2 |
|
|
| SMILES1 = O=C2c1ccccc1C(=O)C2 |
|
|
| InChIKey = UHKAJLSKXBADFT-UHFFFAOYAR |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = 283521 |
|
| ChEMBL = <!-- blanked - oldvalue: 1235209 --> |
|
|
| InChI = 1/C3H8S2/c4-2-1-3-5/h4-5H,1-3H2 |
|
|
| InChIKey = ZJLMKPKYJBQJNH-UHFFFAOYAS |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C9H6O2/c10-8-5-9(11)7-4-2-1-3-6(7)8/h1-4H,5H2 |
|
| StdInChI = 1S/C3H8S2/c4-2-1-3-5/h4-5H,1-3H2 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = UHKAJLSKXBADFT-UHFFFAOYSA-N |
|
| StdInChIKey = ZJLMKPKYJBQJNH-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=606-23-5 |
|
| CASNo = 109-80-8 |
|
|
| RTECS = TZ2585500 |
|
| PubChem=11815 |
|
|
| SMILES=C1C(=O)C2=CC=CC=C2C1=O |
|
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| C=9|H=6|O=2 |
|
| C=3|H=8|S=2 |
|
| Appearance=Yellow solid |
|
| Appearance = Colorless liquid |
|
| Density=1.37 g / cm<sup>3</sup> |
|
| Density = 1.078 g/cm³ |
|
⚫ |
| Solubility = slight |
|
| MeltingPtCL=129 |
|
|
|
| Solvent = solvents |
|
| MeltingPtCH=132 |
|
|
|
| SolubleOther = all organic solvents |
|
| Melting_notes = <ref name="Sigma"> at ]</ref><ref name="Acros"> at ''Acros Organics'', retrieved on June 16 2011</ref> |
|
|
|
| MeltingPtC = -79 |
|
| BoilingPt= |
|
|
|
| BoilingPtC = 169 |
⚫ |
| Solubility=slight |
|
|
|
| pKb = |
|
|
| RefractIndex = 1.539 |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
| Section3 = {{Chembox Structure |
|
|
| Dipole = 0 ] |
⚫ |
| MainHazards= |
|
|
|
}} |
⚫ |
| FlashPt= |
|
|
|
| Section7 = {{Chembox Hazards |
|
| Autoignition= |
|
|
⚫ |
| MainHazards = stench |
|
⚫ |
| FlashPt = 138 °F |
|
|
| RPhrases = {{R36/37/38}} |
|
|
| SPhrases = {{S26}} |
|
|
}} |
|
|
| Section8 = {{Chembox Related |
|
|
| OtherCpds = ]<br />]<br />] |
|
}} |
|
}} |
|
}} |
|
}} |