| Revision as of 16:25, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 443937220 of page 1,4,2-Dithiazole for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 16:25, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447932328 of page 1,4,6-Androstatrien-3,17-dione for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 443935604 |
|
| verifiedrevid = 413468625 |
|
|ImageFile=1,4,2-Dithiazole.svg |
|
|
|
| IUPAC_name = (8''R'',9''S'',10''R'',13''S'',14''S'')-10,13-dimethyl-9,11,12,14,15,16-hexahydro-8''H''-cyclopentaphenanthrene-3,17-dione |
|
|ImageSize=100px |
|
|
|
| image = 1,4,6-androstatrien-3,17-dione.png |
|
|IUPACName=1,4,2-Dithiazole |
|
|
|
|
|
|OtherNames= |
|
|
|
<!--Clinical data--> |
|
|Section1={{Chembox Identifiers |
|
|
|
| tradename = |
|
| CASNo= |
|
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| ⚫ |
| PubChem=21943157 |
|
|
|
| pregnancy_US = X <!-- A / B / C / D / X --> |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| pregnancy_category = |
| ⚫ |
| ChemSpiderID = 11438410 |
|
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
| legal_US = Supplement<!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
|
|
| routes_of_administration = Parenteral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| protein_bound = |
|
|
| metabolism = Hepatic |
|
|
| elimination_half-life = Minutes |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number = <!-- blanked - oldvalue: 633-35-2 --> |
|
|
| ATC_prefix = |
|
|
| ATC_suffix = |
|
⚫ |
| PubChem = 104880 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 94659 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=19 | H=22 | O=2 |
|
|
| molecular_weight = 282 |
|
|
| smiles = O=C\4\C=C/3(C(/C=C\21(C(=O)CC1)(CC23)C)=C/4)C |
|
|
| InChI = 1/C19H22O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h3-4,7,9,11,14-16H,5-6,8,10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1 |
|
|
| InChIKey = DKVSUQWCZQBWCP-QAGGRKNEBB |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C2H3NS2/c1-3-5-2-4-1/h1H,2H2 |
|
| StdInChI = 1S/C19H22O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h3-4,7,9,11,14-16H,5-6,8,10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = MNNJLAZJQBWSST-UHFFFAOYSA-N |
|
| StdInChIKey = DKVSUQWCZQBWCP-QAGGRKNESA-N |
|
| SMILES=C1SC=NS1 |
|
|
}} |
|
|
|Section2={{Chembox Properties |
|
| ⚫ |
| C=2|H=3|N=1|S=2 |
|
|
| Appearance= |
|
|
| Density= |
|
|
| MeltingPt= |
|
|
| BoilingPt= |
|
|
| Solubility= |
|
|
}} |
|
|
|Section3={{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
|
}} |
|
}} |
