Revision as of 16:25, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447932328 of page 1,4,6-Androstatrien-3,17-dione for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 16:26, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 443255630 of page 1,4,7-Triazacyclononane for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
⚫ |
| verifiedrevid = 443254341 |
|
{{Drugbox |
|
|
|
| Name = 1,4,7-Triazacyclononane |
|
| Watchedfields = changed |
|
|
|
| ImageFile = 1,4,7-triazacyclononane.png |
⚫ |
| verifiedrevid = 413468625 |
|
|
|
| ImageSize = 200px |
|
| IUPAC_name = (8''R'',9''S'',10''R'',13''S'',14''S'')-10,13-dimethyl-9,11,12,14,15,16-hexahydro-8''H''-cyclopentaphenanthrene-3,17-dione |
|
|
|
| ImageName = 1,4,7-Triazacyclononane |
|
| image = 1,4,6-androstatrien-3,17-dione.png |
|
|
|
| IUPACName = 1,4,7-Triazacyclononane |
|
|
|
|
|
| Section1 = {{Chembox Identifiers |
|
<!--Clinical data--> |
|
|
|
| ACXNumber = X1073996-5 |
|
| tradename = |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| pregnancy_US = X <!-- A / B / C / D / X --> |
|
|
|
| ChEBI = 37405 |
|
| pregnancy_category = |
|
|
⚫ |
| ChemSpiderID = 163681 |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
|
| InChI = 1/C6H15N3/c1-2-8-5-6-9-4-3-7-1/h7-9H,1-6H2 |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
|
| InChIKey = ITWBWJFEJCHKSN-UHFFFAOYAS |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
|
| SMILES = C1CNCCNCCN1 |
|
| legal_US = Supplement<!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
|
|
| routes_of_administration = Parenteral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| protein_bound = |
|
|
| metabolism = Hepatic |
|
|
| elimination_half-life = Minutes |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 633-35-2 --> |
|
|
| ATC_prefix = |
|
|
| ATC_suffix = |
|
|
| PubChem = 104880 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 94659 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=19 | H=22 | O=2 |
|
|
| molecular_weight = 282 |
|
|
| smiles = O=C\4\C=C/3(C(/C=C\21(C(=O)CC1)(CC23)C)=C/4)C |
|
|
| InChI = 1/C19H22O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h3-4,7,9,11,14-16H,5-6,8,10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1 |
|
|
| InChIKey = DKVSUQWCZQBWCP-QAGGRKNEBB |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C19H22O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h3-4,7,9,11,14-16H,5-6,8,10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1 |
|
| StdInChI = 1S/C6H15N3/c1-2-8-5-6-9-4-3-7-1/h7-9H,1-6H2 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = DKVSUQWCZQBWCP-QAGGRKNESA-N |
|
| StdInChIKey = ITWBWJFEJCHKSN-UHFFFAOYSA-N |
|
⚫ |
| CASNo = <!-- blanked - oldvalue: 4730-54-5 --> |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>6</sub>H<sub>15</sub>N<sub>3</sub> |
|
|
| MolarMass = 129.2046 g/mol |
|
|
}} |
|
}} |
|
}} |