Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 17:21, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Saving copy of the {{chembox}} taken from revid 443315357 of page 2-Iodobenzoic_acid for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 17:21, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Saving copy of the {{chembox}} taken from revid 475462921 of page 2-Iodoxybenzoic_acid for the Chem/Drugbox validation project (updated: 'CASNo').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| verifiedrevid = 443314464 | verifiedrevid = 443314523
| Name = 2-Iodobenzoic acid | ImageFile = IBXAcid.png
| Reference = | ImageSize =
| ImageFile = 2-Iodobenzoic acid.svg | ImageFileL1 = 2-iodoxybenzoic-acid-from-xtal-1997-3D-balls.png
| ImageFileR1 = 2-iodoxybenzoic-acid-from-xtal-1997-3D-sf.png
| ImageSize = 120px
| IUPACName = 2-Iodobenzoic acid | IUPACName =
| OtherNames = ''o''-Iodobenzoic acid | OtherNames = 1-hydroxy-1λ<small><sup>5</sup></small>,2-benziodoxol-1,3-dione<br />
1-hydroxy-1λ<small><sup>3</sup></small>,2-benziodoxol-3(1''H'')-one 1-oxide
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| InChI = 1/C7H5IO4/c9-7-5-3-1-2-4-6(5)8(10,11)12-7/h1-4H,(H,10,11)
| CASNo = 88-67-5
| InChIKey = CQMJEZQEVXQEJB-UHFFFAOYAL
⚫ | CASNo_Ref = {{cascite|correct|CAS}}
| SMILES1 = c1ccc2c(c1)C(=O)OI2(=O)O
⚫ | PubChem = 6941
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChemSpiderID = 6675 | ChEMBL = 118857
⚫ | ChEBI_Ref = {{ebicite|correct|EBI}}
⚫ | ChEBI = 287979
⚫ | SMILES = O=C(O)c1ccccc1I
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 112424
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI=1S/C7H5IO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H,9,10) | StdInChI = 1S/C7H5IO4/c9-7-5-3-1-2-4-6(5)8(10,11)12-7/h1-4H,(H,10,11)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey=CJNZAXGUTKBIHP-UHFFFAOYSA-N | StdInChIKey = CQMJEZQEVXQEJB-UHFFFAOYSA-N
⚫ | CASNo_Ref = {{cascite|correct|??}}
| CASNo = <!-- blanked - oldvalue: 61717-82-6 -->
⚫ | PubChem = 339496
⚫ | ChEBI_Ref = {{ebicite|correct|EBI}}
⚫ | ChEBI = 52701
⚫ | SMILES = O=C1OI(=O)(O)c2ccccc12
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 300947
}} }}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| Formula = C<sub>7</sub>H<sub>5</sub>IO<sub>2</sub> | Formula = C<sub>7</sub>H<sub>5</sub>IO<sub>4</sub>
| MolarMass = 248.018 | MolarMass = 280.02 g/mol
| Appearance = | Appearance =
| Density = | Density =
| MeltingPtC = 162 | MeltingPt =
| BoilingPt = | BoilingPt =
| Solubility = | Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| Autoignition =
}} }}
| Section7 = {{Chembox Hazards | Section7 = {{Chembox Hazards
| NFPA-H = | MainHazards =
| NFPA-F = | FlashPt =
| NFPA-R = | Autoignition =
| RPhrases = {{R22}} {{R34}} {{R44}}
| ExternalMSDS =
}} }}
}} }}

Revision as of 17:21, 16 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 475462921 of page 2-Iodoxybenzoic_acid with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names
Other names 1-hydroxy-1λ,2-benziodoxol-1,3-dione
1-hydroxy-1λ,2-benziodoxol-3(1H)-one 1-oxide
Identifiers
3D model (JSmol)
ChEBI
ChEMBL
ChemSpider
PubChem CID
InChI
  • InChI=1S/C7H5IO4/c9-7-5-3-1-2-4-6(5)8(10,11)12-7/h1-4H,(H,10,11)Key: CQMJEZQEVXQEJB-UHFFFAOYSA-N
  • InChI=1/C7H5IO4/c9-7-5-3-1-2-4-6(5)8(10,11)12-7/h1-4H,(H,10,11)Key: CQMJEZQEVXQEJB-UHFFFAOYAL
SMILES
  • O=C1OI(=O)(O)c2ccccc12
  • c1ccc2c(c1)C(=O)OI2(=O)O
Properties
Chemical formula C7H5IO4
Molar mass 280.02 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkY verify (what is  ?) Infobox references
Chemical compound
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic