Revision as of 17:27, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 423027290 of page 2-Methylindole for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 17:27, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 439701227 of page 2-Methylisoborneol for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 413114072 |
|
| verifiedrevid = 399299083 |
|
⚫ |
|ImageFile=Methylisoborneol.png |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
|
⚫ |
|ImageSize=150px |
⚫ |
| ImageFile = 2-methylindole.png |
|
|
|
|IUPACName=1,6,7,7-Tetramethylbicycloheptan-6-ol |
⚫ |
| ImageSize = |
|
|
|
|OtherNames=2-Methyl-2-bornanol |
|
| IUPACName = |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
| OtherNames = |
|
|
|
| Abbreviations = MIB |
⚫ |
| Section1 = {{Chembox Identifiers |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| InChI = 1/C9H9N/c1-7-6-8-4-2-3-5-9(8)10-7/h2-6,10H,1H3 |
|
|
⚫ |
| ChemSpiderID = 16024 |
|
| InChIKey = BHNHHSOHWZKFOX-UHFFFAOYAQ |
|
|
|
| InChI = 1/C11H20O/c1-9(2)8-5-6-10(9,3)11(4,12)7-8/h8,12H,5-7H2,1-4H3 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
|
| InChIKey = LFYXNXGVLGKVCJ-UHFFFAOYAW |
|
| ChEMBL = 259419 |
|
|
|
| SMILES1 = OC2(C)CC1CCC2(C1(C)C)C |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C9H9N/c1-7-6-8-4-2-3-5-9(8)10-7/h2-6,10H,1H3 |
|
| StdInChI = 1S/C11H20O/c1-9(2)8-5-6-10(9,3)11(4,12)7-8/h8,12H,5-7H2,1-4H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = BHNHHSOHWZKFOX-UHFFFAOYSA-N |
|
| StdInChIKey = LFYXNXGVLGKVCJ-UHFFFAOYSA-N |
|
| CASNo = 95-20-5 |
|
| CASNo = <!-- blanked - oldvalue: 2371-42-8 --> |
|
⚫ |
| PubChem=16913 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
|
| SMILES=CC1(C2CCC1(C(C2)(C)O)C)C |
⚫ |
| PubChem = 7224 |
|
|
| SMILES = c1cccc2c1cc(n2)C |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 6954 |
|
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>9</sub>H<sub>9</sub>N |
|
| Formula=C<sub>11</sub>H<sub>20</sub>O |
|
| MolarMass = 131.17 |
|
| MolarMass=168.28 g/mol |
|
| Appearance = Yellow viscous liquid |
|
| Appearance= |
|
| Density = |
|
| Density= |
|
| MeltingPt = |
|
| MeltingPt= |
|
| BoilingPt = |
|
| BoilingPt= |
|
| Solubility = |
|
| Solubility= |
|
}} |
|
}} |
|
| Section7 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards= |
|
| FlashPt = |
|
| FlashPt= |
|
| Autoignition = |
|
| Autoignition= |
|
}} |
|
}} |
|
}} |
|
}} |