Revision as of 17:52, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 433687219 of page 3-Hydroxyisobutyryl-CoA for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 17:52, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 452198925 of page 3-Hydroxykynurenine for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 401772366 |
|
| verifiedrevid = 443348502 |
|
|ImageFile=3-Hydroxyisobutyryl-CoA.png |
|
|ImageFile=3-hydroxykynurenine.png |
|
|ImageSize=250px |
|
|ImageSize=200px |
|
|
|IUPACName=2-Amino-4-(2-amino-3-hydroxyphenyl)-4-oxobutanoic acid |
|
|IUPACName= <small>''S''-[2-[3-<nowiki>[[</nowiki>4-<nowiki>[[[</nowiki>(2''R'',3''S'',4''R'',5''R'')- |
|
|
5-(6-Aminopurin-9-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] |
|
|
oxy-hydroxyphosphoryl]oxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] 3-hydroxy-2-methylpropanethioate</small> |
|
|
|OtherNames= |
|
|OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| ChemSpiderID = 389192 |
|
| KEGG = C02794 |
|
|
| InChI = 1/C10H12N2O4/c11-6(10(15)16)4-8(14)5-2-1-3-7(13)9(5)12/h1-3,6,13H,4,11-12H2,(H,15,16) |
|
| InChI1 = 1/C25H42N7O18P3S/c1-13(8-33)24(38)54-7-6-27-15(34)4-5-28-22(37)19(36)25(2,3)10-47-53(44,45)50-52(42,43)46-9-14-18(49-51(39,40)41)17(35)23(48-14)32-12-31-16-20(26)29-11-30-21(16)32/h11-14,17-19,23,33,35-36H,4-10H2,1-3H3,(H,27,34)(H,28,37)(H,42,43)(H,44,45)(H2,26,29,30)(H2,39,40,41)/t13?,14-,17-,18-,19?,23-/m1/s1 |
|
|
|
| InChIKey = VCKPUUFAIGNJHC-UHFFFAOYAF |
|
| InChIKey1 = WWEOGFZEFHPUAM-VRQRJWBYBU |
|
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 442576 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C10H12N2O4/c11-6(10(15)16)4-8(14)5-2-1-3-7(13)9(5)12/h1-3,6,13H,4,11-12H2,(H,15,16) |
|
| StdInChI = 1S/C25H42N7O18P3S/c1-13(8-33)24(38)54-7-6-27-15(34)4-5-28-22(37)19(36)25(2,3)10-47-53(44,45)50-52(42,43)46-9-14-18(49-51(39,40)41)17(35)23(48-14)32-12-31-16-20(26)29-11-30-21(16)32/h11-14,17-19,23,33,35-36H,4-10H2,1-3H3,(H,27,34)(H,28,37)(H,42,43)(H,44,45)(H2,26,29,30)(H2,39,40,41)/t13?,14-,17-,18-,19?,23-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = WWEOGFZEFHPUAM-VRQRJWBYSA-N |
|
| StdInChIKey = VCKPUUFAIGNJHC-UHFFFAOYSA-N |
|
|
| CASNo = <!-- blanked - oldvalue: 484-78-6 --> |
|
| CASNo= |
|
|
| PubChem=440205 |
|
| PubChem=89 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| SMILES = O=C(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O)OP(=O)(O)OC3O(n2cnc1c(ncnc12)N)(O)3OP(=O)(O)O)C(C)CO |
|
|
|
| ChEBI = 1547 |
⚫ |
}} |
|
|
|
| SMILES = O=C(O)C(N)CC(=O)c1cccc(O)c1N |
|
|
| MeSHName=3-hydroxykynurenine |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 87 |
|
⚫ |
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>25</sub>H<sub>42</sub>N<sub>7</sub>O<sub>18</sub>P<sub>3</sub>S |
|
| Formula=C<sub>10</sub>H<sub>12</sub>N<sub>2</sub>O<sub>4</sub> |
|
| MolarMass=853.62 g/mol |
|
| MolarMass=224.21 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |