Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 17:54, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 467021484 of page 3-Methoxy-4-ethoxyphenethylamine for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit Revision as of 17:55, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 452837645 of page 3-Methoxy-4-hydroxyhippuric_acid for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| verifiedrevid = 399313506 | verifiedrevid = 449119416
| Name = 3-Methoxy-4-hydroxy-hippuric acid
| ImageFile = MEPEA.png
| ImageFile = 3-methoxy-4-hydroxy-hippuric acid.PNG
| ImageSize = 200px | ImageSize = 200px
| ImageName = Chemical structure of 3-methoxy-4-hydroxy-hippuric acid
| IUPACName = 2-(4-ethoxy-3-methoxyphenyl)ethanamine
| ImageAlt = Chemical structure of 3-methoxy-4-hydroxy-hippuric acid
⚫ | OtherNames =
<!-- | ImageCaption = Chemical structure of -->
⚫ | Section1 = {{Chembox Identifiers
| IUPACName =
⚫ | OtherNames = <!-- <br> -->
⚫ |Section1= {{Chembox Identifiers
| CASNo =
| CASNo_Ref =
| CASOther =
| PubChem =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 125332 | ChemSpiderID = 2340857
| InChI = 1/C11H17NO2/c1-3-14-10-5-4-9(6-7-12)8-11(10)13-2/h4-5,8H,3,6-7,12H2,1-2H3
| InChIKey = AFMUTJRFLRYILG-UHFFFAOYAD
| SMILES1 = O(c1ccc(cc1OC)CCN)CC
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C11H17NO2/c1-3-14-10-5-4-9(6-7-12)8-11(10)13-2/h4-5,8H,3,6-7,12H2,1-2H3 | StdInChI = 1S/C10H11NO5/c1-16-8-4-6(2-3-7(8)12)10(15)11-5-9(13)14/h2-4,12H,5H2,1H3,(H,11,15)(H,13,14)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = AFMUTJRFLRYILG-UHFFFAOYSA-N | StdInChIKey = LOODYTDRRBLQNH-UHFFFAOYSA-N
| SMILES =
| CASNo_Ref = {{cascite|correct|??}}
| InChI =
| CASNo = <!-- blanked - oldvalue: 36377-59-0 -->
| PubChem = 142076 | MeSHName =
}}
| SMILES = COc1cc(ccc1OCC)CCN}}
| Section2 = {{Chembox Properties |Section2= {{Chembox Properties
| Formula = C<sub>11</sub>H<sub>17</sub>NO<sub>2</sub> | Formula = C<sub>10</sub>H<sub>11</sub>NO<sub>5</sub>
| MolarMass = 195.258 g/mol | MolarMass = 225.19 g/mol
| ExactMass = 225.063722 u
| Appearance = | Appearance =
| Density = | Density =
| MeltingPt = | MeltingPt = <!-- °C -->
| BoilingPt = | BoilingPt = <!-- °C -->
| Solubility = }} | Solubility =
}}
| Section3 = {{Chembox Hazards | Section3 = {{Chembox Hazards
| MainHazards = | MainHazards =
| FlashPt = | FlashPt =
| Autoignition = }} | Autoignition =
| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. -->
| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. -->
}}
}} }}

Revision as of 17:55, 16 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 452837645 of page 3-Methoxy-4-hydroxyhippuric_acid with values updated to verified values.
3-Methoxy-4-hydroxy-hippuric acid
Chemical structure of 3-methoxy-4-hydroxy-hippuric acid
Identifiers
ChemSpider
InChI
  • InChI=1S/C10H11NO5/c1-16-8-4-6(2-3-7(8)12)10(15)11-5-9(13)14/h2-4,12H,5H2,1H3,(H,11,15)(H,13,14)Key: LOODYTDRRBLQNH-UHFFFAOYSA-N
Properties
Chemical formula C10H11NO5
Molar mass 225.19 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkY verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound