Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 18:07, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 473765813 of page 4-Aminopyridine for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 18:07, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456503475 of page 4-Aminoquinoline for the Chem/Drugbox validation project (updated: 'CASNo').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{Chembox
| Verifiedfields = changed
| verifiedrevid = 443350606 | verifiedrevid = 456502257
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageFile=4-aminopyridine.svg | ImageFile = 4-aminoquinoline.svg
|ImageSize=80px | ImageSize = 150px
|IUPACName=pyridin-4-amine | IUPACName = quinolin-4-amine
|OtherNames=4-pyridinamine, 4-Pyridylamine, Fampridine | OtherNames =
|Section1= {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| CASNo = <!-- blanked - oldvalue: 578-68-7 -->
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | CASNo_Ref = {{cascite|changed|??}}
⚫ | ChemSpiderID = 1664
| UNII_Ref = {{fdacite|correct|FDA}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| UNII = BH3B64OKL9 | ChEMBL = 58146
⚫ | PubChem = 68476
⚫ | KEGG_Ref = {{keggcite|correct|kegg}}
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| KEGG = D04127
⚫ | ChemSpiderID = 61751
⚫ | InChI = 1/C5H6N2/c6-5-1-3-7-4-2-5/h1-4H,(H2,6,7)
⚫ | UNII_Ref = {{fdacite|correct|FDA}}
| InChIKey = NUKYPUAOHBNCPY-UHFFFAOYAH
| UNII = GTE5P5L97N
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C5H6N2/c6-5-1-3-7-4-2-5/h1-4H,(H2,6,7) | StdInChI = 1S/C9H8N2/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-6H,(H2,10,11)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = NUKYPUAOHBNCPY-UHFFFAOYSA-N | StdInChIKey = FQYRLEXKXQRZDH-UHFFFAOYSA-N
⚫ | SMILES = n1ccc(c2ccccc12)N
⚫ | CASNo_Ref = {{cascite|correct|CAS}}
⚫ | InChI = InChI=1S/C9H8N2/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-6H,(H2,10,11)
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 284348
| CASNo=504-24-5
⚫ | PubChem=1727
| IUPHAR_ligand = 2416
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 34385
⚫ | SMILES = n1ccc(N)cc1
| MeSHName=4-Aminopyridine
| ATCCode_prefix = N07
| ATCCode_suffix = XX07
}} }}
|Section2= {{Chembox Properties | Section2 = {{Chembox Properties
| C=9|H=8|N=2
| Formula=C<sub>5</sub>H<sub>6</sub>N<sub>2</sub>
⚫ | Appearance =
| MolarMass=94.1146
⚫ | Density =
⚫ | Appearance=colourless solid
| Density= | MeltingPt =
| BoilingPt =
| MeltingPt=155-158 °C
| BoilingPtC=273 | Solubility =
| Solubility= polar organic solvents
}} }}
|Section3= {{Chembox Hazards | Section3 = {{Chembox Hazards
| MainHazards= | MainHazards =
| FlashPt= | FlashPt =
| Autoignition= | Autoignition =
}} }}
| Section5 = {{Chembox Pharmacology
| AdminRoutes = Oral
| Bioavail = 96%
| Metabolism =
| HalfLife =
| ProteinBound =
| Excretion =
| Legal_status =
| Legal_US = Rx-only
| Legal_UK =
| Legal_AU =
| Legal_CA =
⚫ | PregCat =
| PregCat_AU =
| PregCat_US = C}}
}} }}

Revision as of 18:07, 16 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 456503475 of page 4-Aminoquinoline with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names
IUPAC name quinolin-4-amine
Identifiers
3D model (JSmol)
ChEMBL
ChemSpider
PubChem CID
UNII
InChI
  • InChI=1S/C9H8N2/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-6H,(H2,10,11)Key: FQYRLEXKXQRZDH-UHFFFAOYSA-N
  • InChI=1S/C9H8N2/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-6H,(H2,10,11)
SMILES
  • n1ccc(c2ccccc12)N
Properties
Chemical formula C9H8N2
Molar mass 144.177 g·mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒N verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound