Revision as of 18:13, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 465586462 of page 4-Fluoromethamphetamine for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 18:13, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456503787 of page 4-Fluoropethidine for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 449582598 |
|
| verifiedrevid = 456502672 |
|
| IUPAC_name = (''RS'')-1-(4-fluorophenyl)-N-methylpropan-2-amine |
|
| IUPAC_name = ethyl 4-(4-fluorophenyl)-1-methylpiperidine-4-carboxylate |
|
| image = 4-FMA.svg |
|
| image = 4-Fluoromeperidine.png |
|
| width = 200 |
|
| width = 240 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category = |
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
| legal_CA = |
|
|
| legal_UK = |
|
|
| legal_US = |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| protein_bound = |
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 351-03-1 --> |
|
| CAS_number = |
|
|
| ATC_prefix = none |
|
| CAS_supplemental = <br /> 52063-62-4 (hydrochloride) |
|
|
| PubChem = 11745017 |
|
| ATC_suffix = |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 112817 |
|
|
| PubChem = 11184669 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 9919721 |
|
| ChemSpiderID = 9359754 |
|
|
| synonyms = 4-Fluoromeperidine, 4-Fluoropethidine |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=10 | H=14 | F=1 | N=1 |
|
| C=15 | H=20 | F=1 | N=1 | O=2 |
|
| molecular_weight = 167.223 |
|
| molecular_weight = 265.322 g/mol |
|
| smiles = Fc1ccc(cc1)CC(NC)C |
|
| smiles = Fc2ccc(cc2)C(C(=O)OCC)(CC1)CCN1C |
|
| InChI = 1/C10H14FN/c1-8(12-2)7-9-3-5-10(11)6-4-9/h3-6,8,12H,7H2,1-2H3 |
|
| InChI = 1/C15H20FNO2/c1-3-19-14(18)15(8-10-17(2)11-9-15)12-4-6-13(16)7-5-12/h4-7H,3,8-11H2,1-2H3 |
|
| InChIKey = YCWZPIHKUYZTFM-UHFFFAOYAV |
|
| InChIKey = CHOQGLPFQOQESN-UHFFFAOYAI |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C10H14FN/c1-8(12-2)7-9-3-5-10(11)6-4-9/h3-6,8,12H,7H2,1-2H3 |
|
| StdInChI = 1S/C15H20FNO2/c1-3-19-14(18)15(8-10-17(2)11-9-15)12-4-6-13(16)7-5-12/h4-7H,3,8-11H2,1-2H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = YCWZPIHKUYZTFM-UHFFFAOYSA-N |
|
| StdInChIKey = CHOQGLPFQOQESN-UHFFFAOYSA-N |
|
}} |
|
}} |