| Revision as of 18:18, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 465068299 of page 4-Methyl-2-pentanol for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 18:18, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 473948324 of page 4-Methylaminorex for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
|
| verifiedrevid = 443354135 |
|
| Watchedfields = changed |
|
|
|
| IUPAC_name = 4-Methyl-5-phenyl-2-amino-oxazoline |
|
| verifiedrevid = 413272674 |
|
|
| Name = 4-Methyl-2-pentanol |
|
| image = 4-Methyl-Aminorex.svg |
|
|
| width = 200px |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
|
| ImageFile = 4-methyl-2-pentanol.PNG |
|
| image2 = 4-Methyl-aminorex.gif |
|
|
| imagename = 1 : 1 mixture (racemate) |
|
| ImageSize = |
|
|
|
| drug_name = 4-Methylaminorex |
|
| ImageName = |
|
|
|
|
|
| IUPACName = 4-Methyl-2-pentanol |
|
|
|
<!--Clinical data--> |
|
| OtherNames = 4-Methylpentan-2-ol, Methyl isobutyl carbinol, MIBC, Isobutyl methyl carbinol, 2-Methyl-4-pentanol, 4-methylpentane-2-ol, 1,3-Dimethylbutanol, Methyl amyl alcohol, Isobutyl methyl methanol |
|
|
|
| tradename = |
|
| Reference = <ref name="hand"> |
|
|
|
| pregnancy_US = D |
|
{{Citation |
|
|
| last = Lide |
|
| legal_AU = S9 |
|
| first = David R. |
|
| legal_CA = Schedule III |
|
| author-link = |
|
| legal_UK = Class A |
|
| last2 = |
|
| legal_US = Schedule I |
|
|
| routes_of_administration = ], ]d, ], ] |
|
| first2 = |
|
|
|
|
|
| author2-link = |
|
|
|
<!--Pharmacokinetic data--> |
|
| publication-date = |
|
|
|
| bioavailability = 62% oral; 79% nasal; 91 - 93.5% smoked; 100% IV |
|
| date = |
|
|
|
| metabolism = ] |
|
| year = 1998 |
|
|
|
| elimination_half-life = 10-19 hours |
|
| title = Handbook of Chemistry and Physics |
|
|
| edition = 87 |
|
| excretion = ] |
|
|
|
|
| volume = |
|
|
|
<!--Identifiers--> |
|
| series = |
|
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| publication-place = Boca Raton, FL |
|
|
|
| CAS_number = <!-- blanked - oldvalue: 3568-94-3 --> |
|
| place = |
|
|
|
| CAS_supplemental = <BR>29493-77-4 - (±)-cis isomers |
|
| publisher = CRC Press |
|
|
| id = |
|
| PubChem = 92196 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| isbn = 0-8493-0594-2 |
|
|
|
| DrugBank = DB01447 |
|
| doi = |
|
|
| oclc = |
|
|
| pages = 3-398, 5-47, 8-106, 15-22, 16-24 |
|
|
| url = |
|
|
| accessdate = |
|
|
}}</ref> |
|
|
| Section1 = {{Chembox Identifiers |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 7622 |
|
| ChemSpiderID = 83237 |
|
|
|
|
| InChI = 1/C6H14O/c1-5(2)4-6(3)7/h5-7H,4H2,1-3H3 |
|
|
|
<!--Chemical data--> |
|
| SMILES = OC(C)CC(C)C |
|
|
|
| C=10 | H=12 | N=2 | O=1 |
|
| InChIKey = WVYWICLMDOOCFB-UHFFFAOYAI |
|
|
|
| molecular_weight = 176.21 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
|
| smiles = N\2=C(\OC(c1ccccc1)C/2C)N |
|
| ChEMBL = 448896 |
|
|
|
| InChI = 1/C10H12N2O/c1-7-9(13-10(11)12-7)8-5-3-2-4-6-8/h2-7,9H,1H3,(H2,11,12) |
|
|
| InChIKey = LJQBMYDFWFGESC-UHFFFAOYAX |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C6H14O/c1-5(2)4-6(3)7/h5-7H,4H2,1-3H3 |
|
| StdInChI = 1S/C10H12N2O/c1-7-9(13-10(11)12-7)8-5-3-2-4-6-8/h2-7,9H,1H3,(H2,11,12) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = WVYWICLMDOOCFB-UHFFFAOYSA-N |
|
| StdInChIKey = LJQBMYDFWFGESC-UHFFFAOYSA-N |
|
| CASNo = 108-11-2 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}}= |
|
|
| RTECS = |
|
|
| EINECS = |
|
|
| PubChem = |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>6</sub>H<sub>14</sub>O |
|
|
| MolarMass = 102.174 g/mol |
|
|
| Appearance = colorless liquid |
|
|
| Density = 0.8075 g/cm<sup>3</sup> at 20 °C |
|
|
| Solubility = 15 g/L |
|
|
| SolubleOther = soluble in ], ] |
|
|
| MeltingPt = −90 °C |
|
|
| BoilingPt = 131.6 °C |
|
|
| Viscosity = 4.07 mPa·s |
|
|
| VaporPressure = 0.698 ] |
|
|
}} |
|
|
| Section3 = {{Chembox Structure |
|
|
| Coordination = |
|
|
| CrystalStruct = |
|
|
}} |
|
|
| Section4 = {{Chembox Thermochemistry |
|
|
| DeltaHf = -394.7 ] (liquid) |
|
|
| DeltaHc = |
|
|
| Entropy = |
|
|
| HeatCapacity = 273.0 J·mol<sup>-1</sup>·K<sup>-1</sup> (liquid) |
|
|
}} |
|
|
| Section7 = {{Chembox Hazards |
|
|
| ExternalMSDS = |
|
|
| EUIndex = |
|
|
| NFPA-H = |
|
|
| NFPA-F = |
|
|
| NFPA-R = |
|
|
| RPhrases = |
|
|
| SPhrases = |
|
|
| FlashPt = 41 °C |
|
|
| Autoignition = 1 — 5.5% |
|
|
| ExploLimits = |
|
|
| LD50 = |
|
|
}} |
|
|
| Section8 = {{Chembox Related |
|
|
| OtherCpds = ] |
|
|
}} |
|
|
}} |
|
}} |
