Revision as of 18:24, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 443669622 of page 5'-Phosphoribosylformylglycinamidine for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 18:24, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 426422969 of page 5,10-Methenyltetrahydrofolate for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 443661600 |
|
| verifiedrevid = 408391878 |
|
|ImageFile=phosphoribosylformylglycinamidine.png |
|
|
|
|ImageFile=5,10-Methenyltetrahydrofolate.svg |
|
|ImageSize=200px |
|
|ImageSize= |
|
|IUPACName= <small>-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate</small> |
|
|
|
|IUPACName= ''N''-pteridin-10-ium-8-yl)benzoyl]-<small>L</small>-glutamic acid |
|
|OtherNames= |
|
|OtherNames= 5,10-CH=THF |
|
|Section1={{Chembox Identifiers |
|
|Section1= {{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 17216355 |
|
| ChemSpiderID = 133 |
|
| InChI = 1/C6H12N3O8P/c7-6(8-1-10)9-4-2(11)3(12)5(16-4)17-18(13,14)15/h1-5,11-12H,(H2,13,14,15)(H3,7,8,9,10)/t2-,3+,4-,5-/m1/s1 |
|
| InChI = 1/C20H21N7O6/c21-20-24-16-15(18(31)25-20)27-9-26(8-12(27)7-22-16)11-3-1-10(2-4-11)17(30)23-13(19(32)33)5-6-14(28)29/h1-4,9,12-13H,5-8H2,(H6-,21,22,23,24,25,28,29,30,31,32,33)/p+1 |
|
|
| InChIKey = MEANFMOQMXYMCT-IKLDFBCSAN |
|
| SMILES1 = O1(O)(NC(=N)NC=O)O1OP(=O)(O)O |
|
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| InChIKey = OKXISSDNJVDCJE-KKQCNMDGBB |
|
|
|
| ChEMBL = 46521 |
⚫ |
| CASNo = <!-- blanked - oldvalue: 6157-85-3 --> |
|
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
⚫ |
| PubChem=5462266 |
|
|
|
| StdInChI = 1S/C20H21N7O6/c21-20-24-16-15(18(31)25-20)27-9-26(8-12(27)7-22-16)11-3-1-10(2-4-11)17(30)23-13(19(32)33)5-6-14(28)29/h1-4,9,12-13H,5-8H2,(H6-,21,22,23,24,25,28,29,30,31,32,33)/p+1 |
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C6H12N3O8P/c7-6(8-1-10)9-4-2(11)3(12)5(16-4)17-18(13,14)15/h1-5,11-12H,(H2,13,14,15)(H3,7,8,9,10)/t2-,3+,4-,5-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = OKXISSDNJVDCJE-KKQCNMDGSA-N |
|
| StdInChIKey = MEANFMOQMXYMCT-UHFFFAOYSA-O |
|
⚫ |
| CASNo = <!-- blanked - oldvalue: 7444-29-3 --> |
|
| SMILES=C(1(((O1)/N=C(/CNC=O)\N)O)O)OP(=O)(O)O |
|
|
⚫ |
| PubChem=644350 |
|
|
| SMILES = O=C(O)C(NC(=O)c1ccc(cc1)N4/C=3/C2=C(/N\C(=N/C2=O)N)NCC3C4)CCC(=O)O |
|
|
| MeSHName=5,10-methenyltetrahydrofolate |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2= {{Chembox Properties |
|
| Formula=C<sub>8</sub>H<sub>16</sub>N<sub>3</sub>O<sub>8</sub>P |
|
| Formula=C<sub>20</sub>H<sub>213</sub>N<sub>7</sub>O<sub>6</sub> |
|
| MolarMass=313.20 g/mol |
|
| MolarMass=455.42 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
Line 29: |
Line 32: |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3= {{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |