Revision as of 18:40, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456563010 of page 7-ACA for the Chem/Drugbox validation project (updated: 'ChEMBL', 'ChEBI', 'KEGG').← Previous edit |
Revision as of 18:40, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 465360826 of page 7-Aminoactinomycin_D for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{chembox |
|
⚫ |
| verifiedrevid = 443358125 |
|
| Verifiedfields = changed |
|
|
|
|Reference=<ref> at ]</ref> |
|
| Watchedfields = changed |
|
|
|
|ImageFile=7-Aminoactinomycin D.png |
⚫ |
| verifiedrevid = 456507014 |
|
|
⚫ |
|ImageSize=200px |
|
| Name = 7-Aminocephalosporanic acid |
|
|
|
|IUPACName= |
|
| ImageFile = 7-aminocephalosporanic acid.svg |
|
|
|
|OtherNames=7-Amino-actinomycin D |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
|
⚫ |
|Section1={{Chembox Identifiers |
⚫ |
| ImageSize = 244 |
|
|
| ImageName = Partially condensed, stereo, skeletal formula of 7-aminocephalosporanic acid ((6R,7R)-7-amino,-oct-2-ene) |
|
|
| IUPACName = 3-(Acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclooct-2-ene-2-carboxylic acid{{Citation needed|date = June 2011}} |
|
|
| OtherNames = 7-Aminocephalosporinic acid |
|
⚫ |
| Section1 = {{Chembox Identifiers |
|
|
| Abbreviations = 7-ACA |
|
|
| CASNo = 957-68-6 |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| PubChem = 483168 |
|
|
| PubChem_Ref = {{Pubchemcite|correct|pubchem}} |
|
⚫ |
| ChemSpiderID = 390087 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 21326185 |
|
| EINECS = 213-485-0 |
|
|
|
| InChI = 1/C62H87N13O16/c1-26(2)42-59(85)74-21-17-19-36(74)57(83)70(13)24-38(76)72(15)48(28(5)6)61(87)89-32(11)44(55(81)66-42)68-53(79)34-23-35(63)30(9)51-46(34)65-47-40(41(64)50(78)31(10)52(47)91-51)54(80)69-45-33(12)90-62(88)49(29(7)8)73(16)39(77)25-71(14)58(84)37-20-18-22-75(37)60(86)43(27(3)4)67-56(45)82/h23,26-29,32-33,36-37,42-45,48-49H,17-22,24-25,63-64H2,1-16H3,(H,66,81)(H,67,82)(H,68,79)(H,69,80)/t32-,33-,36+,37+,42-,43-,44+,45+,48+,49+/m1/s1 |
⚫ |
| KEGG = <!-- blanked - oldvalue: C07756 --> |
|
|
|
| InChIKey = YXHLJMWYDTXDHS-IRFLANFNBD |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| MeSHName = 7-Aminocephalosporanic+acid |
|
|
|
| StdInChI = 1S/C62H87N13O16/c1-26(2)42-59(85)74-21-17-19-36(74)57(83)70(13)24-38(76)72(15)48(28(5)6)61(87)89-32(11)44(55(81)66-42)68-53(79)34-23-35(63)30(9)51-46(34)65-47-40(41(64)50(78)31(10)52(47)91-51)54(80)69-45-33(12)90-62(88)49(29(7)8)73(16)39(77)25-71(14)58(84)37-20-18-22-75(37)60(86)43(27(3)4)67-56(45)82/h23,26-29,32-33,36-37,42-45,48-49H,17-22,24-25,63-64H2,1-16H3,(H,66,81)(H,67,82)(H,68,79)(H,69,80)/t32-,33-,36+,37+,42-,43-,44+,45+,48+,49+/m1/s1 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
⚫ |
| ChEBI = 58501 |
|
|
⚫ |
| StdInChIKey = YXHLJMWYDTXDHS-IRFLANFNSA-N |
|
| ChEMBL = <!-- blanked - oldvalue: 1161449 --> |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo = <!-- blanked - oldvalue: 7240-37-1 --> |
|
| Beilstein = 622637, 8919572 |
|
|
| 3DMet = B02139 |
|
| PubChem=16218991 |
|
⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| SMILES = O=C2N1/C(=C(\CS12N)COC(=O)C)C(=O)O |
|
|
⚫ |
| ChEBI = 52304 |
|
| StdInChI = 1S/C10H12N2O5S/c1-4(13)17-2-5-3-18-9-6(11)8(14)12(9)7(5)10(15)16/h6,9H,2-3,11H2,1H3,(H,15,16)/t6-,9-/m1/s1 |
|
|
|
| SMILES=O=C3C(C)=C2OC1=C(C)C(N)=CC(C(N(C(N(C7=O)(C)C)=O)(C)OC(((C)C)N(C)C(CN(C)(6N7CCC6)=O)=O)=O)=O)=C1N=C2C(C(N(C(N((C)C)C4=O)=O)(C)OC(((C)C)N(C)C(CN(C)(5N4CCC5)=O)=O)=O)=O)=C3N |
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
⚫ |
}} |
⚫ |
| StdInChIKey = HSHGZXNAXBPPDL-HZGVNTEJSA-N |
|
|
⚫ |
|Section2={{Chembox Properties |
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| Formula=C<sub>62</sub>H<sub>87</sub>N<sub>13</sub>O<sub>16</sub> |
⚫ |
}} |
|
|
|
| MolarMass=1270.43 g/mol |
⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| Appearance=Red to dark purple powder |
|
| C=10|H=12|N=2|S=1|O=5 |
|
|
|
| Density= |
|
| ExactMass = 272.046692194 g mol<sup>-1</sup> |
|
|
| MeltingPtC = 300 |
|
| MeltingPt= |
|
|
| BoilingPt= |
|
| Melting_notes = <ref name=chemblink></ref> |
|
|
|
| Solubility= |
|
| LogP = -1.87 |
|
|
⚫ |
}} |
|
| pKa = 2.59 |
|
|
⚫ |
|Section3={{Chembox Hazards |
|
| pKb = 11.41 |
|
|
|
| MainHazards= |
⚫ |
}} |
|
|
|
| FlashPt= |
⚫ |
| Section3 = {{Chembox Hazards |
|
|
|
| Autoignition= |
|
| GHSPictograms = {{GHS health hazard}} |
|
|
|
| RPhrases = {{R26/27/28}} {{R36/37/38}} |
|
| GHSSignalWord = Danger |
|
|
| HPhrases = {{H-phrases|317|334}} |
|
| SPhrases = {{S26}} {{S28}} {{S36/37}} {{S45}} |
|
⚫ |
}} |
|
| PPhrases = {{P-phrases|261|280|342+311}} |
|
|
| EUClass = {{Hazchem Xn}} |
|
|
| RPhrases = {{R42/43}}<ref name=chemblink/> |
|
|
| SPhrases = {{S22}} {{S36/37}}<ref name=chemblink/> |
|
⚫ |
}} |
|
|
}} |
|
}} |