Revision as of 18:49, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 449577427 of page A-372,159 for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 18:51, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 477226241 of page Adenosine_triphosphate for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{chembox |
|
| verifiedrevid = 399345932 |
|
| verifiedrevid = 477002632 |
|
|
| Name = Adenosine triphosphate |
|
| IUPAC_name = (11''S'',16''R'')-3--6-oxa-10,14-diazatetracycloheptadeca-1,3,5(17)-triene |
|
|
|
| ImageFile = Adenosintriphosphat protoniert.svg |
|
| image = A-372,159_structure.png |
|
|
|
| ImageName = Skeletal formula of ATP |
|
| width = 220 |
|
|
|
| ImageFile1 = ATP-xtal-3D-balls.png |
|
|
|
|
|
| ImageName1 = Ball-and-stick model, based on x-ray diffraction data |
|
<!--Clinical data--> |
|
|
|
| ImageFile2 = Atp exp.qutemol-ball.png |
|
| tradename = |
|
|
| legal_status = |
|
| ImageSize2 = 180px |
|
|
| ImageName2 = Space-filling model with hydrogen atoms omitted |
|
| routes_of_administration = |
|
|
|
| IUPACName =<nowiki></nowiki>methyl(hydroxyphosphonooxyphosphoryl)hydrogen phosphate |
|
|
|
|
|
| OtherNames = adenosine 5'-(tetrahydrogen triphosphate) |
|
<!--Pharmacokinetic data--> |
|
|
|
| Section1 = {{Chembox Identifiers |
|
| metabolism = |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| elimination_half-life = |
|
|
| excretion = |
|
| UNII = 8L70Q75FXE |
|
|
| InChI = 1/C10H16N5O13P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 |
|
|
|
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
<!--Identifiers--> |
|
|
| CAS_number = |
|
| DrugBank = DB00171 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
⚫ |
| PubChem = |
|
|
|
| ChEBI = 15422 |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
⚫ |
| ChemSpiderID = 9605283 |
|
|
|
| KEGG = C00002 |
|
|
|
|
|
| SMILES = O=P(O)(O)OP(=O)(O)OP(=O)(O)OC3O(n2cnc1c(ncnc12)N)(O)3O |
|
<!--Chemical data--> |
|
|
|
| InChIKey = ZKHQWZAMYRWXGA-KQYNXXCUBG |
|
| C=24 | H=27 | F=3 | N=2 | O=2 |
|
|
⚫ |
| PubChem = 5957 |
|
| molecular_weight = 432.478 g/mol |
|
|
|
| IUPHAR_ligand = 1713 |
|
| smiles = FC(F)(F)c2cc(OC(C)C)ccc2-c(cc3OCCC4)cc1c3N4C5CCNCC15 |
|
|
|
| SMILES1 = c1nc(c2c(n1)n(cn2)3(((O3)CO(=O)(O)O(=O)(O)OP(=O)(O)O)O)O)N |
|
| InChI = 1/C24H27F3N2O2/c1-14(2)31-16-4-5-17(20(12-16)24(25,26)27)15-10-18-19-13-28-7-6-21(19)29-8-3-9-30-22(11-15)23(18)29/h4-5,10-12,14,19,21,28H,3,6-9,13H2,1-2H3/t19-,21-/m0/s1 |
|
|
| InChIKey = LADKOBQJOCFCQU-FPOVZHCZBZ |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C24H27F3N2O2/c1-14(2)31-16-4-5-17(20(12-16)24(25,26)27)15-10-18-19-13-28-7-6-21(19)29-8-3-9-30-22(11-15)23(18)29/h4-5,10-12,14,19,21,28H,3,6-9,13H2,1-2H3/t19-,21-/m0/s1 |
|
| StdInChI = 1S/C10H16N5O13P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = LADKOBQJOCFCQU-FPOVZHCZSA-N |
|
| StdInChIKey = ZKHQWZAMYRWXGA-KQYNXXCUSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo = 56-65-5 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 14249 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 5742 |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| C=10|H=16|N=5|O=13|P=3 |
|
|
| MolarMass = 507.18 g/mol |
|
|
| MeltingPt = 187 °C (disodium salt) <br> ''decomposes'' |
|
|
| Density = 1.04 g/cm<sup>3</sup> (disodium salt) |
|
|
| pKa = 6.5 |
|
|
}} |
|
}} |
|
}} |