| Revision as of 18:51, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 477226241 of page Adenosine_triphosphate for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 18:56, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 477221059 of page Picric_acid for the Chem/Drugbox validation project (updated: '').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 477002632 |
|
| verifiedrevid = 464206375 |
|
|
| ImageFile1_Ref = {{chemboximage|correct|??}} |
|
| Name = Adenosine triphosphate |
|
|
|
| ImageFile1 = Pikrinsäure.svg |
|
| ImageFile = Adenosintriphosphat protoniert.svg |
|
|
|
| ImageSize1 = 150px |
|
| ImageName = Skeletal formula of ATP |
|
|
| ImageFile1 = ATP-xtal-3D-balls.png |
|
| ImageFileL2 = 246trinitrophenol-3D-ball.png |
|
|
| ImageSizeL2 = 100px |
|
| ImageName1 = Ball-and-stick model, based on x-ray diffraction data |
|
|
| ImageFile2 = Atp exp.qutemol-ball.png |
|
| ImageFileR2 = 246trinitrophenol-3D-vdW.png |
|
| ImageSize2 = 180px |
|
| ImageSizeR2 = 100px |
|
|
| IUPACName = 2,4,6-Trinitrophenol |
|
| ImageName2 = Space-filling model with hydrogen atoms omitted |
|
|
|
| OtherNames = Carbazotic Acid; phenol trinitrate; picronitric acid; trinitrophenol; 2,4,6-trinitro-1-phenol; 2-hydroxy-1,3,5-trinitrobenzene; TNP; Melinite |
|
| IUPACName =<nowiki></nowiki>methyl(hydroxyphosphonooxyphosphoryl)hydrogen phosphate |
|
|
| OtherNames = adenosine 5'-(tetrahydrogen triphosphate) |
|
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
|
| Abbreviations = |
| ⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| UNII = 8L70Q75FXE |
|
|
|
| ChemSpiderID = 6688 |
|
| InChI = 1/C10H16N5O13P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| DrugBank = DB00171 |
|
| UNII = A49OS0F91S |
|
|
| InChI = 1/C6H3N3O7/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-2,10H |
| ⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
|
| InChIKey = OXNIZHLAWKMVMX-UHFFFAOYAM |
| ⚫ |
| ChEBI = 15422 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| KEGG = C00002 |
|
| ChEMBL = 108541 |
|
| SMILES = O=P(O)(O)OP(=O)(O)OP(=O)(O)OC3O(n2cnc1c(ncnc12)N)(O)3O |
|
|
| InChIKey = ZKHQWZAMYRWXGA-KQYNXXCUBG |
|
|
| PubChem = 5957 |
|
|
| IUPHAR_ligand = 1713 |
|
|
| SMILES1 = c1nc(c2c(n1)n(cn2)3(((O3)CO(=O)(O)O(=O)(O)OP(=O)(O)O)O)O)N |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C6H3N3O7/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-2,10H |
|
| StdInChI = 1S/C10H16N5O13P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ZKHQWZAMYRWXGA-KQYNXXCUSA-N |
|
| StdInChIKey = OXNIZHLAWKMVMX-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 56-65-5 |
|
| CASNo = 88-89-1 |
|
|
| EINECS = |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 14249 |
|
| PubChem = 6954 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ChemSpiderID = 5742 |
|
| DrugBank = DB03651 |
|
|
| SMILES = O=()c1cc(cc(()=O)c1O)()=O |
|
}} |
|
|
|
| InChI = |
|
|
| RTECS =TJ7875000 |
|
|
| MeSHName = |
|
⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEBI = 46149 |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = |
|
|
| ATCCode_prefix = |
|
|
| ATCCode_suffix = |
|
|
| ATC_Supplemental =}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>6</sub>H<sub>3</sub>N<sub>3</sub>O<sub>7</sub> |
|
| C=10|H=16|N=5|O=13|P=3 |
|
|
| MolarMass = 507.18 g/mol |
|
| MolarMass = 229.10 g·mol<sup>−1</sup> |
|
|
| Appearance =Colorless to yellow solid |
|
| MeltingPt = 187 °C (disodium salt) <br> ''decomposes'' |
|
|
| Density = 1.04 g/cm<sup>3</sup> (disodium salt) |
|
| Density = 1.763 g·cm<sup>−3</sup>, solid |
|
| pKa = 6.5 |
|
| MeltingPt = 122.5 °C |
|
|
| Melting_notes = |
|
}} |
|
|
|
| BoilingPt = > 300 °C |
|
|
| Boiling_notes = Explodes |
|
|
| Solubility = 14.0 g·L<sup>−1</sup> |
|
|
| SolubleOther = |
|
|
| Solvent = |
|
|
| pKa = 0.38 |
|
|
| pKb = }} |
|
|
| Section7 = {{Chembox Hazards |
|
|
| EUClass = Explosive (E), Toxic (T) |
|
|
| EUIndex = |
|
|
| MainHazards = |
|
|
| NFPA-H = 3 |
|
|
| NFPA-F = 3 |
|
|
| NFPA-R = 4 |
|
|
| NFPA-O = |
|
|
| RPhrases = {{R1}} {{R4}} {{R11}} {{R23}} {{R24}} {{R25}} |
|
|
| SPhrases = {{S28}} {{S35}} {{S37}} {{S45}} |
|
|
| RSPhrases = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
| ExploLimits = |
|
|
| PEL = }} |
|
|
| Section8 = {{Chembox Explosive |
|
|
| ShockSens = |
|
|
| FrictionSens = |
|
|
| ExplosiveV = 7,350 m·s<sup>−1</sup> at ρ 1.70 |
|
|
| REFactor = }} |
|
}} |
|
}} |
Y verify (what is ?)
Infobox references
