| Revision as of 19:36, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 464466940 of page AMPA for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').← Previous edit |
Revision as of 19:36, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 460649403 of page AMPT for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 447384724 |
|
| Verifiedfields = changed |
|
|
|
| IUPAC_name = 2-amino-3-(4-hydroxyphenyl)-2-methylpropanoic acid |
| ⚫ |
| verifiedrevid = 464364201 |
|
|
|
| image = AMPT-2d-skeletal.png |
|
| ImageFile = AMPA.svg |
|
|
| ImageSize = 200px |
|
| width = 150 |
|
|
|
|
| IUPACName = 2-amino-3-(5-methyl-3-oxo-1,2-<br>oxazol-4-yl)propanoic acid |
|
|
|
<!--Clinical data--> |
|
| OtherNames = |
|
|
|
| tradename = |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| pregnancy_AU = |
|
| InChIKey = UUDAMDVQRQNNHZ-UHFFFAOYAT |
|
|
|
| pregnancy_US = |
| ⚫ |
| CASNo_Ref = {{cascite|changed|??}} |
|
|
|
| pregnancy_category = |
| ⚫ |
| CASNo = <!-- blanked - oldvalue: 77521-29-0 --> |
|
|
|
| legal_status = |
| ⚫ |
| PubChem = 1221 |
|
|
|
| routes_of_administration = |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
|
|
|
| ChEMBL = 13378 |
|
|
|
<!--Pharmacokinetic data--> |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
|
| bioavailability = |
|
| DrugBank = DB02057 |
|
|
|
| metabolism = |
| ⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
|
| elimination_half-life = |
|
| KEGG = C11033 |
|
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CASNo_Ref = {{cascite|??|??}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 658-48-0 --> |
|
⚫ |
| PubChem = 3125 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 3013 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = X88TTO174Z |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=10 | H=13 | N=1 | O=3 |
|
|
| molecular_weight = 195.215 g/mol |
|
|
| smiles = O=C(O)C(N)(Cc1ccc(O)cc1)C |
|
|
| InChI = 1/C10H13NO3/c1-10(11,9(13)14)6-7-2-4-8(12)5-3-7/h2-5,12H,6,11H2,1H3,(H,13,14) |
|
|
| InChIKey = NHTGHBARYWONDQ-UHFFFAOYAH |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C7H10N2O4/c1-3-4(6(10)9-13-3)2-5(8)7(11)12/h5H,2,8H2,1H3,(H,9,10)(H,11,12) |
|
| StdInChI = 1S/C10H13NO3/c1-10(11,9(13)14)6-7-2-4-8(12)5-3-7/h2-5,12H,6,11H2,1H3,(H,13,14) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = UUDAMDVQRQNNHZ-UHFFFAOYSA-N |
|
| StdInChIKey = NHTGHBARYWONDQ-UHFFFAOYSA-N |
|
| SMILES = O=C1/C(=C(\ON1)C)CC(N)C(=O)O |
|
|
| InChI = 1/C7H10N2O4/c1-3-4(6(10)9-13-3)2-5(8)7(11)12/h5H,2,8H2,1H3,(H,9,10)(H,11,12) |
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ⚫ |
| ChemSpiderID = 1184 |
|
|
| MeSHName = AMPA |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
| ⚫ |
| C=7|H=10|N=2|O=4 |
|
|
| MolarMass = 186.17 g/mol |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = |
|
|
| BoilingPt = |
|
|
}} |
|
|
| Section3 = {{Chembox Hazards |
|
|
| Solubility = |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
}} |
|
|
}} |
|
}} |
